Ontology mapping
- Primary identifier
-
CHEBI:18067 - Ontology label
- phylloquinone
Nutritional roles
- Role
- VITAMIN_SOURCE
- Confidence
- 1.0
- Evidence
- Reference type
- DATABASE_ENTRY
- Reference text
- Imported from CultureMech pipeline
- Curator note
- Original role text: Vitamin Source
Synonyms (28)
| Synonym | Type | Source | Occurrences |
|---|---|---|---|
| Role: Vitamin; Properties: Defined component, Organic compound, Simple component | RAW_TEXT | CultureMech | |
| Role: Vitamin; Properties: Defined component, Simple component, Organic compound | RAW_TEXT | CultureMech | |
| Role: Vitamin; Properties: Organic compound, Defined component, Simple component | RAW_TEXT | CultureMech | |
| Role: Vitamin; Properties: Organic compound, Simple component, Defined component | RAW_TEXT | CultureMech | |
| Role: Vitamin; Properties: Simple component, Organic compound, Defined component | RAW_TEXT | CultureMech | |
| 2-Methyl-3-(3,7,11,15-tetramethyl-2-hexadecenyl)-1,4-naphthalenedione | EXACT_SYNONYM | kg_microbe | |
| 2-Methyl-3-[(2E)-3,7,11,15-tetramethyl-2-hexadecenyl]naphthoquinone | EXACT_SYNONYM | kg_microbe | |
| 2-Methyl-3-phytyl-1,4-naphthochinon | EXACT_SYNONYM | kg_microbe | |
| 2-methyl-3-[(2E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-yl]naphthalene-1,4-dione | EXACT_SYNONYM | kg_microbe | |
| 2-methyl-3-phytyl-1,4-naphthoquinone | EXACT_SYNONYM | kg_microbe | |
| 3-phytylmenadione | EXACT_SYNONYM | kg_microbe | |
| Mephyton | EXACT_SYNONYM | kg_microbe | |
| PHYLLOQUINONE | EXACT_SYNONYM | kg_microbe | |
| Phyllochinon | EXACT_SYNONYM | kg_microbe | |
| Phyllochinonum | EXACT_SYNONYM | kg_microbe | |
| Phytonadionum | EXACT_SYNONYM | kg_microbe | |
| Phytylmenadione | EXACT_SYNONYM | kg_microbe | |
| alpha-phylloquinone | EXACT_SYNONYM | kg_microbe | |
| fitomenadiona | EXACT_SYNONYM | kg_microbe | |
| fitomenadione | EXACT_SYNONYM | kg_microbe | |
| phytomenadione | EXACT_SYNONYM | kg_microbe | |
| phytomenadionum | EXACT_SYNONYM | kg_microbe | |
| phytonadione | EXACT_SYNONYM | kg_microbe | |
| Role: Vitamin; Properties: Organic compound, Defined component, Solution | RAW_TEXT | CultureMech | |
| Role: Vitamin; Properties: Organic compound, Solution, Defined component | RAW_TEXT | CultureMech | |
| Role: Vitamin; Properties: Solution, Defined component, Organic compound | RAW_TEXT | CultureMech | |
| Role: Vitamin; Properties: Solution, Organic compound, Defined component | RAW_TEXT | CultureMech | |
| Vitamin K1 (1 mg/ml) | RAW_TEXT | culturemech:output/ingredient_occurrences.tsv |
Chemical properties
- Cas rn
- 84-80-0
- Data source
- PubChem API
- Retrieval date
- 2026-04-05T19:54:13.994579+00:00
- Molecular formula
- C31H46O2
- Inchi
- InChI=1S/C31H46O2/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-27-26(6)30(32)28-18-7-8-19-29(28)31(27)33/h7-8,18-20,22-24H,9-17,21H2,1-6H3/b25-20+/t23-,24-/m1/s1
- Smiles
- CC1=C(C/C=C(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C(=O)c2ccccc2C1=O
Evidence (1)
DATABASE_MATCH
via CultureMech
Imported from CultureMech pipeline, quality=DIRECT_MATCH
Occurrence statistics
- Total occurrences
- 127
- Distinct media
- 127
Curation history
| Timestamp | Curator | Action | New status | Changes |
