lotaustralin
naturalproductmech:mibig-dc6550fa9e MINTED SEEDED
Structure
| Standard InChIKey | WEWBWVMTOYUPHH-QHAQEBJBSA-N |
|---|---|
| SMILES | CC[C@](C)(C#N)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
| Stereochemistry | fully defined |
| Cross-references | pubchem:441467 |
Filing pathway
Amino acids and peptides — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is other, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Lotus japonicus NCBITaxon:34305 |
SOURCE_ASSERTION | mibig:BGC0001316 | PMID:21707799 |
Occurrences 25
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Osteospermum ecklonis NCBITaxon:1053381 |
LOTUS | DOI:10.1016/S0031-9422(00)86154-3 |
| Lotus arenarius NCBITaxon:118906 |
LOTUS | DOI:10.1016/S0031-9422(00)86154-3 |
| Hevea pauciflora NCBITaxon:1318717 |
LOTUS | DOI:10.1016/0031-9422(91)83601-G |
| Hevea pauciflora NCBITaxon:1318717 |
LOTUS | DOI:10.1016/S0031-9422(00)81211-X |
| Hevea spruceana NCBITaxon:1318718 |
LOTUS | DOI:10.1016/S0031-9422(00)81211-X |
| Passiflora pendens NCBITaxon:1341377 |
LOTUS | DOI:10.1016/0031-9422(86)88016-5 |
| Lotus arabicus NCBITaxon:181260 |
LOTUS | DOI:10.1016/S0031-9422(00)86154-3 |
| Lotus creticus NCBITaxon:181267 |
LOTUS | DOI:10.1016/0031-9422(90)89077-M |
| Lotus creticus NCBITaxon:181267 |
LOTUS | DOI:10.1016/S0031-9422(00)86154-3 |
| Lotus edulis NCBITaxon:181270 |
LOTUS | DOI:10.1016/S0031-9422(00)86154-3 |
| Lotus maroccanus NCBITaxon:181276 |
LOTUS | DOI:10.1016/S0031-9422(00)86154-3 |
| Lotus parviflorus NCBITaxon:181280 |
LOTUS | DOI:10.1016/S0031-9422(00)86154-3 |
| Rhodiola rosea NCBITaxon:203015 |
LOTUS | DOI:10.1016/J.FITOTE.2004.06.002 |
| Rhodiola rosea NCBITaxon:203015 |
LOTUS | DOI:10.1248/CPB.49.396 |
| Acacia aroma NCBITaxon:207708 |
LOTUS | DOI:10.1016/0305-1978(83)90023-6 |
| Euphorbia maculata NCBITaxon:216479 |
LOTUS | DOI:10.1248/CPB.57.840 |
| Passiflora adenopoda NCBITaxon:237834 |
LOTUS | DOI:10.1016/0031-9422(86)88016-5 |
| Rhodiola sachalinensis NCBITaxon:265354 |
LOTUS | DOI:10.1248/CPB.49.396 |
| Hevea camargoana NCBITaxon:2733477 |
LOTUS | DOI:10.1016/0031-9422(91)83601-G |
| Euphorbia hirta NCBITaxon:318062 |
LOTUS | DOI:10.1007/S11418-012-0692-5 |
| Passiflora lutea NCBITaxon:330177 |
LOTUS | DOI:10.1016/0305-1978(85)90039-0 |
| Berberidopsis beckleri NCBITaxon:333358 |
LOTUS | DOI:10.1016/0305-1978(88)90112-3 |
| Hevea benthamiana NCBITaxon:336955 |
LOTUS | DOI:10.1016/0031-9422(91)83601-G |
| Hevea benthamiana NCBITaxon:336955 |
LOTUS | DOI:10.1016/S0031-9422(00)81211-X |
| Lotus tenuis NCBITaxon:347996 |
LOTUS | DOI:10.1016/S0031-9422(00)86154-3 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0001316 | Lotus japonicus NCBITaxon:34305 |
CLUSTER_UNSTATED | genbank:MIBIG.BGC0001316.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0001316 | MIBIG | 4 |
This page is generated from data/natural_products/amino_acids_and_peptides/lotaustralin.yaml, which is generated from the committed inventories. Neither is edited by hand.