Ontology mapping
- Primary identifier
-
CHEBI:17015 - Ontology label
- riboflavin
- kg-microbe node
CHEBI:17015
Nutritional roles
- Role
- VITAMIN_SOURCE
- Confidence
- 1.0
- Evidence
- Reference text
- CultureMech database (1837 occurrences as 'Vitamin')
- Reference type
- DATABASE_ENTRY
- Url
- https://github.com/CultureBotAI/CultureMech
- Excerpt
- Role: Vitamin; Properties: Defined component, Organic compound, Simple component
- Curator note
- Widespread use in media formulations (1837 occurrences). High confidence based on 'Defined component' property.
Synonyms (30)
| Synonym | Type | Source | Occurrences |
|---|---|---|---|
| Cross-references: KEGG:ribflv | RAW_TEXT | CultureMech | |
| Role: Vitamin; Properties: Defined component, Organic compound, Simple component | RAW_TEXT | CultureMech | |
| Role: Vitamin; Properties: Defined component, Simple component, Organic compound | RAW_TEXT | CultureMech | |
| Role: Vitamin; Properties: Organic compound, Defined component, Simple component | RAW_TEXT | CultureMech | |
| 1-deoxy-1-(7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl)-D-ribitol | EXACT_SYNONYM | kg_microbe | |
| 1-deoxy-1-(7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl)pentitol | EXACT_SYNONYM | kg_microbe | |
| 5-deoxy-5-(7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl)-D-ribitol | EXACT_SYNONYM | kg_microbe | |
| 6,7-dimethyl-9-D-ribitylisoalloxazine | EXACT_SYNONYM | kg_microbe | |
| 7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)benzo[g]pteridine-2,4(3H,10H)-dione | EXACT_SYNONYM | kg_microbe | |
| 7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)isoalloxazine | EXACT_SYNONYM | kg_microbe | |
| 7,8-dimethyl-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4(3H,10H)-dione | EXACT_SYNONYM | kg_microbe | |
| 7,8-dimethyl-10-ribitylisoalloxazine | EXACT_SYNONYM | kg_microbe | |
| Aqua-Flave | EXACT_SYNONYM | kg_microbe | |
| Beflavin | EXACT_SYNONYM | kg_microbe | |
| Beflavine | EXACT_SYNONYM | kg_microbe | |
| Bisulase | EXACT_SYNONYM | kg_microbe | |
| Dermadram | EXACT_SYNONYM | kg_microbe | |
| E101 | EXACT_SYNONYM | kg_microbe | |
| Fiboflavin | EXACT_SYNONYM | kg_microbe | |
| Flavaxin | EXACT_SYNONYM | kg_microbe | |
| Flavin Bb | EXACT_SYNONYM | kg_microbe | |
| Flaxain | EXACT_SYNONYM | kg_microbe | |
| Hyflavin | EXACT_SYNONYM | kg_microbe | |
| Riboflavine | EXACT_SYNONYM | kg_microbe | |
| Riboflavine (B2) | EXACT_SYNONYM | kg_microbe | |
| Riboflavin (Vitamine B2) | RAW_TEXT | culturemech:output/ingredient_occurrences.tsv | |
| Riboflavin (Vitamin B2) | RAW_TEXT | culturemech:output/ingredient_occurrences.tsv | |
| Riboflavin (0.2 mg/ml) | RAW_TEXT | culturemech:output/ingredient_occurrences.tsv | |
| Riboflavin (see below) | RAW_TEXT | culturemech:output/ingredient_occurrences.tsv | |
| Riboflavin (0.05 μg/mL) | RAW_TEXT | culturemech:output/ingredient_occurrences.tsv |
Chemical properties
- Cas rn
- 83-88-5
- Data source
- PubChem API
- Retrieval date
- 2026-04-05T19:53:48.746551+00:00
- Molecular formula
- C17H20N4O6
- Inchi
- InChI=1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15/h3-4,11-12,14,22-25H,5-6H2,1-2H3,(H,20,26,27)/t11-,12+,14-/m0/s1
- Smiles
- Cc1cc2nc3c(=O)nc(=O)nc-3n(C[C@H](O)[C@H](O)[C@H](O)CO)c2cc1C
Evidence (2)
DATABASE_MATCH
via CultureMech
Imported from CultureMech pipeline, quality=DIRECT_MATCH
We found that the abundance of Bacteroides cellulosilyticus affects tumor heterogeneity by producing riboflavin that inhibits CERS3 activity, thus delaying CRC progression.
Auto-proposed; curator should rephrase or remove.
