blasticidin S
CHEBI:15353 EXACT SEEDED antifungal
A blasticidin that is an antibiotic obtained from Streptomyces griseochromogene.
Structure
| Standard InChIKey | CXNPLSGKWMLZPZ-ZNIXKSQXSA-N |
|---|---|
| SMILES | CN(C(N)=N)CC[C@H](N)CC(N[C@H]1C=C[C@H](N2C=CC(N)=NC2=O)O[C@@H]1C(O)=O)=O |
| Stereochemistry | fully defined |
| Cross-references | pubchem:170012 |
Filing pathway
Carbohydrates — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is other, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Streptomyces griseochromogenes NCBITaxon:68214 |
SOURCE_ASSERTION | mibig:BGC0000874 | PMID:12964155 |
Occurrences 17
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Streptomyces arginensis NCBITaxon:1295550 |
LOTUS | DOI:10.1128/AEM.01172-14 |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.1080/10575639608043253 |
| Streptomyces setonii NCBITaxon:1911 |
LOTUS | DOI:10.7164/ANTIBIOTICS.42.470 |
| Streptomyces lividans NCBITaxon:1916 |
LOTUS | DOI:10.1128/AEM.03254-12 |
| Streptomyces morookaense NCBITaxon:1970 |
LOTUS | DOI:10.1093/OXFORDJOURNALS.JBCHEM.A021929 |
| Streptomyces morookaense NCBITaxon:1970 |
LOTUS | DOI:10.1263/JBB.101.63 |
| Streptomyces griseochromogenes NCBITaxon:68214 |
LOTUS | DOI:10.1002/CBIC.200300583 |
| Streptomyces griseochromogenes NCBITaxon:68214 |
LOTUS | DOI:10.1016/0045-2068(88)90014-4 |
| Streptomyces griseochromogenes NCBITaxon:68214 |
LOTUS | DOI:10.1016/S0031-9422(00)95133-1 |
| Streptomyces griseochromogenes NCBITaxon:68214 |
LOTUS | DOI:10.1016/S0040-4020(99)01060-1 |
| Streptomyces griseochromogenes NCBITaxon:68214 |
LOTUS | DOI:10.1016/S0040-4039(01)83843-0 |
| Streptomyces griseochromogenes NCBITaxon:68214 |
LOTUS | DOI:10.1021/JA00015A074 |
| Streptomyces griseochromogenes NCBITaxon:68214 |
LOTUS | DOI:10.1021/JA00225A033 |
| Streptomyces griseochromogenes NCBITaxon:68214 |
LOTUS | DOI:10.1021/NP970468O |
| Streptomyces griseochromogenes NCBITaxon:68214 |
LOTUS | DOI:10.1139/V94-002 |
| Streptomyces griseochromogenes NCBITaxon:68214 |
LOTUS | DOI:10.7164/ANTIBIOTICS.51.570 |
| Streptomyces griseochromogenes NCBITaxon:68214 |
CHEBI | PMID:12964155 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000874 | Streptomyces griseochromogenes NCBITaxon:68214 |
CLUSTER_UNSTATED | genbank:AY196214.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Elsewhere in the fleet
- AntibioticMech — CHEBI:15353 (same structure, same inchikey)
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000874 | MIBIG | 5 |
| CHEBI:15353 | CHEBI | 3-star |
This page is generated from data/natural_products/carbohydrates/blasticidin-s.yaml, which is generated from the committed inventories. Neither is edited by hand.