Ontology mapping
- Primary identifier
-
CHEBI:16494 - Ontology label
- lipoic acid
- kg-microbe node
CHEBI:16494
Nutritional roles
- Role
- VITAMIN_SOURCE
- Confidence
- 1.0
- Evidence
- Reference text
- CultureMech database (1399 occurrences as 'Growth factor')
- Reference type
- DATABASE_ENTRY
- Url
- https://github.com/CultureBotAI/CultureMech
- Excerpt
- Role: Growth factor; Properties: Defined component, Simple component, Organic compound
- Curator note
- Widespread use in media formulations (1399 occurrences). High confidence based on 'Defined component' property.
Synonyms (29)
| Synonym | Type | Source | Occurrences |
|---|---|---|---|
| Role: Growth factor; Properties: Organic compound, Defined component, Simple component | RAW_TEXT | CultureMech | |
| 1,2-dithiolane-3-pentanoic acid | EXACT_SYNONYM | kg_microbe | |
| 1,2-dithiolane-3-valeric acid | EXACT_SYNONYM | kg_microbe | |
| 5-(1,2-dithiolan-3-yl)pentanoic acid | EXACT_SYNONYM | kg_microbe | |
| 5-(1,2-dithiolan-3-yl)valeric acid | EXACT_SYNONYM | kg_microbe | |
| 5-(dithiolan-3-yl)valeric acid | EXACT_SYNONYM | kg_microbe | |
| 5-[3-(1,2-dithiolanyl)]pentanoic acid | EXACT_SYNONYM | kg_microbe | |
| 6,8-thioctic acid | EXACT_SYNONYM | kg_microbe | |
| 6,8-thiotic acid | EXACT_SYNONYM | kg_microbe | |
| 6-thioctic acid | EXACT_SYNONYM | kg_microbe | |
| 6-thiotic acid | EXACT_SYNONYM | kg_microbe | |
| Acetate-replacing factor | EXACT_SYNONYM | kg_microbe | |
| Biletan | EXACT_SYNONYM | kg_microbe | |
| DL-6,8-thioctic acid | EXACT_SYNONYM | kg_microbe | |
| DL-alpha-lipoic acid | EXACT_SYNONYM | kg_microbe | |
| Thioctansaeure | EXACT_SYNONYM | kg_microbe | |
| Thioctsaeure | EXACT_SYNONYM | kg_microbe | |
| Thioktsaeure | EXACT_SYNONYM | kg_microbe | |
| alpha-Liponsaeure | EXACT_SYNONYM | kg_microbe | |
| liponic acid | EXACT_SYNONYM | kg_microbe | |
| Lipoic acid | EXACT_SYNONYM | merged_from_duplicate_mim_record | |
| alpha-lipoic acid | EXACT_SYNONYM | merged_from_duplicate_mim_record | |
| Role: Growth factor; Properties: Defined component, Simple component, Organic compound | RAW_TEXT | CultureMech | |
| Role: Vitamin; Properties: Organic compound, Defined component, Simple component | RAW_TEXT | CultureMech | |
| Lipoate | EXACT | manual | |
| Thioctic acid | RAW_TEXT | MERGED_FROM_CHEBI:30314 | |
| α-lipoic acid | RAW_TEXT | MERGED_FROM_CHEBI:43796 | |
| α--Lipoic acid | RAW_TEXT | MERGED_FROM_CHEBI:43796 | |
| D,L-6,8-Thioctic Acid | RAW_TEXT | MERGED_FROM_CHEBI:43796 |
Chemical properties
- Cas rn
- 1077-28-7
- Data source
- PubChem (via CHEBI:16494)
- Retrieval date
- 2026-04-09T00:32:50.689620+00:00
- Molecular formula
- C8H14O2S2
- Inchi
- InChI=1S/C8H14O2S2/c9-8(10)4-2-1-3-7-5-6-11-12-7/h7H,1-6H2,(H,9,10)
- Smiles
- O=C(O)CCCCC1CCSS1
Evidence (2)
DATABASE_MATCH
via CultureMech
Imported from CultureMech pipeline, quality=DIRECT_MATCH
CURATOR_JUDGMENT
via MIM curation (#454)
The Thioctic acid, alpha-lipoic acid, and D,L-6,8-Thioctic Acid source labels name generic or racemic lipoic/thioctic acid rather than R- or S-only lipoic acid.
