resistomycin
naturalproductmech:mibig-14d7cc15c5 MINTED SEEDED
Structure
| Standard InChIKey | ABLACSIRCKEUOB-UHFFFAOYSA-N |
|---|---|
| SMILES | CC1=CC(=C2C3=C4C(=CC(=C13)O)C(C(=O)C5=C(C=C(C(=C45)C2=O)O)O)(C)C)O |
| Stereochemistry | fully defined |
| Cross-references | pubchem:5282060 |
Filing pathway
Polyketides — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is pks, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Streptomyces resistomycificus NCBITaxon:67356 |
SOURCE_ASSERTION | mibig:BGC0000264 | PMID:14982421 |
Occurrences 16
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.1002/CHIN.200412276 |
| Streptomyces corchorusii NCBITaxon:1903 |
LOTUS | DOI:10.1134/S1068162006030125 |
| Streptomyces olivaceoviridis NCBITaxon:1921 |
LOTUS | DOI:10.1134/S1068162006030125 |
| Streptomyces vinaceus NCBITaxon:1960 |
LOTUS | DOI:10.1002/JLAC.198319830509 |
| Streptomyces griseoincarnatus NCBITaxon:29305 |
LOTUS | DOI:10.7164/ANTIBIOTICS.38.113 |
| Streptomyces griseoflavus NCBITaxon:35619 |
LOTUS | DOI:10.1002/JLAC.198319830509 |
| Streptomyces aurantiacus NCBITaxon:47760 |
LOTUS | DOI:10.1007/S12275-011-1260-5 |
| Streptomyces aurantiacus NCBITaxon:47760 |
LOTUS | DOI:10.1016/J.SAA.2011.12.072 |
| Streptomyces canus NCBITaxon:58343 |
LOTUS | DOI:10.1021/JF305210U |
| Streptomyces variabilis NCBITaxon:67372 |
LOTUS | DOI:10.7164/ANTIBIOTICS.38.113 |
| Streptomyces resistomycificus NCBITaxon:67356 |
LOTUS | DOI:10.1002/JLAC.198319830509 |
| Streptomyces resistomycificus NCBITaxon:67356 |
LOTUS | DOI:10.1007/S13205-018-1304-1 |
| Streptomyces resistomycificus NCBITaxon:67356 |
LOTUS | DOI:10.1016/J.FEBSLET.2009.07.061 |
| Streptomyces resistomycificus NCBITaxon:67356 |
LOTUS | DOI:10.1016/J.SAA.2011.12.072 |
| Streptomyces resistomycificus NCBITaxon:67356 |
LOTUS | DOI:10.1021/JA0390698 |
| Streptomyces resistomycificus NCBITaxon:67356 |
LOTUS | DOI:10.1021/JO01284A072 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000264 | Streptomyces resistomycificus NCBITaxon:67356 |
CLUSTER_DEMONSTRATED | genbank:AJ585192.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000264 | MIBIG | 5 |
This page is generated from data/natural_products/polyketides/resistomycin.yaml, which is generated from the committed inventories. Neither is edited by hand.