staurosporine
naturalproductmech:mibig-c702c4be08 MINTED SEEDED cytotoxicenzyme inhibitor
Structure
| Standard InChIKey | HKSZLNNOFSGOKW-UHFFFAOYSA-N |
|---|---|
| SMILES | CNC1CC2OC(C)(C1OC)N1C3=CC=CC=C3C3=C4CNC(=O)C4=C4C5=C(C=CC=C5)N2C4=C13 |
| Stereochemistry | undefined stereocentres — the InChIKey does not distinguish this compound from its stereoisomers |
| Cross-references | npatlas:NPA014588, pubchem:44259 |
Filing pathway
Alkaloids — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is other, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Streptomyces sp. TP-A0274 NCBITaxon:171258 |
SOURCE_ASSERTION | mibig:BGC0000825 | PMID:12617516 |
Occurrences 21
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.7164/ANTIBIOTICS.55.1063 |
| Streptomyces actuosus NCBITaxon:1885 |
LOTUS | DOI:10.1080/00021369.1986.10867821 |
| Streptomyces actuosus NCBITaxon:1885 |
LOTUS | DOI:10.1248/CPB.51.1402 |
| Streptomyces actuosus NCBITaxon:1885 |
LOTUS | DOI:10.7164/ANTIBIOTICS.40.1782 |
| Streptomyces actuosus NCBITaxon:1885 |
LOTUS | DOI:10.7164/ANTIBIOTICS.48.143 |
| Streptomyces actuosus NCBITaxon:1885 |
LOTUS | DOI:10.7164/ANTIBIOTICS.49.1060 |
| Streptomyces actuosus NCBITaxon:1885 |
LOTUS | DOI:10.7164/ANTIBIOTICS.49.519 |
| Streptomyces hygroscopicus NCBITaxon:1912 |
LOTUS | DOI:10.1080/00021369.1986.10867821 |
| Streptomyces hygroscopicus NCBITaxon:1912 |
LOTUS | DOI:10.1248/CPB.51.1402 |
| Streptomyces hygroscopicus NCBITaxon:1912 |
LOTUS | DOI:10.7164/ANTIBIOTICS.40.1782 |
| Streptomyces hygroscopicus NCBITaxon:1912 |
LOTUS | DOI:10.7164/ANTIBIOTICS.48.143 |
| Streptomyces hygroscopicus NCBITaxon:1912 |
LOTUS | DOI:10.7164/ANTIBIOTICS.49.1060 |
| Streptomyces hygroscopicus NCBITaxon:1912 |
LOTUS | DOI:10.7164/ANTIBIOTICS.49.519 |
| Streptomyces longisporoflavus NCBITaxon:28044 |
LOTUS | DOI:10.7164/ANTIBIOTICS.48.143 |
| Streptomyces lividus NCBITaxon:282216 |
LOTUS | DOI:10.1080/00021369.1986.10867821 |
| Streptomyces lividus NCBITaxon:282216 |
LOTUS | DOI:10.1248/CPB.51.1402 |
| Streptomyces lividus NCBITaxon:282216 |
LOTUS | DOI:10.7164/ANTIBIOTICS.40.1782 |
| Streptomyces lividus NCBITaxon:282216 |
LOTUS | DOI:10.7164/ANTIBIOTICS.48.143 |
| Streptomyces lividus NCBITaxon:282216 |
LOTUS | DOI:10.7164/ANTIBIOTICS.49.1060 |
| Streptomyces lividus NCBITaxon:282216 |
LOTUS | DOI:10.7164/ANTIBIOTICS.49.519 |
| Lechevalieria aerocolonigenes NCBITaxon:68170 |
LOTUS | DOI:10.1271/BBB.67.127 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000825 | Streptomyces sp. TP-A0274 NCBITaxon:171258 |
CLUSTER_UNSTATED | genbank:AB088119.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Causal graph — bioactivity 2 nodes, 1 edges
Staurosporine inhibits human PDK1.
| Subject | Predicate | Object | Evidence |
|---|---|---|---|
| staurosporine | inhibits | human 3-phosphoinositide-dependent protein kinase 1 | DOI:10.1042/BJ20031119 |
Every edge carries its own citation; an uncited edge is refused by the corpus tests.
