melanin
naturalproductmech:mibig-8d58bfa044 MINTED SEEDED
Structure
| Standard InChIKey | XUMBMVFBXHLACL-UHFFFAOYSA-N |
|---|---|
| SMILES | CC1=C2C3=C(C4=CNC5=C(C(=O)C(=O)C(=C45)C3=CN2)C)C(=O)C1=O |
| Stereochemistry | fully defined |
| Cross-references | pubchem:6325610 |
Filing pathway
Alkaloids — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is other, from MIBiG.
Producer organisms 5
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Streptomyces avermitilis NCBITaxon:33903 |
SOURCE_ASSERTION | mibig:BGC0000908 | PMID:11572948 |
| Streptomyces avermitilis NCBITaxon:33903 |
SOURCE_ASSERTION | mibig:BGC0000909 | PMID:11572948 |
| Streptomyces coelicolor A3(2) NCBITaxon:100226 |
SOURCE_ASSERTION | mibig:BGC0000910 | PMID:12000953 |
| Streptomyces griseus subsp. griseus NBRC 13350 NCBITaxon:455632 |
SOURCE_ASSERTION | mibig:BGC0000911 | PMID:18375553 |
| Streptomyces griseus subsp. griseus NBRC 13350 NCBITaxon:455632 |
SOURCE_ASSERTION | mibig:BGC0000912 | PMID:18375553 |
Occurrences 9
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Bipolaris oryzae NCBITaxon:101162 |
LOTUS | DOI:10.1016/J.FEMSLE.2004.07.007 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1038/417141A |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1038/417141A |
| Streptomyces griseus NCBITaxon:1911 |
LOTUS | DOI:10.1128/JB.00204-08 |
| Streptomyces nodosus NCBITaxon:40318 |
LOTUS | DOI:10.1007/S00253-015-7060-9 |
| Ommastrephes bartramii NCBITaxon:61679 |
LOTUS | DOI:10.1248/CPB.30.1381 |
| Streptomyces spectabilis NCBITaxon:68270 |
LOTUS | DOI:10.1007/S10295-019-02172-8 |
| Streptomyces avermitilis NCBITaxon:33903 |
LOTUS | DOI:10.1021/CB300222B |
| Streptomyces avermitilis NCBITaxon:33903 |
LOTUS | DOI:10.1073/PNAS.211433198 |
Biosynthetic gene clusters 5
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000908 | Streptomyces avermitilis NCBITaxon:33903 |
CLUSTER_UNSTATED | genbank:AB070938.1 |
| mibig:BGC0000909 | Streptomyces avermitilis NCBITaxon:33903 |
CLUSTER_UNSTATED | genbank:AB070939.1 |
| mibig:BGC0000910 | Streptomyces coelicolor A3(2) NCBITaxon:100226 |
CLUSTER_UNSTATED | genbank:AL645882.2 |
| mibig:BGC0000911 | Streptomyces griseus subsp. griseus NBRC 13350 NCBITaxon:455632 |
CLUSTER_UNSTATED | genbank:AP009493.1 |
| mibig:BGC0000912 | Streptomyces griseus subsp. griseus NBRC 13350 NCBITaxon:455632 |
CLUSTER_UNSTATED | genbank:AP009493.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Open questions 1
shared-structure — This structure is reported by more than one MIBiG entry: BGC0000908, BGC0000909, BGC0000910, BGC0000911, BGC0000912. Confirm they describe the same compound rather than an upstream cross-reference error.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000908 | MIBIG | 3 |
| BGC0000909 | MIBIG | 3 |
| BGC0000910 | MIBIG | 3 |
| BGC0000911 | MIBIG | 3 |
| BGC0000912 | MIBIG | 3 |
This page is generated from data/natural_products/alkaloids/melanin.yaml, which is generated from the committed inventories. Neither is edited by hand.