falcarindiol
naturalproductmech:mibig-69d89b774c MINTED SEEDED
Structure
| Standard InChIKey | QWCNQXNAFCBLLV-YWALDVPYSA-N |
|---|---|
| SMILES | CCCCCCC/C=C\[C@@H](C#CC#C[C@@H](C=C)O)O |
| Stereochemistry | fully defined |
| Cross-references | pubchem:5281148 |
Filing pathway
Fatty acids — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is other, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Solanum lycopersicum NCBITaxon:4081 |
BGC_CHARACTERIZED | mibig:BGC0002404 | DOI:10.1016/j.jep.2007.05.005 |
Occurrences 25
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Anthriscus nitida NCBITaxon:109081 |
LOTUS | DOI:10.1016/0305-1978(95)00058-5 |
| Chaerophyllum aureum NCBITaxon:109094 |
LOTUS | DOI:10.1515/ZNC-2003-7-818 |
| Chaerophyllum hirsutum NCBITaxon:109101 |
LOTUS | DOI:10.1021/NP040046W |
| Cussonia arborea NCBITaxon:1260347 |
LOTUS | DOI:10.1055/S-2006-957492 |
| Schefflera taiwaniana NCBITaxon:1433837 |
LOTUS | DOI:10.1002/JCCS.200200067 |
| Oreocome striata NCBITaxon:1508160 |
LOTUS | DOI:10.1248/CPB.35.4789 |
| Angelica sinensis NCBITaxon:165353 |
LOTUS | DOI:10.1002/(SICI)1099-1565(199811/12)9:6<283::AID-PCA419>3.0.CO;2-9 |
| Angelica sinensis NCBITaxon:165353 |
LOTUS | DOI:10.1002/PTR.2303 |
| Angelica sinensis NCBITaxon:165353 |
LOTUS | DOI:10.1021/NP050301S |
| Hansenia forbesii NCBITaxon:165499 |
LOTUS | DOI:10.1016/J.BMC.2007.12.021 |
| Oplopanax horridus NCBITaxon:182917 |
LOTUS | DOI:10.1021/NP900674D |
| Oplopanax horridus NCBITaxon:182917 |
LOTUS | DOI:10.1021/NP970182J |
| Cussonia zimmermannii NCBITaxon:1899105 |
LOTUS | DOI:10.1021/NP0702133 |
| Saposhnikovia divaricata NCBITaxon:203717 |
LOTUS | DOI:10.1055/S-2000-8624 |
| Oenanthe fistulosa NCBITaxon:254046 |
LOTUS | DOI:10.1021/NP8007717 |
| Angelica japonica NCBITaxon:265806 |
LOTUS | DOI:10.1016/S0960-894X(97)10193-7 |
| Angelica japonica NCBITaxon:265806 |
LOTUS | DOI:10.1248/CPB.47.96 |
| Angelica pubescens NCBITaxon:312530 |
LOTUS | DOI:10.1002/(SICI)1099-1565(199811/12)9:6<283::AID-PCA419>3.0.CO;2-9 |
| Angelica pubescens NCBITaxon:312530 |
LOTUS | DOI:10.1016/S0031-9422(97)00951-5 |
| Angelica pubescens NCBITaxon:312530 |
LOTUS | DOI:10.1055/S-2006-957507 |
| Kitagawia praeruptora NCBITaxon:312531 |
LOTUS | DOI:10.1021/JF960025A |
| Schefflera digitata NCBITaxon:327232 |
LOTUS | DOI:10.1055/S-2007-971421 |
| Angelica keiskei NCBITaxon:357850 |
LOTUS | DOI:10.1016/S0304-3835(03)00466-X |
| Ferula foetida NCBITaxon:371345 |
LOTUS | DOI:10.1021/NP010541H |
| Ferula linkii NCBITaxon:371362 |
LOTUS | DOI:10.1016/0031-9422(93)85291-X |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0002404 | Solanum lycopersicum NCBITaxon:4081 |
CLUSTER_DEMONSTRATED | genbank:GPC_000003970.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0002404 | MIBIG | 2 |
This page is generated from data/natural_products/fatty_acids/falcarindiol.yaml, which is generated from the committed inventories. Neither is edited by hand.