Ontology mapping
- Primary identifier
-
CHEBI:16602 - Ontology label
- trichloroethene
Synonyms (16)
| Synonym | Type | Source | Occurrences |
|---|---|---|---|
| 1,1,2-trichloroethene | EXACT_SYNONYM | kg_microbe | |
| 1,1-dichloro-2-chloroethylene | EXACT_SYNONYM | kg_microbe | |
| Narcogen | EXACT_SYNONYM | kg_microbe | |
| TCE | EXACT_SYNONYM | kg_microbe | |
| Trichloraethen | EXACT_SYNONYM | kg_microbe | |
| Trichloraethylen | EXACT_SYNONYM | kg_microbe | |
| Trichloroethene | EXACT_SYNONYM | kg_microbe | |
| acetylene trichloride | EXACT_SYNONYM | kg_microbe | |
| ethinyl trichloride | EXACT_SYNONYM | kg_microbe | |
| ethylene trichloride | EXACT_SYNONYM | kg_microbe | |
| trichlor | EXACT_SYNONYM | kg_microbe | |
| trichloraethylenum pro narcosi | EXACT_SYNONYM | kg_microbe | |
| trichlorethylene | EXACT_SYNONYM | kg_microbe | |
| trichloroethylenum | EXACT_SYNONYM | kg_microbe | |
| triciene | EXACT_SYNONYM | kg_microbe | |
| Trichloroethylene (10 mg/ml in methanol) | RAW_TEXT | culturemech:output/ingredient_occurrences.tsv |
Chemical properties
- Cas rn
- 79-01-6
- Data source
- PubChem API
- Retrieval date
- 2026-04-05T19:54:07.710132+00:00
- Molecular formula
- C2HCl3
- Inchi
- InChI=1S/C2HCl3/c3-1-2(4)5/h1H
- Smiles
- ClC=C(Cl)Cl
Evidence (1)
DATABASE_MATCH
via CultureMech
Imported from CultureMech pipeline, quality=DIRECT_MATCH
Occurrence statistics
- Total occurrences
- 2
- Distinct media
- 2
Curation history
| Timestamp | Curator | Action | New status | Changes |
|---|---|---|---|---|
| 2026-03-09T06:54:18.022301+00:00 | import_from_culturemech | IMPORTED | MAPPED | Initial import from CultureMech pipeline |
| 2026-04-05T19:54:07.710183+00:00 | fetch_cas_rn_from_pubchem | ADDED_CAS_RN | MAPPED | Added CAS-RN:79-01-6 from PubChem API via name lookup (Trichloroethylene) |
| 2026-04-18T00:00:00+00:00 | cbclaw_kg_microbe_sweep LLM | ADDED_SYNONYMS | MAPPED | Added 15 synonyms from kg-microbe P4.4 enrichment: 1,1,2-trichloroethene, 1,1-dichloro-2-chloroethylene, Narcogen, TCE, Trichloraethen, ... (10 more) |
| 2026-05-01T07:35:36.696680+00:00 | auto_classify_ingredient_type | AUTO_CLASSIFY_INGREDIENT_TYPE | set ingredient_type=SINGLE_INGREDIENT (CHEBI primary) | |
| 2026-05-01T08:08:32.780846+00:00 | auto_classify_ingredient_type | AUTO_BACKFILL_CHEBI_CHEMISTRY | molecular_formula=C2HCl3; inchi=InChI=1S/C2HCl3/c3-1-2(4)5/h1H; smiles=ClC=C(Cl)Cl | |
| 2026-05-02T03:12:18.966632+00:00 | auto_classify_ingredient_type | AUTO_CLASSIFY_INGREDIENT_TYPE | set ingredient_type=SINGLE_INGREDIENT (chemical structure populated (molecular_formula)) | |
| 2026-06-09T05:23:46.845688+00:00 | correct_stale_ontology_labels.py | CORRECTED | ontology_label 'Trichloroethylene' -> 'trichloroethene': synced to canonical CHEBI label (preferred_term 'Trichloroethylene' unchanged). | |
| 2026-08-27T03:16:39.520000+00:00 | refresh_occurrence_statistics | CORRECTED | occurrence_statistics 1/1 -> 2/2 (media_count/total_occurrences), derived from distinct CultureMech recipe ids in the #337 occurrence table. The prior values came from the importer retired in #453, whose media_count counted a list truncated to 50 examples (#449). [source=ingredient_occurrences.tsv culturemech_rev=15a4da5c08 rows=194137 distinct_recipes=15257] | |
| 2026-08-30T04:48:06.233536+00:00 | claude_culturemech_alias_backfill | ADDED_SYNONYMS | Added 1 CultureMech recipe surface form(s) that folded onto this record's published label but were absent from MIM's label index, so CultureMech could not resolve them: 'Trichloroethylene (10 mg/ml in methanol)' (x1 CultureMech mentions). Source: culturemech:output/ingredient_occurrences.tsv. |