clavulanic acid
CHEBI:48947 EXACT SEEDED antibacterial
Antibiotic isolated from Streptomyces clavuligerus. It acts as a suicide inhibitor of bacterial β-lactamase enzymes.
Structure
| Standard InChIKey | HZZVJAQRINQKSD-PBFISZAISA-N |
|---|---|
| SMILES | C1[C@@H]2N(C1=O)[C@H](/C(=C/CO)/O2)C(=O)O |
| Stereochemistry | fully defined |
| Cross-references | pubchem:5280980 |
Filing pathway
Amino acids and peptides — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is other, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Streptomyces clavuligerus ATCC 27064 NCBITaxon:1901 |
SOURCE_ASSERTION | mibig:BGC0000845 | PMID:8088547 |
Occurrences 25
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Streptomyces cattleya NCBITaxon:29303 |
LOTUS | DOI:10.1016/S1074-5521(03)00069-3 |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1002/BIT.21783 |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1002/BIT.260370507 |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1002/ECE3.4924 |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1007/BF00327805 |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1007/S00253-013-4721-4 |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1007/S00253-018-8841-8 |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1007/S002530051140 |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1007/S00449-012-0682-8 |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1007/S10295-016-1733-Y |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1007/S10295-019-02196-0 |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1007/S10529-011-0561-4 |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1007/S11427-013-4507-Z |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1007/S12010-007-9030-X |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1007/S12010-019-02953-Y |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1007/S42770-019-00202-2 |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1016/0378-1119(94)90036-1 |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1016/J.BJM.2018.01.006 |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1016/J.CHEMBIOL.2006.11.012 |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1016/J.CMPB.2014.02.013 |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1016/J.DIB.2019.103992 |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1016/J.JPBA.2015.12.035 |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1016/J.MICRES.2010.07.005 |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1016/J.SYNBIO.2016.10.003 |
| Streptomyces clavuligerus NCBITaxon:1901 |
LOTUS | DOI:10.1016/S0378-1119(98)00106-1 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000845 | Streptomyces clavuligerus ATCC 27064 NCBITaxon:1901 |
CLUSTER_DEMONSTRATED | genbank:DS570624.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Elsewhere in the fleet
- AntibioticMech — CHEBI:48947 (same structure, same inchikey)
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000845 | MIBIG | 5 |
| CHEBI:48947 | CHEBI | 3-star |
This page is generated from data/natural_products/amino_acids_and_peptides/clavulanic-acid.yaml, which is generated from the committed inventories. Neither is edited by hand.