Ontology mapping
- Primary identifier
-
CHEBI:16135 - Ontology label
- isobutyric acid
- kg-microbe node
CHEBI:16135
Nutritional roles
- Role
- CARBON_SOURCE
- Confidence
- 1.0
- Evidence
- Reference type
- DATABASE_ENTRY
- Reference text
- Imported from CultureMech pipeline
- Curator note
- Original role text: Carbon Source
Synonyms (17)
| Synonym | Type | Source | Occurrences |
|---|---|---|---|
| Role: Carbon source; Properties: Defined component, Organic compound, Simple component | RAW_TEXT | CultureMech | |
| Role: Carbon source; Properties: Defined component, Simple component, Organic compound | RAW_TEXT | CultureMech | |
| Role: Carbon source; Properties: Organic compound, Defined component, Simple component | RAW_TEXT | CultureMech | |
| 2,2-dimethylacetic acid | EXACT_SYNONYM | kg_microbe | |
| 2-METHYL-PROPIONIC ACID | EXACT_SYNONYM | kg_microbe | |
| 2-Methylpropanoic acid | EXACT_SYNONYM | kg_microbe | |
| 2-Methylpropionsaeure | EXACT_SYNONYM | kg_microbe | |
| Dimethylacetic acid | EXACT_SYNONYM | kg_microbe | |
| Isobuttersaeure | EXACT_SYNONYM | kg_microbe | |
| alpha-isobutyric acid | EXACT_SYNONYM | kg_microbe | |
| alpha-methylpropanoic acid | EXACT_SYNONYM | kg_microbe | |
| alpha-methylpropionic acid | EXACT_SYNONYM | kg_microbe | |
| iso-Butyric acid | EXACT_SYNONYM | kg_microbe | |
| iso-C3H7COOH | EXACT_SYNONYM | kg_microbe | |
| isobutanoic acid | EXACT_SYNONYM | kg_microbe | |
| isopropylformic acid | EXACT_SYNONYM | kg_microbe | |
| 2-Methylpropanoate | EXACT_SYNONYM | chebi_synonym_review |
Chemical properties
- Cas rn
- 79-31-2
- Data source
- CultureBotHT compounds_to_cas.csv
- Retrieval date
- 2026-04-05T21:48:45.200004+00:00
- Molecular formula
- C4H8O2
- Inchi
- InChI=1S/C4H8O2/c1-3(2)4(5)6/h3H,1-2H3,(H,5,6)
- Smiles
- CC(C)C(=O)O
Evidence (1)
DATABASE_MATCH
via CultureMech
Imported from CultureMech pipeline, quality=DIRECT_MATCH
Occurrence statistics
- Total occurrences
- 116
- Distinct media
- 116
Curation history
| Timestamp | Curator | Action | New status | Changes |
|---|---|---|---|---|
| 2026-03-09T06:54:18.022301+00:00 | import_from_culturemech | IMPORTED | MAPPED | Initial import from CultureMech pipeline |
| 2026-04-05T21:48:45.200010+00:00 | fetch_cas_rn_from_culturebot_csv | ADDED_CAS_RN | MAPPED | Added CAS-RN:79-31-2 from CultureBotHT compounds_to_cas.csv (matched: Isobutyric acid) |
| 2026-04-09T00:32:50.689620+00:00 | enrich_mim_cas_rn_batch | CAS_RN_ADDED | MAPPED | Added CAS-RN 79-31-2 from CultureBotHT/compounds_to_cas.csv |
| 2026-04-18T00:00:00+00:00 | cbclaw_kg_microbe_sweep LLM | ADDED_SYNONYMS | MAPPED | Added 13 synonyms from kg-microbe P4.4 enrichment: 2,2-dimethylacetic acid, 2-METHYL-PROPIONIC ACID, 2-Methylpropanoic acid, 2-Methylpropionsaeure, Dimethylacetic acid, ... (8 more) |
| 2026-04-19T07:39:23.955331+00:00 | audit_mim_merge | MERGED_FROM_DUPLICATES | MAPPED | Absorbed 1 duplicate MIM record(s) into this one: Iso-butyric_Acid.yaml. Synonyms, curation_history, and occurrence counts were unioned/summed; winner selected by highest occurrence count with preferred_term readability tie-break. |
| 2026-05-01T07:35:34.093976+00:00 | auto_classify_ingredient_type | AUTO_CLASSIFY_INGREDIENT_TYPE | set ingredient_type=SINGLE_INGREDIENT (CHEBI primary) | |
| 2026-05-01T08:08:30.085212+00:00 | auto_classify_ingredient_type | AUTO_BACKFILL_CHEBI_CHEMISTRY | molecular_formula=C4H8O2; inchi=InChI=1S/C4H8O2/c1-3(2)4(5)6/h3H,1-2H3,(H,5,6); smiles=CC(C)C(=O)O | |
| 2026-05-02T03:12:15.155575+00:00 | auto_classify_ingredient_type | AUTO_CLASSIFY_INGREDIENT_TYPE | set ingredient_type=SINGLE_INGREDIENT (chemical structure populated (molecular_formula)) | |
| 2026-05-29T23:35:36.111447+00:00 | extract_roles_from_synonyms | ANNOTATED | Added media role: CARBON_SOURCE (confidence: 1.00) | |
| 2026-06-09T05:23:46.778550+00:00 | correct_stale_ontology_labels.py | CORRECTED | ontology_label 'Isobutyric acid' -> 'isobutyric acid': synced to canonical CHEBI label (preferred_term 'Isobutyric acid' unchanged). | |
| 2026-07-20T00:00:00+00:00 | migrate_media_roles_to_facets | ANNOTATED | Migrated legacy media_roles to role facets (#128): CARBON_SOURCE -> nutritional_roles.CARBON_SOURCE | |
| 2026-08-27T03:16:39.519030+00:00 | refresh_occurrence_statistics | CORRECTED | occurrence_statistics 73/85 -> 116/116 (media_count/total_occurrences), derived from distinct CultureMech recipe ids in the #337 occurrence table. The prior values came from the importer retired in #453, whose media_count counted a list truncated to 50 examples (#449). [source=ingredient_occurrences.tsv culturemech_rev=15a4da5c08 rows=194137 distinct_recipes=15257] |