vancomycin
CHEBI:28001 EXACT SEEDED antibacterial
A complex glycopeptide from Streptomyces orientalis. It inhibits a specific step in the synthesis of the peptidoglycan layer in the Gram-positive bacteria Staphylococcus aureus and Clostridium difficile.
Structure
| Standard InChIKey | MYPYJXKWCTUITO-LYRMYLQWSA-N |
|---|---|
| SMILES | C[C@H]1[C@H]([C@@](C[C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2OC3=C4C=C5C=C3OC6=C(C=C(C=C6)[C@H]([C@H](C(=O)N[C@H](C(=O)N[C@H]5C(=O)N[C@@H]7C8=CC(=C(C=C8)O)C9=C(C=C(C=C9[C@H](NC(=O)[C@H]([C@@H](C1=CC(=C(O4)C=C1)Cl)O)NC7=O)C(=O)O)O)O)CC(=O)N)NC(=O)[C@@H](CC(C)C)NC)O)Cl)CO)O)O)(C)N)O |
| Stereochemistry | fully defined |
| Cross-references | pubchem:14969 |
Filing pathway
Amino acids and peptides — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is saccharide, nrps, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Amycolatopsis orientalis HCCB10007 (ATCC43491) NCBITaxon:1156913 |
BGC_CHARACTERIZED | mibig:BGC0000455 | DOI:10.1021/ja00361a029 |
Occurrences 25
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Ascochyta medicaginicola NCBITaxon:107450 |
LOTUS | DOI:10.1021/NP9005234 |
| Nostoc NCBITaxon:1177 |
LOTUS | DOI:10.1021/ACS.JNATPROD.7B00638 |
| Trichoderma virens NCBITaxon:1331945 |
LOTUS | DOI:10.1021/ACS.JNATPROD.9B00760 |
| Laxitextum incrustatum NCBITaxon:1812024 |
LOTUS | DOI:10.1021/ACS.JNATPROD.5B00950 |
| Nocardia NCBITaxon:1817 |
LOTUS | DOI:10.1021/NP300016R |
| Micromonospora NCBITaxon:1873 |
LOTUS | DOI:10.1021/ACS.JNATPROD.6B00555 |
| Verrucosispora NCBITaxon:1873 |
LOTUS | DOI:10.1021/ACS.JNATPROD.9B00654 |
| Micromonospora NCBITaxon:1873 |
LOTUS | DOI:10.1021/ACS.JNATPROD.9B00808 |
| Verrucosispora NCBITaxon:1873 |
LOTUS | DOI:10.1021/ACS.JNATPROD.9B01185 |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.1016/J.BMC.2018.05.017 |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.1021/ACS.JNATPROD.0C00161 |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.1021/ACS.JNATPROD.8B00544 |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.1021/ACS.JNATPROD.9B00481 |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.1021/NP990088Y |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1021/ACS.JNATPROD.8B00448 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1099/MIC.0.000763 |
| Streptomyces koyangensis NCBITaxon:188770 |
LOTUS | DOI:10.1021/ACS.JNATPROD.8B00448 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1099/MIC.0.000763 |
| Streptomyces hygroscopicus NCBITaxon:1912 |
LOTUS | DOI:10.1021/NP400145U |
| Vibrio spartinae NCBITaxon:1918945 |
LOTUS | DOI:10.1021/ACS.JNATPROD.9B01159 |
| Aspergillus porosus NCBITaxon:1924929 |
LOTUS | DOI:10.1021/ACS.JNATPROD.9B00416 |
| Amycolatopsis orientalis NCBITaxon:31958 |
LOTUS | DOI:10.1186/1471-2164-15-363 |
| Dolomiaea costus NCBITaxon:324593 |
LOTUS | DOI:10.1021/NP030147E |
| Actinospica NCBITaxon:414715 |
LOTUS | DOI:10.1021/NP300470F |
| Streptomyces scopuliridis NCBITaxon:452529 |
LOTUS | DOI:10.1021/NP500399V |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000455 | Amycolatopsis orientalis HCCB10007 (ATCC43491) NCBITaxon:1156913 |
CLUSTER_DEMONSTRATED | genbank:HQ679900.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Bioactivities 2
| Assay | Result | Reference |
|---|---|---|
| BET inhibitor-based combinations targeting novel dependencies in MECOM-rearranged (r) AML: OCI-AML3 cell line | 0.0014 uM | pubchem.aid:2202232 |
| Inhibitor identification of human QSOX1 enzyme: high-throughput screening using ROS-Glo(TM) assay | ACTIVE | pubchem.aid:1347418 |
Elsewhere in the fleet
- AntibioticMech — CHEBI:28001 (same structure, same inchikey)
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000455 | MIBIG | 6 |
| CHEBI:28001 | CHEBI | 3-star |
This page is generated from data/natural_products/amino_acids_and_peptides/vancomycin.yaml, which is generated from the committed inventories. Neither is edited by hand.