o-orsellinate depside
CHEBI:15871 EXACT SEEDED
Structure
| Standard InChIKey | HEMSJKZDHNSSEW-UHFFFAOYSA-N |
|---|---|
| SMILES | CC1=CC(=CC(=C1C(=O)OC2=CC(=C(C(=C2)C)C(=O)O)O)O)O |
| Stereochemistry | fully defined |
| Cross-references | npatlas:NPA021170 |
Filing pathway
Polyketides — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is pks, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Claviceps purpurea 20.1 NCBITaxon:1111077 |
SOURCE_ASSERTION | mibig:BGC0002596 | PMID:33130255 |
Occurrences 25
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Dimelaena oreina NCBITaxon:116793 |
LOTUS | DOI:10.1080/00275514.1984.12023819 |
| Dimelaena oreina NCBITaxon:116793 |
LOTUS | DOI:10.2307/3792846 |
| Umbilicaria angulata NCBITaxon:1217314 |
LOTUS | DOI:10.1515/ZNC-1992-1-202 |
| Ochrolechia parella NCBITaxon:129506 |
LOTUS | DOI:10.1021/NP060561P |
| Ochrolechia parella NCBITaxon:129506 |
LOTUS | DOI:10.1021/NP060561P.S001 |
| Umbilicaria polyphylla NCBITaxon:136372 |
LOTUS | DOI:10.1515/ZNC-1992-1-202 |
| Parmotrema nilgherrense NCBITaxon:1450753 |
LOTUS | DOI:10.1071/CH00137 |
| Parmotrema grayanum NCBITaxon:1566122 |
LOTUS | DOI:10.3390/JOF9010116 |
| Umbilicaria esculenta NCBITaxon:161684 |
LOTUS | DOI:10.1515/ZNC-1992-1-202 |
| Umbilicaria mammulata NCBITaxon:161685 |
LOTUS | DOI:10.1515/ZNC-1992-1-202 |
| Pseudocyphellaria crocata NCBITaxon:161975 |
LOTUS | DOI:10.1139/B75-121 |
| Aspergillus nidulans NCBITaxon:162425 |
LOTUS | DOI:10.1073/PNAS.0901870106 |
| Umbilicaria virginis NCBITaxon:164626 |
LOTUS | DOI:10.1515/ZNC-1992-1-202 |
| Hypotrachyna horrescens NCBITaxon:1709390 |
LOTUS | DOI:10.1071/CH9762701 |
| Parmelina tiliacea NCBITaxon:172629 |
LOTUS | DOI:10.2307/1218225 |
| Punctelia borreri NCBITaxon:172639 |
LOTUS | DOI:10.2307/1218225 |
| Umbilicaria freyi NCBITaxon:1980225 |
LOTUS | DOI:10.1515/ZNC-1992-1-202 |
| Umbilicaria josiae NCBITaxon:1980227 |
LOTUS | DOI:10.1515/ZNC-1992-1-202 |
| Parmotrema stuppeum NCBITaxon:2041279 |
LOTUS | DOI:10.1515/ZNC-2000-11-1227 |
| Parmotrema stuppeum NCBITaxon:2041279 |
LOTUS | DOI:10.3390/JOF9010116 |
| Umbilicaria proboscidea NCBITaxon:232780 |
LOTUS | DOI:10.1515/ZNC-1992-1-202 |
| Parmelia cetrata NCBITaxon:235861 |
LOTUS | DOI:10.3390/JOF9010116 |
| Parmotrema tinctorum NCBITaxon:235862 |
LOTUS | DOI:10.1002/J.1537-2197.1981.TB06359.X |
| Parmotrema tinctorum NCBITaxon:235862 |
LOTUS | DOI:10.1071/CH9762701 |
| Parmotrema tinctorum NCBITaxon:235862 |
LOTUS | DOI:10.1093/CHROMSCI/36.1.8 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0002596 | Claviceps purpurea 20.1 NCBITaxon:1111077 |
CLUSTER_UNSTATED | genbank:CAGA01000059.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Open questions 1
name-disagreement — ChEBI calls this structure 'o-orsellinate depside' and MIBiG calls it 'lecanoric acid'. They share a Standard InChIKey, so if the names denote different compounds then one upstream record has the wrong structure. Check which.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0002596 | MIBIG | 2 |
| CHEBI:15871 | CHEBI | 3-star |
This page is generated from data/natural_products/polyketides/o-orsellinate-depside.yaml, which is generated from the committed inventories. Neither is edited by hand.