prodigiosin
naturalproductmech:mibig-d764a5151a MINTED SEEDED
Structure
| Standard InChIKey | WKGQSEFBQTWRPT-UUPRNIFOSA-N |
|---|---|
| SMILES | CCCCCC1=C(NC(=C1)/C=C\2/C(=C/C(=C/3\C=CC=N3)/N2)OC)C |
| Stereochemistry | fully defined |
| Cross-references | pubchem:5351169 |
Filing pathway
Alkaloids — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is pks, from MIBiG.
Producer organisms 3
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Serratia sp. NCBITaxon:616 |
SOURCE_ASSERTION | mibig:BGC0000258 | PMID:15528645 |
| Serratia marcescens NCBITaxon:615 |
SOURCE_ASSERTION | mibig:BGC0000259 | PMID:15528645 |
| Hahella chejuensis KCTC 2396 NCBITaxon:349521 |
SOURCE_ASSERTION | mibig:BGC0000260 | PMID:17381736 |
Occurrences 14
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Hahella chejuensis NCBITaxon:158327 |
LOTUS | DOI:10.1111/J.1365-2672.2006.03172.X |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1007/S10482-012-9772-5 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1007/S11033-018-4324-3 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1007/S11427-017-9117-X |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1099/00221287-131-9-2431 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1128/JB.00017-11 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1007/S10482-012-9772-5 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1007/S11033-018-4324-3 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1007/S11427-017-9117-X |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1099/00221287-131-9-2431 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1128/JB.00017-11 |
| Streptomyces griseoviridis NCBITaxon:45398 |
LOTUS | DOI:10.1038/JA.2009.27 |
| Streptomyces olivaceus NCBITaxon:47716 |
LOTUS | DOI:10.1007/BF00411284 |
| Serratia marcescens NCBITaxon:615 |
LOTUS | DOI:10.1099/MIC.0.27222-0 |
Biosynthetic gene clusters 3
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000258 | Serratia sp. NCBITaxon:616 |
CLUSTER_UNSTATED | genbank:AJ833001.1 |
| mibig:BGC0000259 | Serratia marcescens NCBITaxon:615 |
CLUSTER_UNSTATED | genbank:AJ833002.1 |
| mibig:BGC0000260 | Hahella chejuensis KCTC 2396 NCBITaxon:349521 |
CLUSTER_UNSTATED | genbank:DQ266254.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Open questions 1
shared-structure — This structure is reported by more than one MIBiG entry: BGC0000258, BGC0000259, BGC0000260. Confirm they describe the same compound rather than an upstream cross-reference error.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000258 | MIBIG | 3 |
| BGC0000259 | MIBIG | 3 |
| BGC0000260 | MIBIG | 3 |
This page is generated from data/natural_products/alkaloids/prodigiosin-2.yaml, which is generated from the committed inventories. Neither is edited by hand.