Ontology mapping
- Primary identifier
-
CHEBI:28262 - Ontology label
- dimethyl sulfoxide
- kg-microbe node
CHEBI:28262
Synonyms (14)
| Synonym | Type | Source | Occurrences |
|---|---|---|---|
| Role: Solvating media; Properties: Simple component, Organic compound, Defined component | RAW_TEXT | CultureMech | |
| (CH3)2SO | EXACT_SYNONYM | kg_microbe | |
| (methanesulfinyl)methane | EXACT_SYNONYM | kg_microbe | |
| DMSO | EXACT_SYNONYM | kg_microbe | |
| Dimethylsulfoxid | EXACT_SYNONYM | kg_microbe | |
| S(O)Me2 | EXACT_SYNONYM | kg_microbe | |
| dimethyl sulfur oxide | EXACT_SYNONYM | kg_microbe | |
| dimethyl sulphoxide | EXACT_SYNONYM | kg_microbe | |
| dimethyli sulfoxidum | EXACT_SYNONYM | kg_microbe | |
| dimethylsulfoxyde | EXACT_SYNONYM | kg_microbe | |
| dimetil sulfoxido | EXACT_SYNONYM | kg_microbe | |
| methylsulfinylmethane | EXACT_SYNONYM | kg_microbe | |
| sulfinylbis(methane) | EXACT_SYNONYM | kg_microbe | |
| dimethyl sulfoxide (DMSO) | RAW_TEXT | culturemech:output/ingredient_occurrences.tsv |
Chemical properties
- Cas rn
- 67-68-5
- Data source
- PubChem API
- Retrieval date
- 2026-04-05T19:51:50.575664+00:00
- Molecular formula
- C2H6OS
- Inchi
- InChI=1S/C2H6OS/c1-4(2)3/h1-2H3
- Smiles
- CS(C)=O
Evidence (1)
DATABASE_MATCH
via CultureMech
Imported from CultureMech pipeline, quality=DIRECT_MATCH
Occurrence statistics
- Total occurrences
- 161
- Distinct media
- 161
Curation history
| Timestamp | Curator | Action | New status | Changes |
|---|---|---|---|---|
| 2026-03-09T06:54:18.022301+00:00 | import_from_culturemech | IMPORTED | MAPPED | Initial import from CultureMech pipeline |
| 2026-04-05T19:51:50.575719+00:00 | fetch_cas_rn_from_pubchem | ADDED_CAS_RN | MAPPED | Added CAS-RN:67-68-5 from PubChem API via name lookup (Dimethyl sulfoxide) |
| 2026-04-18T00:00:00+00:00 | cbclaw_kg_microbe_sweep LLM | ADDED_SYNONYMS | MAPPED | Added 12 synonyms from kg-microbe P4.4 enrichment: (CH3)2SO, (methanesulfinyl)methane, DMSO, Dimethylsulfoxid, S(O)Me2, ... (7 more) |
| 2026-05-01T07:35:33.281743+00:00 | auto_classify_ingredient_type | AUTO_CLASSIFY_INGREDIENT_TYPE | set ingredient_type=SINGLE_INGREDIENT (CHEBI primary) | |
| 2026-05-01T08:08:29.225174+00:00 | auto_classify_ingredient_type | AUTO_BACKFILL_CHEBI_CHEMISTRY | molecular_formula=C2H6OS; inchi=InChI=1S/C2H6OS/c1-4(2)3/h1-2H3; smiles=CS(C)=O | |
| 2026-05-02T03:12:14.043781+00:00 | auto_classify_ingredient_type | AUTO_CLASSIFY_INGREDIENT_TYPE | set ingredient_type=SINGLE_INGREDIENT (chemical structure populated (molecular_formula)) | |
| 2026-05-29T23:35:36.110958+00:00 | extract_roles_from_synonyms | ANNOTATED | Added media role: SALT (confidence: 1.00) | |
| 2026-06-09T05:23:46.756679+00:00 | correct_stale_ontology_labels.py | CORRECTED | ontology_label 'Dimethyl sulfoxide' -> 'dimethyl sulfoxide': synced to canonical CHEBI label (preferred_term 'Dimethyl sulfoxide' unchanged). | |
| 2026-07-20T00:00:00+00:00 | migrate_media_roles_to_facets | CORRECTED | Dropped media_roles role SALT: legacy media_roles SALT assignment dropped during the #128 facet migration: this ingredient is not a salt contributing ionic strength or osmotic balance, so the assignment was a mis-curation rather than a role to rehome. Re-curate onto PhysicochemicalRoleEnum.OSMOTIC_AGENT only if warranted. | |
| 2026-08-27T03:16:39.518738+00:00 | refresh_occurrence_statistics | CORRECTED | occurrence_statistics 50/159 -> 161/161 (media_count/total_occurrences), derived from distinct CultureMech recipe ids in the #337 occurrence table. The prior values came from the importer retired in #453, whose media_count counted a list truncated to 50 examples (#449). [source=ingredient_occurrences.tsv culturemech_rev=15a4da5c08 rows=194137 distinct_recipes=15257] | |
| 2026-08-30T04:48:06.233536+00:00 | claude_culturemech_alias_backfill | ADDED_SYNONYMS | Added 1 CultureMech recipe surface form(s) that folded onto this record's published label but were absent from MIM's label index, so CultureMech could not resolve them: 'dimethyl sulfoxide (DMSO)' (x1 CultureMech mentions). Source: culturemech:output/ingredient_occurrences.tsv. |