Occurrence statistics
- Total occurrences
- 1,748
- Distinct media
- 1,747
Curation history
| Timestamp | Curator | Action | New status | Changes |
|---|---|---|---|---|
| 2026-03-09T06:54:18.022301+00:00 | import_from_culturemech | IMPORTED | MAPPED | Initial import from CultureMech pipeline |
| 2026-04-05T19:51:03.959053+00:00 | fetch_cas_rn_from_pubchem | ADDED_CAS_RN | MAPPED | Added CAS-RN:1077-28-7 from PubChem API via name lookup (alpha-lipoic acid) |
| 2026-04-05T21:48:45.295350+00:00 | fetch_cas_rn_from_culturebot_csv | ADDED_CAS_RN | MAPPED | Added CAS-RN:1077-28-7 from CultureBotHT compounds_to_cas.csv (matched: Lipoic acid) |
| 2026-04-09T00:32:50.689620+00:00 | enrich_mim_cas_rn_batch | CAS_RN_ADDED | MAPPED | Added CAS-RN 1077-28-7 from PubChem (via CHEBI:16494) |
| 2026-04-17T12:00:00+00:00 | synonym_expansion_cbclaw LLM | ADDED_SYNONYMS | MAPPED | Added 1 synonym for unmapped CultureMech surface form |
| 2026-04-18T00:00:00+00:00 | cbclaw_kg_microbe_sweep LLM | ADDED_SYNONYMS | MAPPED | Added 19 synonyms from kg-microbe P4.4 enrichment: 1,2-dithiolane-3-pentanoic acid, 1,2-dithiolane-3-valeric acid, 5-(1,2-dithiolan-3-yl)pentanoic acid, 5-(1,2-dithiolan-3-yl)valeric acid, 5-(dithiolan-3-yl)valeric acid, ... (14 more) |
| 2026-04-18T00:00:00+00:00 | cbclaw_kg_microbe_sweep LLM | ADDED_SYNONYMS | MAPPED | Added 20 synonyms from kg-microbe P4.4 enrichment: (DL)-alpha-Lipoic acid, 1,2-dithiolane-3-pentanoic acid, 1,2-dithiolane-3-valeric acid, 5-(1,2-dithiolan-3-yl)pentanoic acid, 5-(1,2-dithiolan-3-yl)valeric acid, ... (15 more) |
| 2026-04-18T00:00:00+00:00 | cbclaw_kg_microbe_sweep LLM | ADDED_SYNONYMS | MAPPED | Added 19 synonyms from kg-microbe P4.4 enrichment: (DL)-alpha-Lipoic acid, 1,2-dithiolane-3-pentanoic acid, 1,2-dithiolane-3-valeric acid, 5-(1,2-dithiolan-3-yl)pentanoic acid, 5-(1,2-dithiolan-3-yl)valeric acid, ... (14 more) |
| 2026-04-19T07:39:23.955331+00:00 | audit_mim_merge | MERGED_FROM_DUPLICATES | MAPPED | Absorbed 4 duplicate MIM record(s) into this one: Lipoic_Acid.yaml, Alpha-lipoic_Acid.yaml, Dl-68-thioctic_Acid.yaml, Dl-alpha-lipoic_Acid_2.yaml. Synonyms, curation_history, and occurrence counts were unioned/summed; winner selected by highest occurrence count with preferred_term readability tie-break. |
| 2026-05-01T07:35:33.335201+00:00 | auto_classify_ingredient_type | AUTO_CLASSIFY_INGREDIENT_TYPE | set ingredient_type=SINGLE_INGREDIENT (CHEBI primary) | |
| 2026-05-01T08:08:29.303356+00:00 | auto_classify_ingredient_type | AUTO_BACKFILL_CHEBI_CHEMISTRY | molecular_formula=C8H14O2S2; inchi=InChI=1S/C8H14O2S2/c9-8(10)4-2-1-3-7-5-6-11-12-7/h; smiles=O=C(O)CCCCC1CCSS1 | |
| 2026-05-02T03:12:14.110613+00:00 | auto_classify_ingredient_type | AUTO_CLASSIFY_INGREDIENT_TYPE | set ingredient_type=SINGLE_INGREDIENT (chemical structure populated (molecular_formula)) | |
| 2026-05-29T23:35:36.110999+00:00 | extract_roles_from_synonyms | ANNOTATED | Added media role: VITAMIN_SOURCE (confidence: 1.00) | |
| 2026-06-09T05:23:46.757782+00:00 | correct_stale_ontology_labels.py | CORRECTED | ontology_label '(DL)-alpha-Lipoic acid' -> 'lipoic acid': synced to canonical CHEBI label (preferred_term '(DL)-alpha-Lipoic acid' unchanged). | |
| 2026-07-20T00:00:00+00:00 | migrate_media_roles_to_facets | ANNOTATED | Migrated legacy media_roles to role facets (#128): VITAMIN_SOURCE -> nutritional_roles.VITAMIN_SOURCE | |
| 2026-08-27T03:16:39.518756+00:00 | refresh_occurrence_statistics | CORRECTED | occurrence_statistics 157/1399 -> 1700/1701 (media_count/total_occurrences), derived from distinct CultureMech recipe ids in the #337 occurrence table. The prior values came from the importer retired in #453, whose media_count counted a list truncated to 50 examples (#449). [source=ingredient_occurrences.tsv culturemech_rev=15a4da5c08 rows=194137 distinct_recipes=15257] | |
| 2026-09-11T14:49:05.979520+00:00 | fix_lipoic_stereochemistry | MERGED_FROM_MAPPED_RECORD | MAPPED | Absorbed generic/racemic Thioctic acid and alpha-lipoic acid records from CHEBI:30314/CHEBI:43796; carried 4 observed source label(s), kept R/S-only target synonyms as REJECTED_LABEL provenance on the tombstones, moved 47/47 occurrences, and retargeted 2 component reference(s) (#454/#634). |