Causal graph — bioactivity 4 nodes, 3 edges
Staurosporine inhibits human AKT1, AKT2, and AKT3.
| Subject | Predicate | Object | Evidence |
|---|---|---|---|
| staurosporine | inhibits | human RAC-alpha serine/threonine-protein kinase | DOI:10.1016/j.bmcl.2005.12.065 |
| staurosporine | inhibits | human RAC-beta serine/threonine-protein kinase | DOI:10.1016/j.bmcl.2005.12.065 |
| staurosporine | inhibits | human RAC-gamma serine/threonine-protein kinase | DOI:10.1016/j.bmcl.2005.12.065 |
Every edge carries its own citation; an uncited edge is refused by the corpus tests.
Causal graph — bioactivity 5 nodes, 4 edges
Staurosporine inhibits human PLK1, PLK2, PLK3, and PLK4.
| Subject | Predicate | Object | Evidence |
|---|---|---|---|
| staurosporine | inhibits | human serine/threonine-protein kinase PLK1 | DOI:10.1021/bi7008745 |
| staurosporine | inhibits | human serine/threonine-protein kinase PLK2 | DOI:10.1021/bi7008745 |
| staurosporine | inhibits | human serine/threonine-protein kinase PLK3 | DOI:10.1021/bi7008745 |
| staurosporine | inhibits | human serine/threonine-protein kinase PLK4 | DOI:10.1021/bi7008745 |
Every edge carries its own citation; an uncited edge is refused by the corpus tests.
Causal graph — bioactivity 2 nodes, 1 edges
Staurosporine inhibits human PIM1.
| Subject | Predicate | Object | Evidence |
|---|---|---|---|
| staurosporine | inhibits | human serine/threonine-protein kinase pim-1 | DOI:10.1074/jbc.M413155200 |
Every edge carries its own citation; an uncited edge is refused by the corpus tests.
Causal graph — bioactivity 3 nodes, 2 edges
Staurosporine inhibits human PDGFRB and VEGFR2 receptor tyrosine kinases.
| Subject | Predicate | Object | Evidence |
|---|---|---|---|
| staurosporine | inhibits | human platelet-derived growth factor receptor beta | DOI:10.1021/cb9002865 |
| staurosporine | inhibits | human vascular endothelial growth factor receptor 2 | DOI:10.1021/cb9002865 |
Every edge carries its own citation; an uncited edge is refused by the corpus tests.
Causal graph — bioactivity 2 nodes, 1 edges
Staurosporine inhibits chicken c-Src.
| Subject | Predicate | Object | Evidence |
|---|---|---|---|
| staurosporine | inhibits | chicken proto-oncogene tyrosine-protein kinase Src | DOI:10.1038/nchembio.162 |
Every edge carries its own citation; an uncited edge is refused by the corpus tests.
Causal graph — bioactivity 2 nodes, 1 edges
Staurosporine inhibits Plasmodium falciparum K1 calcium-dependent protein kinase 1.
| Subject | Predicate | Object | Evidence |
|---|---|---|---|
| staurosporine | inhibits | Plasmodium falciparum K1 calcium-dependent protein kinase 1 | DOI:10.1038/nchembio.87 |
Every edge carries its own citation; an uncited edge is refused by the corpus tests.
Causal graph — bioactivity 2 nodes, 1 edges
Staurosporine inhibits human GSK3B.
| Subject | Predicate | Object | Evidence |
|---|---|---|---|
| staurosporine | inhibits | human glycogen synthase kinase-3 beta | DOI:10.1111/cbdd.12546 |
Every edge carries its own citation; an uncited edge is refused by the corpus tests.
Causal graph — bioactivity 2 nodes, 1 edges
Staurosporine inhibits human CSF1R.
| Subject | Predicate | Object | Evidence |
|---|---|---|---|
| staurosporine | inhibits | human macrophage colony-stimulating factor 1 receptor | DOI:10.1074/jbc.M608182200 |
Every edge carries its own citation; an uncited edge is refused by the corpus tests.
