actinomycin D
CHEBI:27666 EXACT SEEDED antibacterial
Structure
| Standard InChIKey | RJURFGZVJUQBHK-IIXSONLDSA-N |
|---|---|
| SMILES | [H][C@@]12CCCN1C(=O)[C@]([H])(NC(=O)[C@@]([H])(NC(=O)C1=CC=C(C)C3=C1N=C1C(O3)=C(C)C(=O)C(N)=C1C(=O)N[C@]1([H])C(=O)N[C@]([H])(C(C)C)C(=O)N3CCC[C@@]3([H])C(=O)N(C)CC(=O)N(C)[C@@]([H])(C(C)C)C(=O)O[C@]1([H])C)[C@@]([H])(C)OC(=O)[C@]([H])(C(C)C)N(C)C(=O)CN(C)C2=O)C(C)C |
| Stereochemistry | fully defined |
| Cross-references | npatlas:NPA07563 |
Filing pathway
Amino acids and peptides — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is nrps, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Streptomyces anulatus NCBITaxon:1892 |
SOURCE_ASSERTION | mibig:BGC0000296 | PMID:10212227 |
Occurrences 16
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Streptomyces parvulus NCBITaxon:146923 |
LOTUS | DOI:10.1007/S12602-018-9451-6 |
| Streptomyces parvulus NCBITaxon:146923 |
LOTUS | DOI:10.1038/JA.2012.120 |
| Streptomyces parvulus NCBITaxon:146923 |
LOTUS | DOI:10.1590/S1517-83822014005000022 |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.1002/(SICI)1521-3773(19980918)37:17<2381::AID-ANIE2381>3.0.CO;2-L |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.1021/ACS.JNATPROD.6B00742 |
| Streptomyces antibioticus NCBITaxon:1890 |
LOTUS | DOI:10.1186/S13568-019-0894-2 |
| Streptomyces antibioticus NCBITaxon:1890 |
LOTUS | DOI:10.2147/AABC.S117707 |
| Streptomyces fradiae NCBITaxon:1906 |
LOTUS | DOI:10.1021/NP990416U |
| Streptomyces lividans NCBITaxon:1916 |
LOTUS | DOI:10.3389/FMICB.2018.03042 |
| Streptomyces heliomycini NCBITaxon:284032 |
LOTUS | DOI:10.3389/FMICB.2017.01147 |
| Streptomyces costaricanus NCBITaxon:33900 |
LOTUS | DOI:10.3390/MD17040240 |
| Streptomyces flavovirens NCBITaxon:52258 |
LOTUS | DOI:10.7717/PEERJ.3601 |
| Streptomyces flavogriseus NCBITaxon:67299 |
LOTUS | DOI:10.7717/PEERJ.3601 |
| Streptomyces sindenensis NCBITaxon:67363 |
LOTUS | DOI:10.4014/JMB.1109.09018 |
| Streptomyces chrysomallus NCBITaxon:1892 |
LOTUS | DOI:10.1038/JA.2012.120 |
| Streptomyces chrysomallus NCBITaxon:1892 |
LOTUS | DOI:10.2147/AABC.S117707 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000296 | Streptomyces anulatus NCBITaxon:1892 |
CLUSTER_UNSTATED | genbank:HM038106.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Elsewhere in the fleet
- AntibioticMech — CHEBI:27666 (same structure, same inchikey)
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000296 | MIBIG | 5 |
| CHEBI:27666 | CHEBI | 3-star |
This page is generated from data/natural_products/amino_acids_and_peptides/actinomycin-d.yaml, which is generated from the committed inventories. Neither is edited by hand.