Ontology mapping
- Primary identifier
-
CHEBI:28621 - Ontology label
- triethanolamine
- kg-microbe node
CHEBI:28621
Synonyms (10)
| Synonym | Type | Source | Occurrences |
|---|---|---|---|
| Role: Solvating media; Properties: Defined component, Simple component, Organic compound | RAW_TEXT | CultureMech | |
| 2,2',2''-NITRILOTRIETHANOL | EXACT_SYNONYM | kg_microbe | |
| 2,2',2''-nitrilotris(ethanol) | EXACT_SYNONYM | kg_microbe | |
| H3tea | EXACT_SYNONYM | kg_microbe | |
| N(CH2CH2OH)3 | HYDRATE_FORM | kg_microbe | |
| Trolamine | EXACT_SYNONYM | kg_microbe | |
| nitrilo-2,2',2''-triethanol | EXACT_SYNONYM | kg_microbe | |
| nitrilotriethanol | EXACT_SYNONYM | kg_microbe | |
| tris(2-hydroxyethyl)amine | EXACT_SYNONYM | kg_microbe | |
| tris(beta-hydroxyethyl)amine | EXACT_SYNONYM | kg_microbe |
Chemical properties
- Cas rn
- 102-71-6
- Data source
- PubChem API
- Retrieval date
- 2026-04-05T19:54:08.091273+00:00
- Molecular formula
- C6H15NO3
- Inchi
- InChI=1S/C6H15NO3/c8-4-1-7(2-5-9)3-6-10/h8-10H,1-6H2
- Smiles
- OCCN(CCO)CCO
Evidence (1)
DATABASE_MATCH
via CultureMech
Imported from CultureMech pipeline, quality=DIRECT_MATCH
Occurrence statistics
- Total occurrences
- 5
- Distinct media
- 5
Curation history
| Timestamp | Curator | Action | New status | Changes |
|---|---|---|---|---|
| 2026-03-09T06:54:18.022301+00:00 | import_from_culturemech | IMPORTED | MAPPED | Initial import from CultureMech pipeline |
| 2026-04-05T19:54:08.091313+00:00 | fetch_cas_rn_from_pubchem | ADDED_CAS_RN | MAPPED | Added CAS-RN:102-71-6 from PubChem API via name lookup (Triethanolamine) |
| 2026-04-18T00:00:00+00:00 | cbclaw_kg_microbe_sweep LLM | ADDED_SYNONYMS | MAPPED | Added 9 synonyms from kg-microbe P4.4 enrichment: 2,2',2''-NITRILOTRIETHANOL, 2,2',2''-nitrilotris(ethanol), H3tea, N(CH2CH2OH)3, Trolamine, ... (4 more) |
| 2026-05-01T07:35:36.703499+00:00 | auto_classify_ingredient_type | AUTO_CLASSIFY_INGREDIENT_TYPE | set ingredient_type=SINGLE_INGREDIENT (CHEBI primary) | |
| 2026-05-01T08:08:32.787205+00:00 | auto_classify_ingredient_type | AUTO_BACKFILL_CHEBI_CHEMISTRY | molecular_formula=C6H15NO3; inchi=InChI=1S/C6H15NO3/c8-4-1-7(2-5-9)3-6-10/h8-10H,1-6; smiles=OCCN(CCO)CCO | |
| 2026-05-02T03:12:18.975510+00:00 | auto_classify_ingredient_type | AUTO_CLASSIFY_INGREDIENT_TYPE | set ingredient_type=SINGLE_INGREDIENT (chemical structure populated (molecular_formula)) | |
| 2026-05-29T23:35:36.113220+00:00 | extract_roles_from_synonyms | ANNOTATED | Added media role: SALT (confidence: 1.00) | |
| 2026-06-09T05:23:46.845878+00:00 | correct_stale_ontology_labels.py | CORRECTED | ontology_label 'Triethanolamine' -> 'triethanolamine': synced to canonical CHEBI label (preferred_term 'Triethanolamine' unchanged). | |
| 2026-07-20T00:00:00+00:00 | migrate_media_roles_to_facets | CORRECTED | Dropped media_roles role SALT: legacy media_roles SALT assignment dropped during the #128 facet migration: this ingredient is not a salt contributing ionic strength or osmotic balance, so the assignment was a mis-curation rather than a role to rehome. Re-curate onto PhysicochemicalRoleEnum.OSMOTIC_AGENT only if warranted. | |
| 2026-08-27T03:16:39.520005+00:00 | refresh_occurrence_statistics | CORRECTED | occurrence_statistics 4/4 -> 5/5 (media_count/total_occurrences), derived from distinct CultureMech recipe ids in the #337 occurrence table. The prior values came from the importer retired in #453, whose media_count counted a list truncated to 50 examples (#449). [source=ingredient_occurrences.tsv culturemech_rev=15a4da5c08 rows=194137 distinct_recipes=15257] |