oligomycin
naturalproductmech:mibig-86258f37c8 MINTED SEEDED enzyme inhibitor
Structure
| Standard InChIKey | MNULEGDCPYONBU-WMBHJXFZSA-N |
|---|---|
| SMILES | CC[C@H]\1CC[C@@H]2[C@@H]([C@@H]([C@H]([C@@]3(O2)CC[C@H]([C@H](O3)C[C@H](C)O)C)C)OC(=O)/C=C/[C@H]([C@@H]([C@H](C(=O)[C@H]([C@@H]([C@H](C(=O)[C@@]([C@@H]([C@H](C/C=C/C=C1)C)O)(C)O)C)O)C)C)O)C)C |
| Stereochemistry | fully defined |
| Cross-references | pubchem:5281899 |
Filing pathway
Polyketides — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is pks, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Streptomyces avermitilis NCBITaxon:33903 |
SOURCE_ASSERTION | mibig:BGC0000117 | PMID:11572948 |
Occurrences 25
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Streptomyces xinghaiensis NCBITaxon:1038928 |
LOTUS | DOI:10.1002/CBDV.201700140 |
| Streptomyces xinghaiensis NCBITaxon:1038928 |
LOTUS | DOI:10.1007/S00253-008-1684-Y |
| Streptomyces xinghaiensis NCBITaxon:1038928 |
LOTUS | DOI:10.1007/S00438-009-0502-2 |
| Streptomyces xinghaiensis NCBITaxon:1038928 |
LOTUS | DOI:10.1007/S12223-010-0002-0 |
| Streptomyces xinghaiensis NCBITaxon:1038928 |
LOTUS | DOI:10.1016/J.MYCMED.2017.10.007 |
| Streptomyces xinghaiensis NCBITaxon:1038928 |
LOTUS | DOI:10.1038/S41429-019-0239-Z |
| Streptomyces xinghaiensis NCBITaxon:1038928 |
LOTUS | DOI:10.1099/MIC.0.048371-0 |
| Streptomyces xinghaiensis NCBITaxon:1038928 |
LOTUS | DOI:10.1111/J.1574-6968.2009.01721.X |
| Streptomyces xinghaiensis NCBITaxon:1038928 |
LOTUS | DOI:10.1128/JB.00017-11 |
| Streptomyces xinghaiensis NCBITaxon:1038928 |
LOTUS | DOI:10.1128/MRA.01531-18 |
| Streptomyces xinghaiensis NCBITaxon:1038928 |
LOTUS | DOI:10.14348/MOLCELLS.2016.2226 |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.1016/S0040-4039(00)84680-8 |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.7164/ANTIBIOTICS.40.1053 |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.7164/ANTIBIOTICS.46.1334 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1002/CBDV.201700140 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1007/S00253-008-1684-Y |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1007/S00438-009-0502-2 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1007/S12223-010-0002-0 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1016/J.MYCMED.2017.10.007 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1038/S41429-019-0239-Z |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1099/MIC.0.048371-0 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1111/J.1574-6968.2009.01721.X |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1128/JB.00017-11 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1128/MRA.01531-18 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.14348/MOLCELLS.2016.2226 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000117 | Streptomyces avermitilis NCBITaxon:33903 |
CLUSTER_UNSTATED | genbank:AB070940.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Bioactivities 18
| Assay | Result | Reference |
|---|---|---|
| HTS assay for small molecules that inhibit ELG1-dependent DNA repair in human embryonic kidney (HEK293T) cells expressing luciferase-tagged ELG1: Hit Confirmation | 7.0584 uM | pubchem.aid:624248 |
| Inhibitors of Regulator of G Protein Signaling (RGS) 4: qHTS | 33.5875 uM | pubchem.aid:504845 |
| Inhibitors of the vitamin D receptor (VDR): qHTS | 56.2341 uM | pubchem.aid:504847 |
| Total Fluorescence Counterscreen for Inhibitors of the Interaction of Thyroid Hormone Receptor and Steroid Receptor Coregulator 2 | 44.6684 uM | pubchem.aid:1479 |
| qHTS Assay for Compounds Blocking the Interaction Between CBF-beta and RUNX1 for the Treatment of Acute Myeloid Leukemia | 39.8107 uM | pubchem.aid:1477 |
| qHTS Assay for Enhancers of SMN2 Splice Variant Expression | 0.01 uM | pubchem.aid:1458 |
| qHTS Assay for Inhibitors of Aldehyde Dehydrogenase 1 (ALDH1A1) | 19.9526 uM | pubchem.aid:1030 |
| qHTS Assay for Inhibitors of Bacillus subtilis Sfp phosphopantetheinyl transferase (PPTase) | 0.0006 uM | pubchem.aid:1490 |
| qHTS for Inhibitors of Tau Fibril Formation, Thioflavin T Binding | 17.7828 uM | pubchem.aid:1460 |
| qHTS for Inhibitors of binding or entry into cells for Lassa Virus | 39.8107 uM | pubchem.aid:720533 |
| qHTS for Inhibitors of binding or entry into cells for Marburg Virus | 10 uM | pubchem.aid:720532 |
| qHTS for Inhibitors of the Interaction of Thyroid Hormone Receptor and Steroid Receptor Coregulator 2 | 39.8107 uM | pubchem.aid:1469 |
| qHTS screen for small molecules that inhibit ELG1-dependent DNA repair in human embryonic kidney (HEK293T) cells expressing luciferase-tagged ELG1: Hit Confirmation using MMS Stimulated ELG1 | 0.0112 uM | pubchem.aid:624249 |
| qHTS screen for small molecules that inhibit ELG1-dependent DNA repair: Hit Confirmation in Cell-Based Luciferin Assay | 0.0315 uM | pubchem.aid:624247 |
| qHTS screen for small molecules that inhibit ELG1-dependent DNA repair: Hit Confirmation with 5FU Viability | 35.3758 uM | pubchem.aid:624250 |
| qHTS screen for small molecules that inhibit ELG1-dependent DNA repair: Hit Confirmation with MMS Viability | 0.0112 uM | pubchem.aid:624251 |
| qHTS screen for small molecules that inhibit ELG1-dependent DNA repair: Hit Confirmation with Unstimulated Viability Assay | 0.0281 uM | pubchem.aid:624252 |
| qHTS screen for small molecules that inhibit ELG1-dependent DNA repair: SAR in Cell-Based Luciferin Counter Assay | 0.0315 uM | pubchem.aid:686934 |
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000117 | MIBIG | 5 |
This page is generated from data/natural_products/polyketides/oligomycin.yaml, which is generated from the committed inventories. Neither is edited by hand.