tetracenomycin C
CHEBI:9470 EXACT SEEDED antibacterial
Structure
| Standard InChIKey | ULHJWHCSSAEMLW-UEVCKROQSA-N |
|---|---|
| SMILES | O[C@H]1[C@@]2(O)[C@@](C(C(C(O)=C(C(C)=C(C(OC)=O)C(OC)=C4)C4=C3)=C3C2=O)=O)(O)C(C=C1OC)=O |
| Stereochemistry | fully defined |
Filing pathway
Polyketides — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is pks, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Streptomyces glaucescens NCBITaxon:1907 |
BGC_CHARACTERIZED | mibig:BGC0000275 | PMID:1548230 |
Occurrences 23
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Streptomyces olivaceus NCBITaxon:47716 |
LOTUS | DOI:10.1021/NP010007+ |
| Streptomyces glaucescens NCBITaxon:1907 |
LOTUS | DOI:10.1002/ANGE.19951071525 |
| Streptomyces glaucescens NCBITaxon:1907 |
LOTUS | DOI:10.1002/ANIE.199505651 |
| Streptomyces glaucescens NCBITaxon:1907 |
LOTUS | DOI:10.1002/J.1460-2075.1989.TB08414.X |
| Streptomyces glaucescens NCBITaxon:1907 |
LOTUS | DOI:10.1007/BF00873025 |
| Streptomyces glaucescens NCBITaxon:1907 |
LOTUS | DOI:10.1007/S00253-009-2428-3 |
| Streptomyces glaucescens NCBITaxon:1907 |
LOTUS | DOI:10.1016/0378-1119(91)90588-3 |
| Streptomyces glaucescens NCBITaxon:1907 |
LOTUS | DOI:10.1016/J.JBIOTEC.2017.09.008 |
| Streptomyces glaucescens NCBITaxon:1907 |
LOTUS | DOI:10.1016/S0014-5793(98)00840-0 |
| Streptomyces glaucescens NCBITaxon:1907 |
LOTUS | DOI:10.1016/S1074-5521(97)90233-7 |
| Streptomyces glaucescens NCBITaxon:1907 |
LOTUS | DOI:10.1021/BI00029A015 |
| Streptomyces glaucescens NCBITaxon:1907 |
LOTUS | DOI:10.1021/BI00077A019 |
| Streptomyces glaucescens NCBITaxon:1907 |
LOTUS | DOI:10.1021/BI00092A026 |
| Streptomyces glaucescens NCBITaxon:1907 |
LOTUS | DOI:10.1021/BI0258804 |
| Streptomyces glaucescens NCBITaxon:1907 |
LOTUS | DOI:10.1073/PNAS.84.13.4445 |
| Streptomyces glaucescens NCBITaxon:1907 |
LOTUS | DOI:10.1074/JBC.M406144200 |
| Streptomyces glaucescens NCBITaxon:1907 |
LOTUS | DOI:10.1099/00221287-113-2-243 |
| Streptomyces glaucescens NCBITaxon:1907 |
LOTUS | DOI:10.1128/JB.173.20.6475-6483.1991 |
| Streptomyces glaucescens NCBITaxon:1907 |
LOTUS | DOI:10.1128/JB.174.6.1810-1820.1992 |
| Streptomyces glaucescens NCBITaxon:1907 |
LOTUS | DOI:10.1128/JB.175.23.7571-7580.1993 |
| Streptomyces glaucescens NCBITaxon:1907 |
LOTUS | DOI:10.1128/JB.177.2.477-481.1995 |
| Streptomyces glaucescens NCBITaxon:1907 |
LOTUS | DOI:10.3109/14756369209040747 |
| Streptomyces glaucescens NCBITaxon:1907 |
LOTUS | DOI:10.7164/ANTIBIOTICS.45.1190 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000275 | Streptomyces glaucescens NCBITaxon:1907 |
CLUSTER_DEMONSTRATED | genbank:M80674.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Elsewhere in the fleet
- AntibioticMech — CHEBI:9470 (same structure, same inchikey)
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000275 | MIBIG | 4 |
| CHEBI:9470 | CHEBI | 3-star |
This page is generated from data/natural_products/polyketides/tetracenomycin-c.yaml, which is generated from the committed inventories. Neither is edited by hand.