Molecular targets 56
| Target | Assay organism | Measurement | Reference |
|---|---|---|---|
| 3-phosphoinositide-dependent protein kinase 1 [51-359] UniProtKB:O15530 |
Homo sapiens NCBITaxon:9606 |
IC50 6.5 nM | PMID:12892559 |
| 5'-AMP-activated protein kinase subunit beta-1/5'-AMP-activated protein kinase subunit gamma-1/Dual specificity protein kinase CLK2 UniProtKB:P49760 |
Homo sapiens NCBITaxon:9606 |
IC50 1 nM | PMID:20020776 |
| Activin receptor type-1 UniProtKB:Q04771 |
Homo sapiens NCBITaxon:9606 |
IC50 4531 nM | PMID:20020776 |
| Calcium-dependent protein kinase 1 UniProtKB:P62343 |
Plasmodium falciparum (isolate K1 / Thailand) NCBITaxon:5839 |
IC50 240 nM | PMID:18454143 |
| Cyclin-A2/Cyclin-dependent kinase 1 UniProtKB:P06493 |
Homo sapiens NCBITaxon:9606 |
KI 1 nM | PMID:12244092 |
| Cyclin-A2/Cyclin-dependent kinase 2 UniProtKB:P24941 |
Homo sapiens NCBITaxon:9606 |
KI 2.9 nM | PMID:12244092 |
| Cyclin-dependent kinase 4/G1/S-specific cyclin-D1 UniProtKB:P11802 |
Homo sapiens NCBITaxon:9606 |
KI 41 nM | PMID:12244092 |
| Cyclin-dependent kinase 4/G1/S-specific cyclin-D1 UniProtKB:P11802 |
Homo sapiens NCBITaxon:9606 |
IC50 59 nM | PMID:12824014 |
| Glycogen synthase kinase-3 beta UniProtKB:P49841 |
Homo sapiens NCBITaxon:9606 |
IC50 38 nM | PMID:25711384 |
| Glycogen synthase kinase-3 beta UniProtKB:P49841 |
Homo sapiens NCBITaxon:9606 |
IC50 60 nM | PMID:26804375 |
| Glycogen synthase kinase-3 beta UniProtKB:P49841 |
Homo sapiens NCBITaxon:9606 |
IC50 54 nM | PMID:27454617 |
| Macrophage colony-stimulating factor 1 receptor [538-678,753-922] UniProtKB:P07333 |
Homo sapiens NCBITaxon:9606 |
IC50 49 nM | PMID:17132625 |
| Macrophage colony-stimulating factor 1 receptor [538-678,753-922] UniProtKB:P07333 |
Homo sapiens NCBITaxon:9606 |
IC50 57 nM | PMID:17132625 |
| Macrophage colony-stimulating factor 1 receptor [538-972] UniProtKB:P07333 |
IC50 57 nM | PMID:17132625 | |
| Myosin light chain kinase, smooth muscle UniProtKB:P11799 |
Gallus gallus NCBITaxon:9031 |
IC50 10 nM | DOI:10.1016/0960-894X(94)00458-R |
| Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform UniProtKB:P48736 |
Homo sapiens NCBITaxon:9606 |
KD 290 nM | PMID:11090628 |
| Platelet-derived growth factor receptor beta UniProtKB:P09619 |
Homo sapiens NCBITaxon:9606 |
IC50 6.14 nM | PMID:20020776 |
| Protein kinase C beta type UniProtKB:P68403 |
Rattus norvegicus NCBITaxon:10116 |
IC50 9 nM | DOI:10.1016/0960-894X(94)00458-R |
| Protein kinase C beta type UniProtKB:P68403 |
Rattus norvegicus NCBITaxon:10116 |
IC50 9 nM | PMID:1732526 |
| Protein kinase C beta type UniProtKB:P68403 |
Rattus norvegicus NCBITaxon:10116 |
IC50 9 nM | PMID:8421286 |
| Protein kinase C beta type UniProtKB:P68403 |
Rattus norvegicus NCBITaxon:10116 |
KI 19 nM | PMID:9383464 |
| Protein kinase C gamma type UniProtKB:P05129 |
Homo sapiens NCBITaxon:9606 |
