Ontology mapping
- Primary identifier
-
CHEBI:66870 - Ontology label
- sodium dithionite
- kg-microbe node
CHEBI:66870
Physicochemical roles
- Role
- REDUCING_AGENT
- Confidence
- 0.8
- Evidence
- Reference type
- COMPUTATIONAL_PREDICTION
- Reference text
- Inferred from curated media-role name pattern
- Curator note
- Provisional role from a curated name-pattern rule; review recommended.
Synonyms (12)
| Synonym | Type | Source | Occurrences |
|---|---|---|---|
| Properties: Defined component, Inorganic compound, Simple component | RAW_TEXT | CultureMech | |
| Properties: Defined component, Simple component, Inorganic compound | RAW_TEXT | CultureMech | |
| disodium dithionite | EXACT_SYNONYM | kg_microbe | |
| sodium hydrosulfite | EXACT_SYNONYM | kg_microbe | |
| sodium sulfoxylate | EXACT_SYNONYM | kg_microbe | |
| Na2S2O4 | RAW_TEXT | merged_record | |
| 5,6-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranosiduronic acid | RAW_TEXT | merged_record | |
| Scutellarein 7-O-beta-D-glucuronide | RAW_TEXT | merged_record | |
| Scutellarein-7-O-beta-D-glucuronide | RAW_TEXT | merged_record | |
| Scutellarein-7-glucuronide | RAW_TEXT | merged_record | |
| Scutellarein-7beta-D-glucuronide | RAW_TEXT | merged_record | |
| Scutellarein-7beta-D-glucuronoside | RAW_TEXT | merged_record |
Chemical properties
- Cas rn
- 7775-14-6
- Data source
- PubChem API
- Retrieval date
- 2026-04-05T19:53:51.419747+00:00
- Molecular formula
- 2Na.O4S2
- Inchi
- InChI=1S/2Na.H2O4S2/c;;1-5(2)6(3)4/h;;(H,1,2)(H,3,4)/q2*+1;/p-2
- Smiles
- O=S([O-])S(=O)[O-].[Na+].[Na+]
Evidence (1)
DATABASE_MATCH
via CultureMech
Imported from CultureMech pipeline, quality=DIRECT_MATCH
Occurrence statistics
- Total occurrences
- 47
- Distinct media
- 47
Curation history
| Timestamp | Curator | Action | New status | Changes |
|---|---|---|---|---|
| 2026-03-09T06:54:18.022301+00:00 | import_from_culturemech | IMPORTED | MAPPED | Initial import from CultureMech pipeline |
| 2026-04-05T19:53:51.419773+00:00 | fetch_cas_rn_from_pubchem | ADDED_CAS_RN | MAPPED | Added CAS-RN:7775-14-6 from PubChem API via name lookup (Sodium dithionite) |
| 2026-04-18T00:00:00+00:00 | cbclaw_kg_microbe_sweep LLM | ADDED_SYNONYMS | MAPPED | Added 3 synonyms from kg-microbe P4.4 enrichment: disodium dithionite, sodium hydrosulfite, sodium sulfoxylate |
| 2026-05-01T07:35:36.248521+00:00 | auto_classify_ingredient_type | AUTO_CLASSIFY_INGREDIENT_TYPE | set ingredient_type=SINGLE_INGREDIENT (CHEBI primary) | |
| 2026-05-01T08:08:32.337175+00:00 | auto_classify_ingredient_type | AUTO_BACKFILL_CHEBI_CHEMISTRY | molecular_formula=2Na.O4S2; inchi=InChI=1S/2Na.H2O4S2/c;;1-5(2)6(3)4/h;;(H,1,2)(H,3,; smiles=O=S([O-])S(=O)[O-].[Na+].[Na+] | |
| 2026-05-02T03:12:18.366467+00:00 | auto_classify_ingredient_type | AUTO_CLASSIFY_INGREDIENT_TYPE | set ingredient_type=SINGLE_INGREDIENT (chemical structure populated (molecular_formula)) | |
| 2026-06-02T07:05:13.393781+00:00 | infer_roles_from_name_lists | ANNOTATED | Added media role: REDUCING_AGENT (confidence: 0.80) | |
| 2026-06-09T05:23:46.833979+00:00 | correct_stale_ontology_labels.py | CORRECTED | ontology_label 'Sodium dithionite' -> 'sodium dithionite': synced to canonical CHEBI label (preferred_term 'Sodium dithionite' unchanged). | |
| 2026-07-20T00:00:00+00:00 | migrate_media_roles_to_facets | ANNOTATED | Migrated legacy media_roles to role facets (#128): REDUCING_AGENT -> physicochemical_roles.REDUCING_AGENT | |
| 2026-08-06T01:37:25.864886+00:00 | reground_263 LLM | MERGED_FROM_MAPPED_RECORD | Absorbed CHEBI:61278 'Na2S2O4': 7 synonym(s), occurrences +25/25. Na2S2O4 and Sodium dithionite are the same substance (CAS 7775-14-6); the Na2S2O4 record's CHEBI:61278 'scutellarin' grounding was wrong (#263) and masked the duplicate | |
| 2026-08-27T03:16:39.519835+00:00 | refresh_occurrence_statistics | CORRECTED | occurrence_statistics 36/36 -> 47/47 (media_count/total_occurrences), derived from distinct CultureMech recipe ids in the #337 occurrence table. The prior values came from the importer retired in #453, whose media_count counted a list truncated to 50 examples (#449). [source=ingredient_occurrences.tsv culturemech_rev=15a4da5c08 rows=194137 distinct_recipes=15257] |