nystatin A1
CHEBI:473992 EXACT SEEDED antifungal
A polyene macrolide antibiotic; part of the nystatin complex produced by several Streptomyces species. It is an antifungal antibiotic used for the treatment of topical fungal infections caused by a broad spectrum of fungal pathogens comprising yeast-like and filamentous species.
Structure
| Standard InChIKey | VQOXZBDYSJBXMA-NQTDYLQESA-N |
|---|---|
| SMILES | C[C@H]1/C=C/C=C/CC/C=C/C=C/C=C/C=C/[C@@H](C[C@H]2[C@@H]([C@H](C[C@](O2)(C[C@H]([C@@H](CC[C@H](C[C@H](C[C@H](CC(=O)O[C@H]([C@@H]([C@@H]1O)C)C)O)O)O)O)O)O)O)C(=O)O)O[C@H]3[C@H]([C@H]([C@@H]([C@H](O3)C)O)N)O |
| Stereochemistry | fully defined |
| Cross-references | pubchem:11286230 |
Filing pathway
Polyketides — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is pks, saccharide, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Streptomyces noursei ATCC 11455 NCBITaxon:316284 |
BGC_CHARACTERIZED | mibig:BGC0000115 | PMID:10873841 |
Occurrences 25
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Hohenbuehelia grisea NCBITaxon:104357 |
LOTUS | DOI:10.1021/ACS.JNATPROD.7B00713 |
| Oscillatoria NCBITaxon:1158 |
LOTUS | DOI:10.1021/ACS.JNATPROD.8B00650 |
| Microporus NCBITaxon:1191098 |
LOTUS | DOI:10.1021/ACS.JNATPROD.7B00764 |
| Lonchocarpus chiricanus NCBITaxon:1582177 |
LOTUS | DOI:10.1021/NP000597W |
| Sparticola junci NCBITaxon:1803578 |
LOTUS | DOI:10.1021/ACS.JNATPROD.9B00604 |
| Streptomyces noursei NCBITaxon:1971 |
CHEBI | 10.1016/S0040-4039(01)96531-1 |
| Streptomyces noursei NCBITaxon:1971 |
LOTUS | DOI:10.1007/S002530100613 |
| Streptomyces noursei NCBITaxon:1971 |
LOTUS | DOI:10.1016/J.CHEMBIOL.2008.08.009 |
| Streptomyces noursei NCBITaxon:1971 |
LOTUS | DOI:10.1016/J.FEMSLE.2005.05.052 |
| Streptomyces noursei NCBITaxon:1971 |
LOTUS | DOI:10.1016/S0040-4039(01)96531-1 |
| Streptomyces noursei NCBITaxon:1971 |
LOTUS | DOI:10.1016/S1074-5521(00)00120-4 |
| Streptomyces noursei NCBITaxon:1971 |
LOTUS | DOI:10.1074/JBC.M212611200 |
| Streptomyces noursei NCBITaxon:1971 |
LOTUS | DOI:10.1099/00221287-146-3-611 |
| Streptomyces noursei NCBITaxon:1971 |
LOTUS | DOI:10.1111/J.1574-6968.1999.TB13746.X |
| Streptomyces noursei NCBITaxon:1971 |
LOTUS | DOI:10.1128/JB.186.5.1345-1354.2004 |
| Nocardiopsis NCBITaxon:2013 |
LOTUS | DOI:10.1021/ACS.JNATPROD.8B00708 |
| Sporormiella similis NCBITaxon:269685 |
LOTUS | DOI:10.1021/ACS.JNATPROD.7B00064 |
| Streptomyces sp. HSG2 NCBITaxon:2797167 |
CHEBI | PMID:33932153 |
| Amycolatopsis aidingensis NCBITaxon:2842453 |
CHEBI | PMID:34938275 |
| Phoma NCBITaxon:37463 |
LOTUS | DOI:10.1021/ACS.JNATPROD.8B00685 |
| Streptomyces ahygroscopicus NCBITaxon:387846 |
CHEBI | PMID:24231162 |
| Streptomyces ahygroscopicus NCBITaxon:387850 |
LOTUS | DOI:10.1007/S10295-015-1660-3 |
| Streptomyces ahygroscopicus NCBITaxon:387850 |
LOTUS | DOI:10.1016/J.MICRES.2013.09.017 |
| Hyalangium minutum NCBITaxon:394096 |
LOTUS | DOI:10.1021/NP200776V |
| Armillaria NCBITaxon:47424 |
LOTUS | DOI:10.1021/ACS.JNATPROD.8B00685 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000115 | Streptomyces noursei ATCC 11455 NCBITaxon:316284 |
CLUSTER_DEMONSTRATED | genbank:AF263912.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Elsewhere in the fleet
- AntibioticMech — CHEBI:473992 (same structure, same inchikey)
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000115 | MIBIG | 5 |
| CHEBI:473992 | CHEBI | 3-star |
This page is generated from data/natural_products/polyketides/nystatin-a1.yaml, which is generated from the committed inventories. Neither is edited by hand.