streptomycin
CHEBI:17076 EXACT SEEDED antibacterialenzyme inhibitortoxin
A amino cyclitol glycoside that consists of streptidine having a disaccharyl moiety attached at the 4-position. The parent of the streptomycin class
Structure
| Standard InChIKey | UCSJYZPVAKXKNQ-HZYVHMACSA-N |
|---|---|
| SMILES | C[C@H]1[C@@]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H]([C@@H]([C@H]2O)O)N=C(N)N)O)N=C(N)N)O[C@H]3[C@H]([C@@H]([C@H]([C@@H](O3)CO)O)O)NC)(C=O)O |
| Stereochemistry | fully defined |
| Cross-references | pubchem:19649 |
Filing pathway
Carbohydrates — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is saccharide, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Streptomyces griseus subsp. griseus NBRC 13350 NCBITaxon:455632 |
SOURCE_ASSERTION | mibig:BGC0000724 | PMID:18375553 |
Occurrences 25
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Aspergillus sclerotiorum NCBITaxon:138282 |
LOTUS | DOI:10.1021/ACS.JNATPROD.5B00961 |
| Lyngbya majuscula NCBITaxon:158786 |
LOTUS | DOI:10.1021/NP1006839 |
| Senecio NCBITaxon:18794 |
LOTUS | DOI:10.1021/NP0702741 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1099/00221287-129-9-2939 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1111/J.1365-2958.2005.04817.X |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1128/AEM.00546-13 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1128/JB.168.1.257-269.1986 |
| Streptomyces bikiniensis NCBITaxon:1896 |
LOTUS | DOI:10.7164/ANTIBIOTICS.30.404 |
| Streptomyces bikiniensis NCBITaxon:1896 |
LOTUS | DOI:10.7164/ANTIBIOTICS.38.636 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1099/00221287-129-9-2939 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1111/J.1365-2958.2005.04817.X |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1128/AEM.00546-13 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1128/JB.168.1.257-269.1986 |
| Streptomyces glaucescens NCBITaxon:1907 |
LOTUS | DOI:10.1046/J.1432-1327.1998.2581059.X |
| Streptomyces griseus NCBITaxon:1911 |
LOTUS | DOI:10.1007/BF00211140 |
| Streptomyces griseus NCBITaxon:1911 |
LOTUS | DOI:10.1007/BF00264220 |
| Streptomyces griseus NCBITaxon:1911 |
LOTUS | DOI:10.1007/BF00293829 |
| Streptomyces griseus NCBITaxon:1911 |
LOTUS | DOI:10.1007/BF00330443 |
| Streptomyces griseus NCBITaxon:1911 |
LOTUS | DOI:10.1016/0304-4165(79)90095-3 |
| Streptomyces griseus NCBITaxon:1911 |
LOTUS | DOI:10.1016/0378-1119(83)90178-6 |
| Streptomyces griseus NCBITaxon:1911 |
LOTUS | DOI:10.1016/B978-0-08-025385-5.50022-5 |
| Streptomyces griseus NCBITaxon:1911 |
LOTUS | DOI:10.1021/BI981949P |
| Streptomyces griseus NCBITaxon:1911 |
LOTUS | DOI:10.1021/JA01187A006 |
| Streptomyces griseus NCBITaxon:1911 |
LOTUS | DOI:10.1038/JA.2009.97 |
| Streptomyces griseus NCBITaxon:1911 |
LOTUS | DOI:10.1038/SJ.JIM.7000068 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000724 | Streptomyces griseus subsp. griseus NBRC 13350 NCBITaxon:455632 |
CLUSTER_UNSTATED | genbank:AP009493.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Bioactivities 6
| Assay | Result | Reference |
|---|---|---|
| Inhibitors of the vitamin D receptor (VDR): qHTS | 70.7946 uM | pubchem.aid:504847 |
| qHTS Assay for Inhibitors of Aldehyde Dehydrogenase 1 (ALDH1A1) | 39.8107 uM | pubchem.aid:1030 |
| qHTS Assay for Inhibitors of Histone Lysine Methyltransferase G9a | 17.7828 uM | pubchem.aid:504332 |
| CCRIS mutagenicity studies | ACTIVE | pubchem.aid:1259407 |
| DSSTox (FDAMDD) FDA Maximum (Recommended) Daily Dose Database | ACTIVE | pubchem.aid:1195 |
| GENE-TOX mutagenicity studies | ACTIVE | pubchem.aid:1259408 |
Elsewhere in the fleet
- AntibioticMech — CHEBI:17076 (same structure, same inchikey)
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000724 | MIBIG | 5 |
| CHEBI:17076 | CHEBI | 3-star |
This page is generated from data/natural_products/carbohydrates/streptomycin.yaml, which is generated from the committed inventories. Neither is edited by hand.