citrulline
naturalproductmech:mibig-6a9399d351 REVIEW_NEEDED SEEDED enzyme inhibitor
Structure
| Standard InChIKey | RHGKLRLOHDJJDR-BYPYZUCNSA-N |
|---|---|
| SMILES | C(C[C@@H](C(=O)O)N)CNC(=O)N |
| Stereochemistry | fully defined |
| Cross-references | pubchem:9750 |
Filing pathway
Amino acids and peptides — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is other, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Lactobacillus plantarum subsp. plantarum NCBITaxon:337330 |
SOURCE_ASSERTION | mibig:BGC0000895 | PMID:9098069 |
Occurrences 25
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Mus musculus NCBITaxon:10090 |
CHEBI | PMID:19425150 |
| Cycas revoluta NCBITaxon:3396 |
LOTUS | DOI:10.1016/S0031-9422(96)00866-7 |
| Arabidopsis thaliana NCBITaxon:3702 |
LOTUS | DOI:10.1104/PP.101.2.429 |
| Arabidopsis thaliana NCBITaxon:3702 |
CHEBI | PMID:8278506 |
| Opuntia ficus-indica NCBITaxon:371859 |
LOTUS | DOI:10.1055/S-1999-14037 |
| Prunus domestica NCBITaxon:3758 |
LOTUS | DOI:10.1021/JF00017A016 |
| Glycine max NCBITaxon:3847 |
LOTUS | DOI:10.1080/00380768.2014.945390 |
| Medicago sativa NCBITaxon:3879 |
LOTUS | DOI:10.1094/MPMI-19-0998 |
| Phaseolus vulgaris NCBITaxon:3885 |
LOTUS | DOI:10.3390/METABO4030599 |
| Flammulina velutipes NCBITaxon:38945 |
LOTUS | DOI:10.1111/J.1365-2621.1987.TB13989.X |
| Capsicum annuum NCBITaxon:4072 |
LOTUS | DOI:10.1016/J.POSTHARVBIO.2013.11.004 |
| Oryza sativa NCBITaxon:4530 |
LOTUS | DOI:10.1111/J.1365-313X.2004.02187.X |
| Allium cepa NCBITaxon:4679 |
LOTUS | DOI:10.1016/J.PLAPHY.2019.11.007 |
| Allium sativum NCBITaxon:4682 |
LOTUS | DOI:10.1016/0378-8741(96)01416-X |
| Saccharomyces cerevisiae NCBITaxon:4932 |
CHEBI | PMID:24678285 |
| Escherichia coli NCBITaxon:562 |
LOTUS | DOI:10.1038/MSB.2011.65 |
| Escherichia coli NCBITaxon:562 |
LOTUS | DOI:10.1128/JB.127.1.291-301.1976 |
| Escherichia coli NCBITaxon:562 |
CHEBI | PMID:179975 |
| Escherichia coli NCBITaxon:562 |
CHEBI | PMID:21988831 |
| Caenorhabditis elegans NCBITaxon:6239 |
LOTUS | DOI:10.1021/CB3004226 |
| Caenorhabditis elegans NCBITaxon:6239 |
LOTUS | DOI:10.3389/FMOLB.2018.00096 |
| Chondria armata NCBITaxon:860625 |
LOTUS | DOI:10.1002/ARDP.19602930608 |
| Juncus roemerianus NCBITaxon:879918 |
LOTUS | DOI:10.18785/GRR.0602.07 |
| Homo sapiens NCBITaxon:9606 |
CHEBI | 10.1038/nbt.2488 |
| Homo sapiens NCBITaxon:9606 |
LOTUS | DOI:10.1007/S11306-016-1051-4 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000895 | Lactobacillus plantarum subsp. plantarum NCBITaxon:337330 |
CLUSTER_UNSTATED | genbank:X99978.2 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Bioactivities 2
| Assay | Result | Reference |
|---|---|---|
| Inhibition Assay from Article 10.1021/bi9007098: "Developing dual and specific inhibitors of dimethylarginine dimethylaminohydrolase-1 and nitric oxide synthase: toward a targeted polypharmacology to control nitric oxide." | KI 3700 uM | PMID:19663506 |
| Inhibition Assay from Article 10.1021/bi9007098: "Developing dual and specific inhibitors of dimethylarginine dimethylaminohydrolase-1 and nitric oxide synthase: toward a targeted polypharmacology to control nitric oxide." | KI 1000 uM | PMID:19663506 |
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000895 | MIBIG | 5 |
| CHEBI:16349 | CHEBI | 3-star |
| CHEBI:57743 | CHEBI | 3-star |
This page is generated from data/natural_products/amino_acids_and_peptides/citrulline.yaml, which is generated from the committed inventories. Neither is edited by hand.