nikkomycin Z
CHEBI:623918 EXACT SEEDED antifungal
A uridine-based nucleoside-peptide antibiotic which inhibits fungal chitin biosynthesis by inhibiting chitin synthase.
Structure
| Standard InChIKey | WWJFFVUVFNBJTN-VHDFTHOZSA-N |
|---|---|
| SMILES | [H][C@@](N)(C(=O)N[C@]([H])(C(O)=O)[C@@]1([H])O[C@H]([C@H](O)[C@@H]1O)N1C=CC(=O)NC1=O)[C@]([H])(C)[C@]([H])(O)C1=NC=C(O)C=C1 |
| Stereochemistry | fully defined |
| Cross-references | npatlas:NPA015863 |
Filing pathway
Alkaloids — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is other, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Streptomyces tendae NCBITaxon:1932 |
SOURCE_ASSERTION | mibig:BGC0000876 | PMID:10712601 |
Occurrences 25
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Streptomyces ansochromogenes NCBITaxon:115647 |
LOTUS | DOI:10.1007/S00284-001-0115-4 |
| Streptomyces ansochromogenes NCBITaxon:115647 |
LOTUS | DOI:10.1007/S00284-002-3892-5 |
| Streptomyces ansochromogenes NCBITaxon:115647 |
LOTUS | DOI:10.1007/S00284-004-4260-4 |
| Streptomyces ansochromogenes NCBITaxon:115647 |
LOTUS | DOI:10.1007/S002840010141 |
| Streptomyces ansochromogenes NCBITaxon:115647 |
LOTUS | DOI:10.1016/J.BBRC.2007.08.114 |
| Streptomyces ansochromogenes NCBITaxon:115647 |
LOTUS | DOI:10.1016/J.YMBEN.2005.12.002 |
| Streptomyces ansochromogenes NCBITaxon:115647 |
LOTUS | DOI:10.1046/J.1472-765X.2003.01296.X |
| Streptomyces ansochromogenes NCBITaxon:115647 |
LOTUS | DOI:10.1046/J.1472-765X.2003.01426.X |
| Streptomyces ansochromogenes NCBITaxon:115647 |
LOTUS | DOI:10.1099/MIC.0.033605-0 |
| Streptomyces ansochromogenes NCBITaxon:115647 |
LOTUS | DOI:10.1111/J.1365-2958.2009.06681.X |
| Streptomyces ansochromogenes NCBITaxon:115647 |
LOTUS | DOI:10.1186/1471-2180-11-164 |
| Streptomyces ansochromogenes NCBITaxon:115647 |
LOTUS | DOI:10.1186/1475-2859-11-135 |
| Streptomyces ansochromogenes NCBITaxon:115647 |
LOTUS | DOI:10.1186/1475-2859-9-6 |
| Streptomyces scabiei NCBITaxon:1930 |
LOTUS | DOI:10.1128/AEM.01169-17 |
| Streptomyces tendae NCBITaxon:1932 |
LOTUS | DOI:10.1007/BF00170179 |
| Streptomyces tendae NCBITaxon:1932 |
LOTUS | DOI:10.1007/BF00170913 |
| Streptomyces tendae NCBITaxon:1932 |
LOTUS | DOI:10.1007/BF00205028 |
| Streptomyces tendae NCBITaxon:1932 |
LOTUS | DOI:10.1007/BF00903777 |
| Streptomyces tendae NCBITaxon:1932 |
LOTUS | DOI:10.1007/PL00008637 |
| Streptomyces tendae NCBITaxon:1932 |
LOTUS | DOI:10.1007/S004380000352 |
| Streptomyces tendae NCBITaxon:1932 |
LOTUS | DOI:10.1007/S00449-010-0471-1 |
| Streptomyces tendae NCBITaxon:1932 |
LOTUS | DOI:10.1046/J.1432-1327.1998.2540347.X |
| Streptomyces tendae NCBITaxon:1932 |
LOTUS | DOI:10.1046/J.1432-1327.2000.01162.X |
| Streptomyces tendae NCBITaxon:1932 |
LOTUS | DOI:10.1111/J.1365-2672.1992.TB01823.X |
| Streptomyces tendae NCBITaxon:1932 |
LOTUS | DOI:10.1111/J.1365-2958.1995.TB02269.X |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000876 | Streptomyces tendae NCBITaxon:1932 |
CLUSTER_UNSTATED | genbank:AJ250581.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Elsewhere in the fleet
- AntibioticMech — CHEBI:623918 (same structure, same inchikey)
Open questions 1
name-disagreement — ChEBI calls this structure 'nikkomycin Z' and MIBiG calls it 'neopolyoxin C'. They share a Standard InChIKey, so if the names denote different compounds then one upstream record has the wrong structure. Check which.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000876 | MIBIG | 5 |
| CHEBI:623918 | CHEBI | 3-star |
This page is generated from data/natural_products/alkaloids/nikkomycin-z.yaml, which is generated from the committed inventories. Neither is edited by hand.