coelichelin
CHEBI:80049 EXACT SEEDED
A tetrapeptide hydroxamate siderophore that is isolated from Streptomyces coelicolor.
Structure
| Standard InChIKey | ZPJLQAOTGYKOBJ-OVYGPGRDSA-N |
|---|---|
| SMILES | C[C@@H](O)[C@@H](NC(=O)[C@H](N)CCCN(O)C=O)C(=O)N(O)CCC[C@H](NC(=O)[C@H](N)CCCN(O)C=O)C(O)=O |
| Stereochemistry | fully defined |
| Cross-references | npatlas:NPA09051, pubchem:3247071 |
Filing pathway
Amino acids and peptides — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is nrps, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Streptomyces coelicolor A3(2) NCBITaxon:100226 |
SOURCE_ASSERTION | mibig:BGC0000325 | PMID:12000953 |
Occurrences 16
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1007/S10295-013-1383-2 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1016/B978-0-12-404634-4.00014-0 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1038/417141A |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1038/NCHEMBIO731 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1099/MIC.0.2006/003145-0 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1111/J.1574-6968.2006.00362.X |
| Streptomyces ambofaciens NCBITaxon:1889 |
LOTUS | DOI:10.1371/JOURNAL.PONE.0087607 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1007/S10295-013-1383-2 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1016/B978-0-12-404634-4.00014-0 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1038/417141A |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1038/NCHEMBIO731 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1099/MIC.0.2006/003145-0 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1111/J.1574-6968.2006.00362.X |
| Streptomyces nodosus NCBITaxon:40318 |
LOTUS | DOI:10.1007/S00253-015-7060-9 |
| Streptomyces spectabilis NCBITaxon:68270 |
LOTUS | DOI:10.1007/S10295-019-02172-8 |
| Streptomyces coelicolor A3(2) NCBITaxon:100226 |
CHEBI | PMID:21342472 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000325 | Streptomyces coelicolor A3(2) NCBITaxon:100226 |
CLUSTER_UNSTATED | genbank:AL645882.2 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000325 | MIBIG | 5 |
| CHEBI:80049 | CHEBI | 3-star |
This page is generated from data/natural_products/amino_acids_and_peptides/coelichelin.yaml, which is generated from the committed inventories. Neither is edited by hand.