staurosporine
CHEBI:15738 EXACT SEEDED
Structure
| Standard InChIKey | HKSZLNNOFSGOKW-FYTWVXJKSA-N |
|---|---|
| SMILES | C[C@@]12[C@@H]([C@@H](C[C@@H](O1)N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N2C7=C53)CNC6=O)NC)OC |
| Stereochemistry | fully defined |
| Cross-references | pubchem:44259 |
Filing pathway
Alkaloids — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is other, from MIBiG.
Producer organisms 2
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Streptomyces clavuligerus ATCC 27064 NCBITaxon:1901 |
SOURCE_ASSERTION | mibig:BGC0000826 | PMID:20624727 |
| Salinispora arenicola CNS-205 NCBITaxon:391037 |
SOURCE_ASSERTION | mibig:BGC0000827 | PMID:17158611 |
Occurrences 25
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Lyngbya majuscula NCBITaxon:158786 |
LOTUS | DOI:10.1021/ACS.JNATPROD.7B00751 |
| Micromonospora NCBITaxon:1873 |
LOTUS | DOI:10.7164/ANTIBIOTICS.53.895 |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.1021/ACS.JNATPROD.7B01055 |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.1021/ACS.JNATPROD.7B01058 |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.1021/NP900163F |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.1248/CPB.51.1402 |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.1271/BBB1961.50.2723 |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.7164/ANTIBIOTICS.30.275 |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.7164/ANTIBIOTICS.40.1782 |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.7164/ANTIBIOTICS.42.571 |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.7164/ANTIBIOTICS.43.168 |
| Streptomyces actuosus NCBITaxon:1885 |
LOTUS | DOI:10.1271/BBB1961.49.1959 |
| Streptomyces fradiae NCBITaxon:1906 |
LOTUS | DOI:10.1007/S11427-019-1597-6 |
| Streptomyces fradiae NCBITaxon:1906 |
LOTUS | DOI:10.1021/JF0532617 |
| Streptomyces fradiae NCBITaxon:1906 |
LOTUS | DOI:10.3390/MD12042079 |
| Streptomyces lividans NCBITaxon:1916 |
LOTUS | DOI:10.1038/JA.2015.31 |
| Tubifera casparyi NCBITaxon:2659272 |
LOTUS | DOI:10.1016/S0960-894X(03)00592-4 |
| Sporormiella similis NCBITaxon:269685 |
LOTUS | DOI:10.1021/ACS.JNATPROD.7B00064 |
| Streptomyces longisporoflavus NCBITaxon:28044 |
LOTUS | DOI:10.7164/ANTIBIOTICS.49.1060 |
| Streptomyces longisporoflavus NCBITaxon:28044 |
LOTUS | DOI:10.7164/ANTIBIOTICS.51.679 |
| Lycogala epidendrum NCBITaxon:300236 |
LOTUS | DOI:10.1248/CPB.53.594 |
| Streptomyces sanyensis NCBITaxon:568869 |
LOTUS | DOI:10.1038/S41598-019-48261-7 |
| Streptomyces sanyensis NCBITaxon:568869 |
LOTUS | DOI:10.3390/MD11020466 |
| Streptomyces sanyensis NCBITaxon:568869 |
LOTUS | DOI:10.3390/MD17100588 |
| Streptomyces platensis NCBITaxon:58346 |
LOTUS | DOI:10.7164/ANTIBIOTICS.45.195 |
Biosynthetic gene clusters 2
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000826 | Streptomyces clavuligerus ATCC 27064 NCBITaxon:1901 |
CLUSTER_UNSTATED | genbank:CM000914.1 |
| mibig:BGC0000827 | Salinispora arenicola CNS-205 NCBITaxon:391037 |
CLUSTER_UNSTATED | genbank:CP000850.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Open questions 1
shared-structure — This structure is reported by more than one MIBiG entry: BGC0000826, BGC0000827. Confirm they describe the same compound rather than an upstream cross-reference error.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000826 | MIBIG | 5 |
| BGC0000827 | MIBIG | 3 |
| CHEBI:15738 | CHEBI | 3-star |
This page is generated from data/natural_products/alkaloids/staurosporine.yaml, which is generated from the committed inventories. Neither is edited by hand.