spectinomycin
CHEBI:9215 EXACT SEEDED antibacterialenzyme inhibitor
A pyranobenzodioxin and antibiotic that is active against gram-negative bacteria and used (as its dihydrochloride pentahydrate) to treat gonorrhea. It is produced by the bacterium Streptomyces spectabilis.
Structure
| Standard InChIKey | UNFWWIHTNXNPBV-WXKVUWSESA-N |
|---|---|
| SMILES | C[C@@H]1CC(=O)[C@]2([C@@H](O1)O[C@@H]3[C@H]([C@@H]([C@@H]([C@@H]([C@H]3O2)NC)O)NC)O)O |
| Stereochemistry | fully defined |
| Cross-references | pubchem:15541 |
Filing pathway
Carbohydrates — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is saccharide, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Streptomyces netropsis NCBITaxon:55404 |
SOURCE_ASSERTION | mibig:BGC0000716 | PMID:9245803 |
Occurrences 24
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Ramaria cystidiophora NCBITaxon:113088 |
LOTUS | DOI:10.1021/NP3006277 |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.7164/ANTIBIOTICS.37.1519 |
| Streptomyces venezuelae NCBITaxon:54571 |
LOTUS | DOI:10.1002/JOBM.200410529 |
| Streptomyces venezuelae NCBITaxon:54571 |
LOTUS | DOI:10.1007/S10295-019-02172-8 |
| Streptomyces venezuelae NCBITaxon:54571 |
LOTUS | DOI:10.1016/J.JBIOTEC.2014.01.028 |
| Streptomyces venezuelae NCBITaxon:54571 |
LOTUS | DOI:10.1111/J.1365-2672.2008.03788.X |
| Streptomyces venezuelae NCBITaxon:54571 |
LOTUS | DOI:10.1111/J.1574-6968.2000.TB08955.X |
| Streptomyces venezuelae NCBITaxon:54571 |
LOTUS | DOI:10.1128/JB.177.3.818-822.1995 |
| Streptomyces venezuelae NCBITaxon:54571 |
LOTUS | DOI:10.7164/ANTIBIOTICS.47.1425 |
| Streptomyces spectabilis NCBITaxon:68270 |
LOTUS | DOI:10.1002/JOBM.200410529 |
| Streptomyces spectabilis NCBITaxon:68270 |
LOTUS | DOI:10.1007/S10295-019-02172-8 |
| Streptomyces spectabilis NCBITaxon:68270 |
LOTUS | DOI:10.1016/J.JBIOTEC.2014.01.028 |
| Streptomyces spectabilis NCBITaxon:68270 |
LOTUS | DOI:10.1021/JA00875A053 |
| Streptomyces spectabilis NCBITaxon:68270 |
LOTUS | DOI:10.1111/J.1365-2672.2008.03788.X |
| Streptomyces spectabilis NCBITaxon:68270 |
LOTUS | DOI:10.1111/J.1574-6968.2000.TB08955.X |
| Streptomyces spectabilis NCBITaxon:68270 |
LOTUS | DOI:10.1128/JB.177.3.818-822.1995 |
| Streptomyces spectabilis NCBITaxon:68270 |
LOTUS | DOI:10.7164/ANTIBIOTICS.47.1425 |
| Streptomyces netropsis NCBITaxon:55404 |
LOTUS | DOI:10.1002/JOBM.200410529 |
| Streptomyces netropsis NCBITaxon:55404 |
LOTUS | DOI:10.1007/S10295-019-02172-8 |
| Streptomyces netropsis NCBITaxon:55404 |
LOTUS | DOI:10.1016/J.JBIOTEC.2014.01.028 |
| Streptomyces netropsis NCBITaxon:55404 |
LOTUS | DOI:10.1111/J.1365-2672.2008.03788.X |
| Streptomyces netropsis NCBITaxon:55404 |
LOTUS | DOI:10.1111/J.1574-6968.2000.TB08955.X |
| Streptomyces netropsis NCBITaxon:55404 |
LOTUS | DOI:10.1128/JB.177.3.818-822.1995 |
| Streptomyces netropsis NCBITaxon:55404 |
LOTUS | DOI:10.7164/ANTIBIOTICS.47.1425 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000716 | Streptomyces netropsis NCBITaxon:55404 |
CLUSTER_UNSTATED | genbank:U70376.2 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Bioactivities 7
| Assay | Result | Reference |
|---|---|---|
| qHTS Assay for Inhibitors of the Human Apurinic/apyrimidinic Endonuclease 1 (APE1) | 3.5481 uM | pubchem.aid:2517 |
| DSSTox (FDAMDD) FDA Maximum (Recommended) Daily Dose Database | ACTIVE | pubchem.aid:1195 |
| Diffuse intrinsic pontine glioma (JHH-DIPG-1) cell line screen of MIPE4.0 library: viability qHTS assay using CellTiter-Glo | ACTIVE | pubchem.aid:1347062 |
| Diffuse intrinsic pontine glioma (SU-DIPG-IV) cell line screen of MIPE4.0 library: viability qHTS assay using CellTiter-Glo | ACTIVE | pubchem.aid:1347063 |
| Diffuse intrinsic pontine glioma (SU-DIPG-VI) cell line screen of MIPE4.0 library: viability qHTS assay using CellTiter-Glo | ACTIVE | pubchem.aid:1347066 |
| Diffuse intrinsic pontine glioma (SU-DIPG-XIII) cell line screen of MIPE4.0 library: viability qHTS assay using CellTiter-Glo | ACTIVE | pubchem.aid:1347061 |
| High Throughput Screen to Identify Inhibitors of Mycobacterium tuberculosis H37Rv | ACTIVE | pubchem.aid:1332 |
Elsewhere in the fleet
- AntibioticMech — CHEBI:9215 (same structure, same inchikey)
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000716 | MIBIG | 5 |
| CHEBI:9215 | CHEBI | 3-star |
This page is generated from data/natural_products/carbohydrates/spectinomycin.yaml, which is generated from the committed inventories. Neither is edited by hand.