rimocidin
naturalproductmech:mibig-c5a4f915e6 MINTED SEEDED
Structure
| Standard InChIKey | AWGBZRVEGDNLDZ-JCUCCFEFSA-N |
|---|---|
| SMILES | CCC[C@@H]1C/C=C/C=C/C=C/C=C/[C@@H](C[C@H]2[C@@H]([C@H](C[C@](O2)(C[C@H](CCCC(=O)C[C@H]([C@@H](C(=O)O1)CC)O)O)O)O)C(=O)O)O[C@H]3[C@H]([C@H]([C@@H]([C@H](O3)C)O)N)O |
| Stereochemistry | fully defined |
| Cross-references | pubchem:6440843, npatlas:NPA020400 |
Filing pathway
Polyketides — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is pks, from MIBiG.
Producer organisms 2
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Streptomyces rimosus subsp. rimosus NRRL WC-3558 NCBITaxon:132474 |
BGC_CORRELATED | mibig:BGC0002106 | PMID:33057790 |
| Streptomyces diastaticus NCBITaxon:1956 |
SOURCE_ASSERTION | mibig:BGC0000138 | PMID:15123265 |
Occurrences 14
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Streptomyces rimosus NCBITaxon:1927 |
LOTUS | DOI:10.1007/S10295-019-02146-W |
| Streptomyces rimosus NCBITaxon:1927 |
LOTUS | DOI:10.1016/J.JBIOSC.2012.07.020 |
| Streptomyces rimosus NCBITaxon:1927 |
LOTUS | DOI:10.1111/JAM.13071 |
| Streptomyces rimosus NCBITaxon:1927 |
LOTUS | DOI:10.1371/JOURNAL.PONE.0135891 |
| Streptomyces rimosus NCBITaxon:1927 |
LOTUS | DOI:10.7164/ANTIBIOTICS.29.197 |
| Streptomyces mauvecolor NCBITaxon:58345 |
LOTUS | DOI:10.1007/S10295-019-02146-W |
| Streptomyces mauvecolor NCBITaxon:58345 |
LOTUS | DOI:10.1016/J.JBIOSC.2012.07.020 |
| Streptomyces mauvecolor NCBITaxon:58345 |
LOTUS | DOI:10.1111/JAM.13071 |
| Streptomyces mauvecolor NCBITaxon:58345 |
LOTUS | DOI:10.1371/JOURNAL.PONE.0135891 |
| Streptomyces diastaticus NCBITaxon:1956 |
LOTUS | DOI:10.1007/S10295-019-02146-W |
| Streptomyces diastaticus NCBITaxon:1956 |
LOTUS | DOI:10.1016/J.CHEMBIOL.2004.02.017 |
| Streptomyces diastaticus NCBITaxon:1956 |
LOTUS | DOI:10.1016/J.JBIOSC.2012.07.020 |
| Streptomyces diastaticus NCBITaxon:1956 |
LOTUS | DOI:10.1111/JAM.13071 |
| Streptomyces diastaticus NCBITaxon:1956 |
LOTUS | DOI:10.1371/JOURNAL.PONE.0135891 |
Biosynthetic gene clusters 2
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0002106 | Streptomyces rimosus subsp. rimosus NRRL WC-3558 NCBITaxon:132474 |
CLUSTER_CORRELATED | genbank:NZ_JOBS01000013.1 |
| mibig:BGC0000138 | Streptomyces diastaticus NCBITaxon:1956 |
CLUSTER_UNSTATED | genbank:AY442225.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Open questions 1
shared-structure — This structure is reported by more than one MIBiG entry: BGC0000138, BGC0002106. Confirm they describe the same compound rather than an upstream cross-reference error.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0002106 | MIBIG | 3 |
| BGC0000138 | MIBIG | 5 |
This page is generated from data/natural_products/polyketides/rimocidin.yaml, which is generated from the committed inventories. Neither is edited by hand.