thebaine
CHEBI:9519 EXACT SEEDED
Structure
| Standard InChIKey | FQXXSQDCDRQNQE-VMDGZTHMSA-N |
|---|---|
| SMILES | CN1CC[C@]23[C@@H]4C(=CC=C2[C@H]1CC5=C3C(=C(C=C5)OC)O4)OC |
| Stereochemistry | fully defined |
Filing pathway
Alkaloids — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is other, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Papaver somniferum NCBITaxon:3469 |
SOURCE_ASSERTION | mibig:BGC0001799 | PMID:29807982 |
Occurrences 25
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Papaver bracteatum NCBITaxon:215227 |
LOTUS | DOI:10.1002/JPS.2600700125 |
| Papaver bracteatum NCBITaxon:215227 |
LOTUS | DOI:10.1007/BF00565837 |
| Papaver bracteatum NCBITaxon:215227 |
LOTUS | DOI:10.1016/0003-9861(83)90558-1 |
| Papaver bracteatum NCBITaxon:215227 |
LOTUS | DOI:10.1016/S0031-9422(00)82630-8 |
| Papaver bracteatum NCBITaxon:215227 |
LOTUS | DOI:10.1016/S0031-9422(00)83934-5 |
| Papaver bracteatum NCBITaxon:215227 |
LOTUS | DOI:10.1016/S0040-4020(01)92023-X |
| Papaver bracteatum NCBITaxon:215227 |
LOTUS | DOI:10.1016/S0044-328X(84)80092-6 |
| Papaver bracteatum NCBITaxon:215227 |
LOTUS | DOI:10.1016/S0379-0738(97)00196-5 |
| Papaver bracteatum NCBITaxon:215227 |
LOTUS | DOI:10.1021/NP50021A004 |
| Papaver bracteatum NCBITaxon:215227 |
LOTUS | DOI:10.1039/P19840001701 |
| Papaver bracteatum NCBITaxon:215227 |
LOTUS | DOI:10.1055/S-0028-1097282 |
| Papaver bracteatum NCBITaxon:215227 |
LOTUS | DOI:10.1055/S-2006-961487 |
| Papaver bracteatum NCBITaxon:215227 |
LOTUS | DOI:10.1055/S-2006-962438 |
| Papaver bracteatum NCBITaxon:215227 |
LOTUS | DOI:10.1055/S-2007-969299 |
| Papaver bracteatum NCBITaxon:215227 |
LOTUS | DOI:10.1104/PP.81.1.161 |
| Papaver bracteatum NCBITaxon:215227 |
LOTUS | DOI:10.1104/PP.86.1.161 |
| Papaver bracteatum NCBITaxon:215227 |
LOTUS | DOI:10.1135/CCCC19851216 |
| Papaver pseudo-orientale NCBITaxon:215228 |
LOTUS | DOI:10.1016/S0379-0738(97)00196-5 |
| Papaver pseudo-orientale NCBITaxon:215228 |
LOTUS | DOI:10.1021/NP50058A030 |
| Papaver setigerum NCBITaxon:215229 |
LOTUS | DOI:10.1055/S-2007-969106 |
| Papaver setigerum NCBITaxon:215229 |
LOTUS | DOI:10.1135/CCCC19961047 |
| Papaver orientale NCBITaxon:22694 |
LOTUS | DOI:10.1002/JPS.2600660742 |
| Papaver orientale NCBITaxon:22694 |
LOTUS | DOI:10.1016/S0379-0738(97)00196-5 |
| Papaver orientale NCBITaxon:22694 |
LOTUS | DOI:10.1021/NP50022A012 |
| Papaver orientale NCBITaxon:22694 |
LOTUS | DOI:10.1021/NP50058A030 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0001799 | Papaver somniferum NCBITaxon:3469 |
CLUSTER_UNSTATED | genbank:MH011344.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Causal graph — bioactivity 2 nodes, 1 edges
Thebaine activates human MRGPRX2 in beta-arrestin recruitment and intracellular calcium mobilization assays.
| Subject | Predicate | Object | Evidence |
|---|---|---|---|
| thebaine | activates | human MRGPRX2 | DOI:10.1038/nchembio.2334 |
Every edge carries its own citation; an uncited edge is refused by the corpus tests.
Molecular targets 2
| Target | Assay organism | Measurement | Reference |
|---|---|---|---|
| Mas-related G-protein coupled receptor member X2 UniProtKB:Q96LB1 |
Human | EC50 76000 nM | PMID:28288109 |
| Mas-related G-protein coupled receptor member X2 UniProtKB:Q96LB1 |
Human | EC50 11000 nM | PMID:28288109 |
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0001799 | MIBIG | 3 |
| CHEBI:9519 | CHEBI | 3-star |
This page is generated from data/natural_products/alkaloids/thebaine.yaml, which is generated from the committed inventories. Neither is edited by hand.