IC50 6.6 nM | PMID:16413780 |
| Protein kinase C zeta type UniProtKB:Q05513 |
Homo sapiens NCBITaxon:9606 |
IC50 570 nM | PMID:16413780 |
| Proto-oncogene tyrosine-protein kinase Src UniProtKB:P00523 |
Gallus gallus NCBITaxon:9031 |
KD 8 nM | PMID:19396179 |
| RAC-alpha serine/threonine-protein kinase [139-480,S378A,S381A,T450D,S473D] UniProtKB:P31749 |
Homo sapiens NCBITaxon:9606 |
IC50 1.5 nM | PMID:16413780 |
| RAC-beta serine/threonine-protein kinase UniProtKB:P31751 |
Homo sapiens NCBITaxon:9606 |
IC50 6.5 nM | PMID:16413780 |
| RAC-gamma serine/threonine-protein kinase UniProtKB:Q9Y243 |
Homo sapiens NCBITaxon:9606 |
IC50 10 nM | PMID:16413780 |
| Rho-associated protein kinase 2 UniProtKB:Q28021 |
Bos taurus NCBITaxon:9913 |
IC50 1.2 nM | PMID:16699172 |
| Serine/threonine-protein kinase Chk1 UniProtKB:O14757 |
Homo sapiens NCBITaxon:9606 |
KI 7.8 nM | PMID:12244092 |
| Serine/threonine-protein kinase Chk2 [209-531,Q209M] UniProtKB:O96017 |
Homo sapiens NCBITaxon:9606 |
IC50 80 nM | PMID:17616632 |
| Serine/threonine-protein kinase PLK1 UniProtKB:P53350 |
Homo sapiens NCBITaxon:9606 |
KI 790 nM | PMID:17655330 |
| Serine/threonine-protein kinase PLK2 UniProtKB:Q9NYY3 |
Homo sapiens NCBITaxon:9606 |
KI 150 nM | PMID:17655330 |
| Serine/threonine-protein kinase PLK3 UniProtKB:Q9H4B4 |
Homo sapiens NCBITaxon:9606 |
KI 1200 nM | PMID:17655330 |
| Serine/threonine-protein kinase PLK4 UniProtKB:O00444 |
Homo sapiens NCBITaxon:9606 |
KI 2.6 nM | PMID:17655330 |
| Serine/threonine-protein kinase pim-1 UniProtKB:P11309 |
Homo sapiens NCBITaxon:9606 |
IC50 10 nM | PMID:15657054 |
| TGF-beta receptor type-1 UniProtKB:P36897 |
Homo sapiens NCBITaxon:9606 |
IC50 10640 nM | PMID:20020776 |
| Tyrosine-protein kinase CSK UniProtKB:P41240 |
Homo sapiens NCBITaxon:9606 |
IC50 600 nM | PMID:24632506 |
| Tyrosine-protein kinase ITK/TSK UniProtKB:Q08881 |
Homo sapiens NCBITaxon:9606 |
KI 10 nM | PMID:14766749 |
| Tyrosine-protein kinase ITK/TSK UniProtKB:Q08881 |
Homo sapiens NCBITaxon:9606 |
KI 2.2 nM | PMID:14766749 |
| Tyrosine-protein phosphatase non-receptor type 2 UniProtKB:P35233 |
Mus musculus NCBITaxon:10090 |
IC50 400 nM | DOI:10.1016/0960-894X(94)00458-R |
| Vascular endothelial growth factor receptor 2 UniProtKB:P35968 |
Homo sapiens NCBITaxon:9606 |
IC50 3.29 nM | PMID:20020776 |
| cAMP-dependent protein kinase | Oryctolagus cuniculus NCBITaxon:9986 |
KI 35 nM | PMID:9383464 |
| cAMP-dependent protein kinase catalytic subunit alpha UniProtKB:P00517 |
Bos taurus NCBITaxon:9913 |
IC50 40 nM | DOI:10.1016/0960-894X(94)00458-R |
| cAMP-dependent protein kinase catalytic subunit alpha UniProtKB:P00517 |
Bos taurus NCBITaxon:9913 |
IC50 3.6 nM | PMID:16413780 |
| cAMP-dependent protein kinase catalytic subunit alpha UniProtKB:P00517 |
Bos taurus NCBITaxon:9913 |
IC50 45 nM | PMID:16699172 |
