kanamycin A
CHEBI:17630 EXACT SEEDED antibacterialenzyme inhibitor
Structure
| Standard InChIKey | SBUJHOSQTJFQJX-NOAMYHISSA-N |
|---|---|
| SMILES | C1[C@H]([C@@H]([C@H]([C@@H]([C@H]1N)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CN)O)O)O)O)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)N)O)N |
| Stereochemistry | fully defined |
| Cross-references | pubchem:6032 |
Filing pathway
Carbohydrates — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is saccharide, from MIBiG.
Producer organisms 5
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Streptomyces kanamyceticus NCBITaxon:1967 |
SOURCE_ASSERTION | mibig:BGC0000702 | PMID:15303497 |
| Streptomyces kanamyceticus NCBITaxon:1967 |
SOURCE_ASSERTION | mibig:BGC0000703 | PMID:16766657 |
| Streptomyces kanamyceticus NCBITaxon:1967 |
SOURCE_ASSERTION | mibig:BGC0000704 | PMID:15313224 |
| Streptomyces kanamyceticus NCBITaxon:1967 |
SOURCE_ASSERTION | mibig:BGC0000705 | PMID:19362651 |
| Streptomyces kanamyceticus NCBITaxon:1967 |
SOURCE_ASSERTION | mibig:BGC0000706 | PMID:16766657 |
Occurrences 24
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Hohenbuehelia grisea NCBITaxon:104357 |
LOTUS | DOI:10.1021/ACS.JNATPROD.7B00713 |
| Nocardia abscessus NCBITaxon:120957 |
LOTUS | DOI:10.1021/ACS.JNATPROD.6B00935 |
| Sparticola junci NCBITaxon:1803578 |
LOTUS | DOI:10.1021/ACS.JNATPROD.9B00604 |
| Verrucosispora NCBITaxon:1873 |
LOTUS | DOI:10.1021/ACS.JNATPROD.9B00654 |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.1021/ACS.JNATPROD.0C00161 |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.1021/JA01548A077 |
| Streptomyces hygroscopicus NCBITaxon:1912 |
LOTUS | DOI:10.1021/NP400145U |
| Aspergillus porosus NCBITaxon:1924929 |
LOTUS | DOI:10.1021/ACS.JNATPROD.9B00416 |
| Streptomyces niveus NCBITaxon:193462 |
LOTUS | DOI:10.1021/NP4006025 |
| Elateriospermum tapos NCBITaxon:212299 |
LOTUS | DOI:10.1021/NP070629G |
| Actinoalloteichus cyanogriseus NCBITaxon:2893586 |
LOTUS | DOI:10.1021/NP4006025 |
| Phoma NCBITaxon:37463 |
LOTUS | DOI:10.1021/ACS.JNATPROD.8B00685 |
| Armillaria NCBITaxon:47424 |
LOTUS | DOI:10.1021/ACS.JNATPROD.8B00685 |
| Pseudoalteromonas NCBITaxon:53246 |
LOTUS | DOI:10.1021/NP500775E |
| Streptomyces venezuelae NCBITaxon:54571 |
LOTUS | DOI:10.1007/S00253-007-1096-4 |
| Myrothecium NCBITaxon:5531 |
LOTUS | DOI:10.1021/NP500142G |
| Streptomyces canus NCBITaxon:58343 |
LOTUS | DOI:10.1021/JF305210U |
| Micromonospora harpali NCBITaxon:686309 |
LOTUS | DOI:10.1021/ACS.JNATPROD.7B00176 |
| Serratia plymuthica NCBITaxon:82996 |
LOTUS | DOI:10.1021/ACS.JNATPROD.7B00565 |
| Streptomyces kanamyceticus NCBITaxon:1967 |
LOTUS | DOI:10.1016/J.ABB.2004.06.009 |
| Streptomyces kanamyceticus NCBITaxon:1967 |
LOTUS | DOI:10.1073/PNAS.0603251103 |
| Streptomyces kanamyceticus NCBITaxon:1967 |
LOTUS | DOI:10.1271/BBB1961.39.1593 |
| Streptomyces kanamyceticus NCBITaxon:1967 |
LOTUS | DOI:10.1371/JOURNAL.PONE.0181971 |
| Streptomyces kanamyceticus NCBITaxon:1967 |
LOTUS | DOI:10.7164/ANTIBIOTICS.57.351 |
Biosynthetic gene clusters 5
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000702 | Streptomyces kanamyceticus NCBITaxon:1967 |
CLUSTER_UNSTATED | genbank:AB164642.1 |
| mibig:BGC0000703 | Streptomyces kanamyceticus NCBITaxon:1967 |
CLUSTER_UNSTATED | genbank:CP023699.1 |
| mibig:BGC0000704 | Streptomyces kanamyceticus NCBITaxon:1967 |
CLUSTER_UNSTATED | genbank:AJ582817.3 |
| mibig:BGC0000705 | Streptomyces kanamyceticus NCBITaxon:1967 |
CLUSTER_UNSTATED | genbank:AJ628422.2 |
| mibig:BGC0000706 | Streptomyces kanamyceticus NCBITaxon:1967 |
CLUSTER_UNSTATED | genbank:AB254081.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Bioactivities 2
| Assay | Result | Reference |
|---|---|---|
| Primary qHTS for inhibitors of SARS-S pseudo-typed particle cell entry | 3.9811 uM | pubchem.aid:1479145 |
| DSSTox (FDAMDD) FDA Maximum (Recommended) Daily Dose Database | ACTIVE | pubchem.aid:1195 |
Elsewhere in the fleet
- AntibioticMech — CHEBI:17630 (same structure, same inchikey)
Open questions 1
shared-structure — This structure is reported by more than one MIBiG entry: BGC0000702, BGC0000703, BGC0000704, BGC0000705, BGC0000706. Confirm they describe the same compound rather than an upstream cross-reference error.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000702 | MIBIG | 5 |
| BGC0000703 | MIBIG | 4 |
| BGC0000704 | MIBIG | 3 |
| BGC0000705 | MIBIG | 3 |
| BGC0000706 | MIBIG | 3 |
| CHEBI:17630 | CHEBI | 3-star |
This page is generated from data/natural_products/carbohydrates/kanamycin-a.yaml, which is generated from the committed inventories. Neither is edited by hand.