linamarin
CHEBI:16441 EXACT SEEDED
Structure
| Standard InChIKey | QLTCHMYAEJEXBT-ZEBDFXRSSA-N |
|---|---|
| SMILES | CC(C)(C#N)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
| Stereochemistry | fully defined |
Filing pathway
Amino acids and peptides — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is other, from MIBiG.
Producer organisms 2
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Lotus japonicus NCBITaxon:34305 |
SOURCE_ASSERTION | mibig:BGC0001316 | DOI:10.3923/ijcr.2020.18.27 |
| Manihot esculenta NCBITaxon:3983 |
SOURCE_ASSERTION | mibig:BGC0001318 | PMID:21707799 |
Occurrences 25
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Osteospermum ecklonis NCBITaxon:1053381 |
LOTUS | DOI:10.1016/S0031-9422(00)86154-3 |
| Lotus arenarius NCBITaxon:118906 |
LOTUS | DOI:10.1016/S0031-9422(00)86154-3 |
| Hevea pauciflora NCBITaxon:1318717 |
LOTUS | DOI:10.1016/0031-9422(91)83601-G |
| Hevea pauciflora NCBITaxon:1318717 |
LOTUS | DOI:10.1016/S0031-9422(00)81211-X |
| Hevea spruceana NCBITaxon:1318718 |
LOTUS | DOI:10.1016/S0031-9422(00)81211-X |
| Passiflora pendens NCBITaxon:1341377 |
LOTUS | DOI:10.1016/0031-9422(86)88016-5 |
| Passiflora pendens NCBITaxon:1341377 |
LOTUS | DOI:10.1016/S0031-9422(01)00485-X |
| Passiflora foetida NCBITaxon:159421 |
LOTUS | DOI:10.1016/S0031-9422(01)00485-X |
| Passiflora foetida NCBITaxon:159421 |
LOTUS | DOI:10.1016/S0031-9422(98)80070-8 |
| Passiflora morifolia NCBITaxon:159435 |
LOTUS | DOI:10.1016/0031-9422(86)88016-5 |
| Passiflora morifolia NCBITaxon:159435 |
LOTUS | DOI:10.1016/0031-9422(92)80427-G |
| Passiflora morifolia NCBITaxon:159435 |
LOTUS | DOI:10.1016/0031-9422(96)00065-9 |
| Passiflora morifolia NCBITaxon:159435 |
LOTUS | DOI:10.1016/S0031-9422(01)00485-X |
| Passiflora morifolia NCBITaxon:159435 |
LOTUS | DOI:10.1055/S-2007-971239 |
| Lotus arabicus NCBITaxon:181260 |
LOTUS | DOI:10.1016/S0031-9422(00)86154-3 |
| Lotus creticus NCBITaxon:181267 |
LOTUS | DOI:10.1016/0031-9422(90)89077-M |
| Lotus creticus NCBITaxon:181267 |
LOTUS | DOI:10.1016/S0031-9422(00)86154-3 |
| Lotus edulis NCBITaxon:181270 |
LOTUS | DOI:10.1016/S0031-9422(00)86154-3 |
| Lotus maroccanus NCBITaxon:181276 |
LOTUS | DOI:10.1016/S0031-9422(00)86154-3 |
| Lotus parviflorus NCBITaxon:181280 |
LOTUS | DOI:10.1016/S0031-9422(00)86154-3 |
| Passiflora subpeltata NCBITaxon:1822414 |
LOTUS | DOI:10.1016/0031-9422(89)85023-X |
| Acacia aroma NCBITaxon:207708 |
LOTUS | DOI:10.1016/0305-1978(83)90023-6 |
| Passiflora adenopoda NCBITaxon:237834 |
LOTUS | DOI:10.1016/0031-9422(86)88016-5 |
| Passiflora adenopoda NCBITaxon:237834 |
LOTUS | DOI:10.1016/S0031-9422(01)00485-X |
| Hevea camargoana NCBITaxon:2733477 |
LOTUS | DOI:10.1016/0031-9422(91)83601-G |
Biosynthetic gene clusters 2
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0001316 | Lotus japonicus NCBITaxon:34305 |
CLUSTER_UNSTATED | genbank:MIBIG.BGC0001316.1 |
| mibig:BGC0001318 | Manihot esculenta NCBITaxon:3983 |
CLUSTER_UNSTATED | genbank:MIBIG.BGC0001318.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Open questions 1
shared-structure — This structure is reported by more than one MIBiG entry: BGC0001316, BGC0001318. Confirm they describe the same compound rather than an upstream cross-reference error.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0001316 | MIBIG | 4 |
| BGC0001318 | MIBIG | 4 |
| CHEBI:16441 | CHEBI | 3-star |
This page is generated from data/natural_products/amino_acids_and_peptides/linamarin.yaml, which is generated from the committed inventories. Neither is edited by hand.