citreoviridin
naturalproductmech:mibig-c097f8fa78 MINTED SEEDED
Structure
| Standard InChIKey | JLSVDPQAIKFBTO-OMCRQDLASA-N |
|---|---|
| SMILES | C[C@@H]1[C@]([C@H]([C@](O1)(C)/C=C(\C)/C=C/C=C/C=C/C2=C(C(=CC(=O)O2)OC)C)O)(C)O |
| Stereochemistry | fully defined |
| Cross-references | pubchem:6436023 |
Filing pathway
Polyketides — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is pks, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Aspergillus terreus NIH2624 NCBITaxon:341663 |
SOURCE_ASSERTION | mibig:BGC0001400 | DOI:10.1042/bj1700503 |
Occurrences 12
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Penicillium pulvillorum NCBITaxon:104261 |
LOTUS | DOI:10.1039/C39850001531 |
| Penicillium pulvillorum NCBITaxon:104261 |
LOTUS | DOI:10.1039/P19820002175 |
| Penicillium pedemontanum NCBITaxon:1343405 |
LOTUS | DOI:10.1016/S0040-4039(00)97883-3 |
| Penicillium pedemontanum NCBITaxon:1343405 |
LOTUS | DOI:10.1246/CL.1997.33 |
| Aspergillus terreus NCBITaxon:33178 |
LOTUS | DOI:10.1021/ACS.ORGLETT.6B00299 |
| Penicillium miczynskii NCBITaxon:36645 |
LOTUS | DOI:10.1016/S0040-4039(00)97883-3 |
| Penicillium miczynskii NCBITaxon:36645 |
LOTUS | DOI:10.1246/CL.1997.33 |
| Aspergillus aureoterreus NCBITaxon:41288 |
LOTUS | DOI:10.1021/ACS.ORGLETT.6B00299 |
| Penicillium citreoviride NCBITaxon:64494 |
LOTUS | DOI:10.1246/CL.1987.515 |
| Penicillium simplicissimum NCBITaxon:69488 |
LOTUS | DOI:10.1039/C39850001531 |
| Penicillium simplicissimum NCBITaxon:69488 |
LOTUS | DOI:10.1039/P19820002175 |
| Penicillium citreonigrum NCBITaxon:69768 |
LOTUS | DOI:10.1246/CL.1987.515 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0001400 | Aspergillus terreus NIH2624 NCBITaxon:341663 |
CLUSTER_UNSTATED | genbank:CH476608.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0001400 | MIBIG | 3 |
This page is generated from data/natural_products/polyketides/citreoviridin.yaml, which is generated from the committed inventories. Neither is edited by hand.