Occurrence statistics
- Total occurrences
- 2,123
- Distinct media
- 2,122
Curation history
| Timestamp | Curator | Action | New status | Changes |
|---|---|---|---|---|
| 2026-03-09T06:54:18.022301+00:00 | import_from_culturemech | IMPORTED | MAPPED | Initial import from CultureMech pipeline |
| 2026-04-05T19:53:48.746601+00:00 | fetch_cas_rn_from_pubchem | ADDED_CAS_RN | MAPPED | Added CAS-RN:83-88-5 from PubChem API via name lookup (Riboflavin) |
| 2026-04-05T21:48:45.703391+00:00 | fetch_cas_rn_from_culturebot_csv | ADDED_CAS_RN | MAPPED | Added CAS-RN:83-88-5 from CultureBotHT compounds_to_cas.csv (matched: riboflavin) |
| 2026-04-09T00:32:50.689620+00:00 | enrich_mim_cas_rn_batch | CAS_RN_ADDED | MAPPED | Added CAS-RN 83-88-5 from PubChem (via CHEBI:17015) |
| 2026-04-18T00:00:00+00:00 | cbclaw_kg_microbe_sweep LLM | ADDED_SYNONYMS | MAPPED | Added 20 synonyms from kg-microbe P4.4 enrichment: 1-deoxy-1-(7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl)-D-ribitol, 1-deoxy-1-(7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl)pentitol, 5-deoxy-5-(7,8-dimethyl-2,4-dioxo-3,4-dihydrobenzo[g]pteridin-10(2H)-yl)-D-ribitol, 6,7-dimethyl-9-D-ribitylisoalloxazine, 7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)benzo[g]pteridine-2,4(3H,10H)-dione, ... (15 more) |
| 2026-04-19T07:39:23.955331+00:00 | audit_mim_merge | MERGED_FROM_DUPLICATES | MAPPED | Absorbed 2 duplicate MIM record(s) into this one: Riboflavine.yaml, Riboflavin_2.yaml. Synonyms, curation_history, and occurrence counts were unioned/summed; winner selected by highest occurrence count with preferred_term readability tie-break. |
| 2026-05-01T07:35:36.069178+00:00 | auto_classify_ingredient_type | AUTO_CLASSIFY_INGREDIENT_TYPE | set ingredient_type=SINGLE_INGREDIENT (CHEBI primary) | |
| 2026-05-01T08:08:32.160107+00:00 | auto_classify_ingredient_type | AUTO_BACKFILL_CHEBI_CHEMISTRY | molecular_formula=C17H20N4O6; inchi=InChI=1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23; smiles=Cc1cc2nc3c(=O)nc(=O)nc-3n(C[C@H](O)[C@H](O)[C@H](O | |
| 2026-05-01T08:09:48.123437+00:00 | auto_classify_ingredient_type | APPLY_EVIDENCE_PROPOSAL | added pmid=40609532 from propose-evidence batch | |
| 2026-05-02T03:12:18.114359+00:00 | auto_classify_ingredient_type | AUTO_CLASSIFY_INGREDIENT_TYPE | set ingredient_type=SINGLE_INGREDIENT (chemical structure populated (molecular_formula)) | |
| 2026-05-29T23:35:36.112742+00:00 | extract_roles_from_synonyms | ANNOTATED | Added media role: VITAMIN_SOURCE (confidence: 1.00) | |
| 2026-06-09T05:23:46.827070+00:00 | correct_stale_ontology_labels.py | CORRECTED | ontology_label 'Riboflavin' -> 'riboflavin': synced to canonical CHEBI label (preferred_term 'Riboflavin' unchanged). | |
| 2026-07-20T00:00:00+00:00 | migrate_media_roles_to_facets | ANNOTATED | Migrated legacy media_roles to role facets (#128): VITAMIN_SOURCE -> nutritional_roles.VITAMIN_SOURCE | |
| 2026-08-27T03:16:39.519802+00:00 | refresh_occurrence_statistics | CORRECTED | occurrence_statistics 85/1837 -> 2122/2123 (media_count/total_occurrences), derived from distinct CultureMech recipe ids in the #337 occurrence table. The prior values came from the importer retired in #453, whose media_count counted a list truncated to 50 examples (#449). [source=ingredient_occurrences.tsv culturemech_rev=15a4da5c08 rows=194137 distinct_recipes=15257] | |
| 2026-08-30T04:48:06.233536+00:00 | claude_culturemech_alias_backfill | ADDED_SYNONYMS | Added 4 CultureMech recipe surface form(s) that folded onto this record's published label but were absent from MIM's label index, so CultureMech could not resolve them: 'Riboflavin (Vitamine B2)' (x4 CultureMech mentions); 'Riboflavin (Vitamin B2)' (x2 CultureMech mentions); 'Riboflavin (0.2 mg/ml)' (x1 CultureMech mentions); 'Riboflavin (see below)' (x1 CultureMech mentions). Source: culturemech:output/ingredient_occurrences.tsv. | |
| 2026-08-31T23:56:54.854807+00:00 | claude_culturemech_alias_backfill | ADDED_SYNONYMS | Added 1 CultureMech recipe surface form(s) that folded onto this record's published label but were absent from MIM's label index, so CultureMech could not resolve them: 'Riboflavin (0.05 μg/mL)' (x1 CultureMech mentions). Source: culturemech:output/ingredient_occurrences.tsv. |