flavoglaucin
naturalproductmech:mibig-be4adf1947 MINTED SEEDED
Structure
| Standard InChIKey | RGRXZGKXEJHPQQ-UHFFFAOYSA-N |
|---|---|
| SMILES | CCCCCCCC1=C(O)C=C(CC=C(C)C)C(O)=C1C=O |
| Stereochemistry | fully defined |
| Cross-references | pubchem:119037, npatlas:NPA033320 |
Filing pathway
Polyketides — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is pks, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Aspergillus ruber CBS 135680 NCBITaxon:1388766 |
SOURCE_ASSERTION | mibig:BGC0002234 | PMID:32134669 |
Occurrences 17
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Penicillium dierckxii NCBITaxon:121611 |
LOTUS | DOI:10.1248/CPB.20.2727 |
| Aspergillus repens NCBITaxon:1405805 |
LOTUS | DOI:10.1021/NP200147C |
| Aspergillus chevalieri NCBITaxon:182096 |
LOTUS | DOI:10.1007/BF02540819 |
| Aspergillus chevalieri NCBITaxon:182096 |
LOTUS | DOI:10.1271/BBB1961.45.313 |
| Talipariti tiliaceum NCBITaxon:183267 |
LOTUS | DOI:10.1248/CPB.56.1282 |
| Microsporum NCBITaxon:34392 |
LOTUS | DOI:10.1248/CPB.54.882 |
| Aspergillus ruber NCBITaxon:396024 |
LOTUS | DOI:10.1080/00021369.1980.10864196 |
| Aspergillus ruber NCBITaxon:396024 |
LOTUS | DOI:10.1248/CPB.37.621 |
| Aspergillus ruber NCBITaxon:396024 |
LOTUS | DOI:10.1248/CPB.56.1282 |
| Aspergillus ruber NCBITaxon:396024 |
LOTUS | DOI:10.1271/BBB1961.44.1685 |
| Aspergillus glaucus NCBITaxon:41413 |
LOTUS | DOI:10.1002/CBER.19430760408 |
| Aspergillus glaucus NCBITaxon:41413 |
LOTUS | DOI:10.1038/164026A0 |
| Aspergillus glaucus NCBITaxon:41413 |
LOTUS | DOI:10.1039/JR9370000080 |
| Aspergillus glaucus NCBITaxon:41413 |
LOTUS | DOI:10.1271/BBB.67.1443 |
| Aspergillus glaucus NCBITaxon:41413 |
LOTUS | DOI:10.1271/BBB.80887 |
| Aspergillus amstelodami NCBITaxon:5054 |
LOTUS | DOI:10.1248/CPB1953.1.160 |
| Penicillium charlesii NCBITaxon:69767 |
LOTUS | DOI:10.1248/CPB.20.2727 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0002234 | Aspergillus ruber CBS 135680 NCBITaxon:1388766 |
CLUSTER_DEMONSTRATED | genbank:KK088422.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0002234 | MIBIG | 3 |
This page is generated from data/natural_products/polyketides/flavoglaucin.yaml, which is generated from the committed inventories. Neither is edited by hand.