2'-amino-2'-deoxyadenosine
naturalproductmech:mibig-92f786b464 MINTED SEEDED
Structure
| Standard InChIKey | CQKMBZHLOYVGHW-QYYRPYCUSA-N |
|---|---|
| SMILES | N[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C=NC2=C1N=CN=C2N |
| Stereochemistry | fully defined |
| Cross-references | npatlas:NPA01164 |
Filing pathway
Carbohydrates — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is other, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Actinomadura sp. ATCC 39365 NCBITaxon:1676613 |
SOURCE_ASSERTION | mibig:BGC0001484 | DOI:10.7164/antibiotics.38.1008 |
Occurrences 15
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Micrococcus luteus NCBITaxon:1270 |
LOTUS | DOI:10.1080/00021369.1985.10867155 |
| Lysinibacillus sphaericus NCBITaxon:1421 |
LOTUS | DOI:10.1080/00021369.1985.10867155 |
| Actinomadura NCBITaxon:1988 |
LOTUS | DOI:10.7164/ANTIBIOTICS.32.1367 |
| Nocardioides simplex NCBITaxon:2045 |
LOTUS | DOI:10.1080/00021369.1985.10867155 |
| Brevundimonas diminuta NCBITaxon:293 |
LOTUS | DOI:10.1080/00021369.1985.10867155 |
| Xanthomonas campestris NCBITaxon:339 |
LOTUS | DOI:10.1080/00021369.1985.10867155 |
| Citrobacter freundii NCBITaxon:546 |
LOTUS | DOI:10.1080/00021369.1985.10867155 |
| Enterobacter aerogenes NCBITaxon:548 |
LOTUS | DOI:10.1080/00021369.1985.10867155 |
| Pantoea agglomerans NCBITaxon:549 |
LOTUS | DOI:10.1080/00021369.1985.10867155 |
| Enterobacter cloacae NCBITaxon:550 |
LOTUS | DOI:10.1080/00021369.1985.10867155 |
| Escherichia coli NCBITaxon:562 |
LOTUS | DOI:10.1080/00021369.1985.10867155 |
| Providencia rettgeri NCBITaxon:587 |
LOTUS | DOI:10.1080/00021369.1985.10867155 |
| Serratia marcescens NCBITaxon:615 |
LOTUS | DOI:10.1080/00021369.1985.10867155 |
| Aeromonas salmonicida NCBITaxon:645 |
LOTUS | DOI:10.1080/00021369.1985.10867155 |
| Aeromonas caviae NCBITaxon:648 |
LOTUS | DOI:10.1080/00021369.1985.10867155 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0001484 | Actinomadura sp. ATCC 39365 NCBITaxon:1676613 |
CLUSTER_UNSTATED | genbank:KP025768.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0001484 | MIBIG | 3 |
This page is generated from data/natural_products/carbohydrates/2-amino-2-deoxyadenosine.yaml, which is generated from the committed inventories. Neither is edited by hand.