flaviolin
naturalproductmech:mibig-cfe2b5c0a9 MINTED SEEDED
Structure
| Standard InChIKey | XNPCAGMCQDGQKK-UHFFFAOYSA-N |
|---|---|
| SMILES | C1=C(C=C2C(=C1O)C(=CC(=O)C2=O)O)O |
| Stereochemistry | fully defined |
| Cross-references | pubchem:160478, npatlas:NPA032742 |
Filing pathway
Polyketides — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is pks, saccharide, from MIBiG.
Producer organisms 3
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Saccharopolyspora erythraea NCBITaxon:1836 |
BGC_CHARACTERIZED | mibig:BGC0000285 | PMID:12028378 |
| Saccharopolyspora erythraea NRRL 2338 NCBITaxon:405948 |
SOURCE_ASSERTION | mibig:BGC0000902 | PMID:22187221 |
| Streptomyces coelicolor A3(2) NCBITaxon:100226 |
SOURCE_ASSERTION | mibig:BGC0002127 | PMID:12905073 |
Occurrences 12
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1007/S10295-003-0075-8 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1007/S10295-013-1383-2 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1186/S12934-015-0335-0 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1007/S10295-003-0075-8 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1007/S10295-013-1383-2 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1186/S12934-015-0335-0 |
| Verticillium dahliae NCBITaxon:27337 |
LOTUS | DOI:10.1007/BF00567298 |
| Verticillium dahliae NCBITaxon:27337 |
LOTUS | DOI:10.1007/BF00567299 |
| Leptosphaeria maculans NCBITaxon:5022 |
LOTUS | DOI:10.1016/0031-9422(88)80752-0 |
| Streptomyces venezuelae NCBITaxon:54571 |
LOTUS | DOI:10.1007/S10529-009-0152-9 |
| Aspergillus fumigatus NCBITaxon:746128 |
LOTUS | DOI:10.1080/13693780802307720 |
| Saccharopolyspora erythraea NCBITaxon:1836 |
LOTUS | DOI:10.1046/J.1365-2958.2002.02975.X |
Biosynthetic gene clusters 3
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000285 | Saccharopolyspora erythraea NCBITaxon:1836 |
CLUSTER_DEMONSTRATED | genbank:AY078067.1 |
| mibig:BGC0000902 | Saccharopolyspora erythraea NRRL 2338 NCBITaxon:405948 |
CLUSTER_UNSTATED | genbank:AM420293.1 |
| mibig:BGC0002127 | Streptomyces coelicolor A3(2) NCBITaxon:100226 |
CLUSTER_DEMONSTRATED | genbank:AL645882.2 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Bioactivities 8
| Assay | Result | Reference |
|---|---|---|
| OTUD3 deubiquitinase inhibition: Primary qHTS | ACTIVE | pubchem.aid:1645858 |
| UCHL1 deubiquitinase inhibition: Primary qHTS | ACTIVE | pubchem.aid:1645859 |
| USP10 deubiquitinase inhibition: Primary qHTS | ACTIVE | pubchem.aid:1645856 |
| USP17 deubiquitinase inhibition: Primary qHTS | ACTIVE | pubchem.aid:1645855 |
| USP28 deubiquitinase inhibition: Primary qHTS | ACTIVE | pubchem.aid:1645857 |
| USP30 deubiquitinase inhibition: Primary qHTS | ACTIVE | pubchem.aid:1645860 |
| USP7 deubiquitinase inhibition: Primary qHTS | ACTIVE | pubchem.aid:1645854 |
| USP8 deubiquitinase inhibition: Primary qHTS | ACTIVE | pubchem.aid:1645853 |
Open questions 1
shared-structure — This structure is reported by more than one MIBiG entry: BGC0000285, BGC0000902, BGC0002127. Confirm they describe the same compound rather than an upstream cross-reference error.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000285 | MIBIG | 5 |
| BGC0000902 | MIBIG | 4 |
| BGC0002127 | MIBIG | 3 |
This page is generated from data/natural_products/polyketides/flaviolin.yaml, which is generated from the committed inventories. Neither is edited by hand.