| cAMP-dependent protein kinase catalytic subunit alpha UniProtKB:P00517 |
Bos taurus NCBITaxon:9913 |
IC50 121 nM | PMID:8421286 |
| cAMP-dependent protein kinase catalytic subunit alpha [E127D] UniProtKB:P00517 |
Bos taurus NCBITaxon:9913 |
IC50 45 nM | PMID:16699172 |
| cAMP-dependent protein kinase catalytic subunit alpha [L49I,Q181K,T183A] UniProtKB:P00517 |
Bos taurus NCBITaxon:9913 |
IC50 45 nM | PMID:16699172 |
| cAMP-dependent protein kinase catalytic subunit alpha [L49I,V123M,E127D,Q181K,T183A] UniProtKB:P00517 |
Bos taurus NCBITaxon:9913 |
IC50 45 nM | PMID:16699172 |
| cAMP-dependent protein kinase catalytic subunit alpha [L49I,V123M,Q181K,T183A] UniProtKB:P00517 |
Bos taurus NCBITaxon:9913 |
IC50 51 nM | PMID:16699172 |
| cAMP-dependent protein kinase catalytic subunit alpha [L49I] UniProtKB:P00517 |
Bos taurus NCBITaxon:9913 |
IC50 47 nM | PMID:16699172 |
| cAMP-dependent protein kinase catalytic subunit alpha [Q181K,T183A] UniProtKB:P00517 |
Bos taurus NCBITaxon:9913 |
IC50 45 nM | PMID:16699172 |
| cAMP-dependent protein kinase catalytic subunit alpha [T183A] UniProtKB:P00517 |
Bos taurus NCBITaxon:9913 |
IC50 45 nM | PMID:16699172 |
| cAMP-dependent protein kinase catalytic subunit alpha [V123M,Q181K,T183A] UniProtKB:P00517 |
Bos taurus NCBITaxon:9913 |
IC50 45 nM | PMID:16699172 |
| cAMP-dependent protein kinase catalytic subunit alpha [V123M] UniProtKB:P00517 |
Bos taurus NCBITaxon:9913 |
IC50 45 nM | PMID:16699172 |
| cGMP-dependent protein kinase 1 UniProtKB:P00516 |
Bos taurus NCBITaxon:9913 |
IC50 18 nM | DOI:10.1016/0960-894X(94)00458-R |
Bioactivities 25
| Assay | Result | Reference |
|---|---|---|
| A549 Cytotoxicity Assay Measured in Cell-Based System Using Plate Reader - 7071-06_Inhibitor_Dose_DryPowder_Activity_Set6 | EC50 26.77 uM | pubchem.aid:743312 |
| ABL1 kinase (ABL1-N-HiBiT) SDR gain of signal screen | 0.8802 uM | pubchem.aid:1963315 |
| ABL1 kinase (ABL1-N-HiBiT) SDR gain of signal screen | 0.8802 uM | pubchem.aid:1963315 |
| ABL1 kinase (ABL1-N-HiBiT) SDR gain of signal screen - plus ATP | 0.6112 uM | pubchem.aid:1963316 |
| ABL1 kinase (ABL1-N-HiBiT) SDR gain of signal screen - plus ATP | 0.6112 uM | pubchem.aid:1963316 |
| ABL1 kinase (ABL1-N-HiBiT) enzymatic inhibition screen - Functional assay | 3.0633 uM | pubchem.aid:1963317 |
| ABL1 kinase (ABL1-N-HiBiT) enzymatic inhibition screen - Functional assay | 3.0633 uM | pubchem.aid:1963317 |
| Akt Kinase Assay from Article 10.1016/j.bmcl.2005.12.065: "Synthesis and structure-activity relationship of 3,4'-bispyridinylethylenes: discovery of a potent 3-isoquinolinylpyridine inhibitor of protein kinase B (PKB/Akt) for the treatment of cancer." | IC50 0.0015 uM | PMID:16413780 |
| Akt Kinase Assay from Article 10.1016/j.bmcl.2005.12.065: "Synthesis and structure-activity relationship of 3,4'-bispyridinylethylenes: discovery of a potent 3-isoquinolinylpyridine inhibitor of protein kinase B (PKB/Akt) for the treatment of cancer." | IC50 0.0065 uM | PMID:16413780 |
