lincomycin
CHEBI:6472 EXACT SEEDED antibacterial
A carbohydrate-containing antibiotic produced by the actinomyces Streptomyces lincolnensis.
Structure
| Standard InChIKey | OJMMVQQUTAEWLP-KIDUDLJLSA-N |
|---|---|
| SMILES | CCC[C@@H]1C[C@@H](C(N[C@H]([C@H](O)C)[C@@H]2[C@H](O)[C@H](O)[C@@H](O)[C@@H](SC)O2)=O)N(C)C1 |
| Stereochemistry | fully defined |
| Cross-references | pubchem:3000540, pubchem:9063 |
Filing pathway
Carbohydrates — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is other, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Streptomyces lincolnensis NCBITaxon:1915 |
SOURCE_ASSERTION | mibig:BGC0000907 | PMID:19085073 |
Occurrences 25
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1128/AAC.02247-16 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1128/AAC.02247-16 |
| Streptomyces lincolnensis NCBITaxon:1915 |
LOTUS | DOI:10.1002/BIT.260270318 |
| Streptomyces lincolnensis NCBITaxon:1915 |
LOTUS | DOI:10.1007/S002030050578 |
| Streptomyces lincolnensis NCBITaxon:1915 |
LOTUS | DOI:10.1007/S00253-018-8900-1 |
| Streptomyces lincolnensis NCBITaxon:1915 |
LOTUS | DOI:10.1007/S10295-018-2029-1 |
| Streptomyces lincolnensis NCBITaxon:1915 |
LOTUS | DOI:10.1007/S12223-008-0060-8 |
| Streptomyces lincolnensis NCBITaxon:1915 |
LOTUS | DOI:10.1016/J.BBAPAP.2013.12.005 |
| Streptomyces lincolnensis NCBITaxon:1915 |
LOTUS | DOI:10.1016/J.BBRC.2019.08.079 |
| Streptomyces lincolnensis NCBITaxon:1915 |
LOTUS | DOI:10.1016/J.JBIOSC.2012.07.015 |
| Streptomyces lincolnensis NCBITaxon:1915 |
LOTUS | DOI:10.1021/JA00337A038 |
| Streptomyces lincolnensis NCBITaxon:1915 |
LOTUS | DOI:10.1021/JA00337A039 |
| Streptomyces lincolnensis NCBITaxon:1915 |
LOTUS | DOI:10.1023/A:1012034421088 |
| Streptomyces lincolnensis NCBITaxon:1915 |
LOTUS | DOI:10.1046/J.1472-765X.2003.01432.X |
| Streptomyces lincolnensis NCBITaxon:1915 |
LOTUS | DOI:10.1111/J.1365-2958.1995.TB02338.X |
| Streptomyces lincolnensis NCBITaxon:1915 |
LOTUS | DOI:10.1111/JAM.12919 |
| Streptomyces lincolnensis NCBITaxon:1915 |
LOTUS | DOI:10.1128/AAC.8.5.526 |
| Streptomyces lincolnensis NCBITaxon:1915 |
LOTUS | DOI:10.1128/AEM.02091-18 |
| Streptomyces lincolnensis NCBITaxon:1915 |
LOTUS | DOI:10.1128/JB.00447-17 |
| Streptomyces lincolnensis NCBITaxon:1915 |
LOTUS | DOI:10.1128/JB.00777-17 |
| Streptomyces lincolnensis NCBITaxon:1915 |
LOTUS | DOI:10.1128/JB.146.2.621-631.1981 |
| Streptomyces lincolnensis NCBITaxon:1915 |
LOTUS | DOI:10.1186/1475-2859-9-6 |
| Streptomyces lincolnensis NCBITaxon:1915 |
LOTUS | DOI:10.3389/FMICB.2019.02428 |
| Streptomyces lincolnensis NCBITaxon:1915 |
LOTUS | DOI:10.3390/IJMS13044797 |
| Streptomyces lincolnensis NCBITaxon:1915 |
LOTUS | DOI:10.7164/ANTIBIOTICS.45.1773 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000907 | Streptomyces lincolnensis NCBITaxon:1915 |
CLUSTER_UNSTATED | genbank:EU124663.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Bioactivities 3
| Assay | Result | Reference |
|---|---|---|
| PON Activity Assay from Article 10.3109/14756366.2012.681653: "Impacts of some antibiotics on human serum paraoxonase 1 activity." | KI 18300 uM | PMID:22591317 |
| A screen for compounds that inhibit the activity of LtaS in Staphylococcus aureus | ACTIVE | pubchem.aid:720641 |
| DSSTox (FDAMDD) FDA Maximum (Recommended) Daily Dose Database | ACTIVE | pubchem.aid:1195 |
Elsewhere in the fleet
- AntibioticMech — CHEBI:6472 (same structure, same inchikey)
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000907 | MIBIG | 5 |
| CHEBI:6472 | CHEBI | 3-star |
This page is generated from data/natural_products/carbohydrates/lincomycin.yaml, which is generated from the committed inventories. Neither is edited by hand.