|---|---|---|---|---|
| 2026-03-09T06:54:18.022301+00:00 | import_from_culturemech | IMPORTED | MAPPED | Initial import from CultureMech pipeline |
| 2026-04-05T19:54:13.994603+00:00 | fetch_cas_rn_from_pubchem | ADDED_CAS_RN | MAPPED | Added CAS-RN:84-80-0 from PubChem API via name lookup (Vitamin K1) |
| 2026-04-05T23:47:11.204232+00:00 | fetch_cas_rn_with_preprocessing | ADDED_CAS_RN | MAPPED | Added CAS-RN:84-80-0 from PubChem API (ontology label) via name preprocessing (vitamin K1) |
| 2026-04-18T00:00:00+00:00 | cbclaw_kg_microbe_sweep LLM | ADDED_SYNONYMS | MAPPED | Added 18 synonyms from kg-microbe P4.4 enrichment: 2-Methyl-3-(3,7,11,15-tetramethyl-2-hexadecenyl)-1,4-naphthalenedione, 2-Methyl-3-[(2E)-3,7,11,15-tetramethyl-2-hexadecenyl]naphthoquinone, 2-Methyl-3-phytyl-1,4-naphthochinon, 2-methyl-3-[(2E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-yl]naphthalene-1,4-dione, 2-methyl-3-phytyl-1,4-naphthoquinone, ... (13 more) |
| 2026-04-19T07:39:23.955331+00:00 | audit_mim_merge | MERGED_FROM_DUPLICATES | MAPPED | Absorbed 1 duplicate MIM record(s) into this one: Vitamin_K1_2.yaml. Synonyms, curation_history, and occurrence counts were unioned/summed; winner selected by highest occurrence count with preferred_term readability tie-break. |
| 2026-05-01T07:35:36.875053+00:00 | auto_classify_ingredient_type | AUTO_CLASSIFY_INGREDIENT_TYPE | set ingredient_type=SINGLE_INGREDIENT (CHEBI primary) | |
| 2026-05-01T08:08:32.960137+00:00 | auto_classify_ingredient_type | AUTO_BACKFILL_CHEBI_CHEMISTRY | molecular_formula=C31H46O2; inchi=InChI=1S/C31H46O2/c1-22(2)12-9-13-23(3)14-10-15-24; smiles=CC1=C(C/C=C(C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C(=O) | |
| 2026-05-02T03:12:19.213829+00:00 | auto_classify_ingredient_type | AUTO_CLASSIFY_INGREDIENT_TYPE | set ingredient_type=SINGLE_INGREDIENT (chemical structure populated (molecular_formula)) | |
| 2026-05-29T23:35:36.113339+00:00 | extract_roles_from_synonyms | ANNOTATED | Added media role: VITAMIN_SOURCE (confidence: 1.00) | |
| 2026-06-09T05:23:46.849789+00:00 | correct_stale_ontology_labels.py | CORRECTED | ontology_label 'Vitamin K1' -> 'phylloquinone': synced to canonical CHEBI label (preferred_term 'Vitamin K1' unchanged). | |
| 2026-07-20T00:00:00+00:00 | migrate_media_roles_to_facets | ANNOTATED | Migrated legacy media_roles to role facets (#128): VITAMIN_SOURCE -> nutritional_roles.VITAMIN_SOURCE | |
| 2026-08-27T03:16:39.520141+00:00 | refresh_occurrence_statistics | CORRECTED | occurrence_statistics 57/117 -> 127/127 (media_count/total_occurrences), derived from distinct CultureMech recipe ids in the #337 occurrence table. The prior values came from the importer retired in #453, whose media_count counted a list truncated to 50 examples (#449). [source=ingredient_occurrences.tsv culturemech_rev=15a4da5c08 rows=194137 distinct_recipes=15257] | |
| 2026-08-30T04:48:06.233536+00:00 | claude_culturemech_alias_backfill | ADDED_SYNONYMS | Added 1 CultureMech recipe surface form(s) that folded onto this record's published label but were absent from MIM's label index, so CultureMech could not resolve them: 'Vitamin K1 (1 mg/ml)' (x1 CultureMech mentions). Source: culturemech:output/ingredient_occurrences.tsv. |