streptothricin F
naturalproductmech:mibig-1398555989 REVIEW_NEEDED SEEDED antibacterial
Structure
| Standard InChIKey | NRAUADCLPJTGSF-VLSXYIQESA-N |
|---|---|
| SMILES | NCCC[C@H](N)CC(=O)N[C@@H]1[C@H](O)[C@@H](OC(N)=O)[C@@H](CO)O[C@H]1\N=C1\N[C@H]2[C@H](N1)C(=O)NC[C@H]2O |
| Stereochemistry | fully defined |
Filing pathway
Carbohydrates — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is nrps, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Streptomyces rochei NBRC 12908 NCBITaxon:1928 |
SOURCE_ASSERTION | mibig:BGC0000432 | DOI:10.1038/nchembio.1040 |
Occurrences 13
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.1016/0045-2068(91)90058-W |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.1016/S0040-4020(01)88659-2 |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.1021/JA00354A047 |
| Streptomyces lavendulae NCBITaxon:1914 |
LOTUS | DOI:10.1039/P19880002283 |
| Streptomyces lavendulae NCBITaxon:1914 |
LOTUS | DOI:10.1128/JB.169.5.1929-1937.1987 |
| Streptomyces lavendulae NCBITaxon:1914 |
LOTUS | DOI:10.7164/ANTIBIOTICS.21.98 |
| Streptomyces lavendulae NCBITaxon:1914 |
LOTUS | DOI:10.7164/ANTIBIOTICS.37.368 |
| Streptomyces lavendulae NCBITaxon:1914 |
LOTUS | DOI:10.7164/ANTIBIOTICS.40.1016 |
| Streptomyces noursei NCBITaxon:1971 |
LOTUS | DOI:10.1002/JOBM.3620250505 |
| Streptomyces qinlingensis NCBITaxon:360709 |
LOTUS | DOI:10.1038/JA.2007.96 |
| Streptomyces nojiriensis NCBITaxon:66374 |
LOTUS | DOI:10.7164/ANTIBIOTICS.40.1140 |
| Streptomyces griseochromogenes NCBITaxon:68214 |
LOTUS | DOI:10.1016/0045-2068(88)90014-4 |
| Streptomyces rochei NCBITaxon:1928 |
LOTUS | DOI:10.1128/JB.180.16.4017-4023.1998 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000432 | Streptomyces rochei NBRC 12908 NCBITaxon:1928 |
CLUSTER_DEMONSTRATED | genbank:AB684619.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Elsewhere in the fleet
- AntibioticMech — CHEBI:60821 (same structure, same inchikey)
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000432 | MIBIG | 6 |
| CHEBI:26789 | CHEBI | 3-star |
| CHEBI:60821 | CHEBI | 3-star |
This page is generated from data/natural_products/carbohydrates/streptothricin-f.yaml, which is generated from the committed inventories. Neither is edited by hand.