elymoclavine
naturalproductmech:mibig-cfd9387f26 MINTED SEEDED
Structure
| Standard InChIKey | DAVNRFCJMIONPO-UKRRQHHQSA-N |
|---|---|
| SMILES | CN1CC(=C[C@H]2[C@H]1CC3=CNC4=CC=CC2=C34)CO |
| Stereochemistry | fully defined |
| Cross-references | pubchem:440904 |
Filing pathway
Alkaloids — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is terpene, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Claviceps fusiformis NCBITaxon:40602 |
SOURCE_ASSERTION | mibig:BGC0001267 | DOI:10.1128/aem.01040-07 |
Occurrences 24
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Jacquemontia tamnifolia NCBITaxon:112277 |
LOTUS | DOI:10.1086/337697 |
| Ipomoea muricata NCBITaxon:231710 |
LOTUS | DOI:10.1086/337697 |
| Ipomoea capillacea NCBITaxon:2490667 |
LOTUS | DOI:10.1086/337697 |
| Turbina corymbosa NCBITaxon:2607118 |
LOTUS | DOI:10.1021/NP070040H |
| Ipomoea violacea NCBITaxon:398502 |
LOTUS | DOI:10.1007/3-540-29719-0_581 |
| Ipomoea violacea NCBITaxon:398502 |
LOTUS | DOI:10.4141/CJPS86-048 |
| Ipomoea purpurea NCBITaxon:4121 |
LOTUS | DOI:10.4141/CJPS86-048 |
| Ipomoea hederacea NCBITaxon:43178 |
LOTUS | DOI:10.4141/CJPS86-048 |
| Balansia strangulans NCBITaxon:45231 |
LOTUS | DOI:10.1021/JF00105A055 |
| Claviceps NCBITaxon:5110 |
LOTUS | DOI:10.1021/JA00059A051 |
| Claviceps NCBITaxon:5110 |
LOTUS | DOI:10.1021/JA00157A046 |
| Claviceps NCBITaxon:5110 |
LOTUS | DOI:10.1021/JA00214A054 |
| Claviceps NCBITaxon:5110 |
LOTUS | DOI:10.1021/JO00228A036 |
| Claviceps NCBITaxon:5110 |
LOTUS | DOI:10.1021/NP50009A003 |
| Claviceps NCBITaxon:5110 |
LOTUS | DOI:10.1021/NP50018A030 |
| Claviceps purpurea NCBITaxon:5111 |
LOTUS | DOI:10.1002/JOBM.3620310209 |
| Claviceps purpurea NCBITaxon:5111 |
LOTUS | DOI:10.1021/NP50074A007 |
| Epichloe typhina NCBITaxon:5113 |
LOTUS | DOI:10.1021/JF00105A055 |
| Balansia epichloe NCBITaxon:51584 |
LOTUS | DOI:10.1021/JF00105A055 |
| Balansia epichloe NCBITaxon:51584 |
LOTUS | DOI:10.1021/NP50003A015 |
| Securidaca longepedunculata NCBITaxon:690845 |
LOTUS | DOI:10.1002/JHET.5570290647 |
| Ipomoea lacunosa NCBITaxon:89647 |
LOTUS | DOI:10.4141/CJPS86-048 |
| Ipomoea lobata NCBITaxon:89650 |
LOTUS | DOI:10.1086/337697 |
| Ipomoea tricolor NCBITaxon:89664 |
LOTUS | DOI:10.1007/3-540-29719-0_581 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0001267 | Claviceps fusiformis NCBITaxon:40602 |
CLUSTER_UNSTATED | genbank:EU006773.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0001267 | MIBIG | 3 |
This page is generated from data/natural_products/alkaloids/elymoclavine.yaml, which is generated from the committed inventories. Neither is edited by hand.