| Akt Kinase Assay from Article 10.1016/j.bmcl.2005.12.065: "Synthesis and structure-activity relationship of 3,4'-bispyridinylethylenes: discovery of a potent 3-isoquinolinylpyridine inhibitor of protein kinase B (PKB/Akt) for the treatment of cancer." | IC50 0.01 uM | PMID:16413780 |
| Assay for Inhibitors of the ERK Signaling Pathway using a Homogeneous Screening Assay: EGFR Kinase Inhibition | 0.3981 uM | pubchem.aid:1731 |
| Assay for Inhibitors of the ERK Signaling Pathway using a Homogeneous Screening Assay: EGFR L858R Kinase Inhibition | 0.3548 uM | pubchem.aid:1727 |
| Assay for Inhibitors of the ERK Signaling Pathway using a Homogeneous Screening Assay: EGFR T790M Kinase Inhibition | 0.0056 uM | pubchem.aid:1729 |
| Assay for Inhibitors of the ERK Signaling Pathway using a Homogeneous Screening Assay: EGFR T790M/L858R Kinase Inhibition | 0.0398 uM | pubchem.aid:1726 |
| Assay for Inhibitors of the ERK Signaling Pathway using a Homogeneous Screening Assay: MEK Inhibition | 0.1 uM | pubchem.aid:1732 |
| Assay for Inhibitors of the ERK Signaling Pathway using a Homogeneous Screening Assay: c-Raf Inhibition | 0.1778 uM | pubchem.aid:1728 |
| BET inhibitor-based combinations targeting novel dependencies in MECOM-rearranged (r) AML: AML-191 cell line | 0.0295 uM | pubchem.aid:2202236 |
| BET inhibitor-based combinations targeting novel dependencies in MECOM-rearranged (r) AML: AML-194 cell line | 0.0332 uM | pubchem.aid:2202237 |
| BET inhibitor-based combinations targeting novel dependencies in MECOM-rearranged (r) AML: HNT-34 cell line | 0.0934 uM | pubchem.aid:2202234 |
| BET inhibitor-based combinations targeting novel dependencies in MECOM-rearranged (r) AML: MV-4-11 cell line | 0.0074 uM | pubchem.aid:2202233 |
| BET inhibitor-based combinations targeting novel dependencies in MECOM-rearranged (r) AML: OCI-AML3 cell line | 0.0833 uM | pubchem.aid:2202232 |
| BET inhibitor-based combinations targeting novel dependencies in MECOM-rearranged (r) AML: SET-2 cell line | 0.1864 uM | pubchem.aid:2202231 |
| BET inhibitor-based combinations targeting novel dependencies in MECOM-rearranged (r) AML: UCSD-AML1 cell line | 0.0661 uM | pubchem.aid:2202235 |
| Biochemical Assay from US Patent US20240002365: "PYRIDAZINE AND 1,2,4-TRIAZINE DERIVATIVES AS FGFR KINASE INHIBITORS" | IC50 0.0021 uM | pubchem.aid:1920143 |
| Biochemical Assay from US Patent US20240002365: "PYRIDAZINE AND 1,2,4-TRIAZINE DERIVATIVES AS FGFR KINASE INHIBITORS" | IC50 0.0008 uM | pubchem.aid:1920143 |
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000825 | MIBIG | 5 |
This page is generated from data/natural_products/alkaloids/staurosporine-2.yaml, which is generated from the committed inventories. Neither is edited by hand.