6-hydroxymellein
CHEBI:16368 EXACT SEEDED
An isochromane that is mellein bearing an additional hydroxy substituent at the 6-position.
Structure
| Standard InChIKey | DHLPMLVSBRRUGA-RXMQYKEDSA-N |
|---|---|
| SMILES | C[C@@H]1CC2=CC(=CC(=C2C(=O)O1)O)O |
| Stereochemistry | fully defined |
| Cross-references | pubchem:172675 |
Filing pathway
Shikimates and phenylpropanoids — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is pks, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Cladonia uncialis subsp. uncialis NCBITaxon:180999 |
SOURCE_ASSERTION | mibig:BGC0001489 | DOI:10.1016/j.bfopcu.2017.03.001 |
Occurrences 13
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Tubakia dryina NCBITaxon:1194331 |
LOTUS | DOI:10.1007/BF00578500 |
| Garcinia atroviridis NCBITaxon:180101 |
LOTUS | DOI:10.1111/J.1574-695X.2007.00331.X |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.1007/S11306-016-1025-6 |
| Discula NCBITaxon:2109287 |
LOTUS | DOI:10.1021/NP50077A009 |
| Dicarpella dryina NCBITaxon:2137241 |
LOTUS | DOI:10.1007/BF00578500 |
| Aspergillus terreus NCBITaxon:33178 |
LOTUS | DOI:10.1515/ZNC-2002-5-610 |
| Aspergillus terreus NCBITaxon:33178 |
LOTUS | DOI:10.3390/MD9081368 |
| Senna siamea NCBITaxon:346999 |
LOTUS | DOI:10.1016/S0031-9422(00)81245-5 |
| Lachnum papyraceum NCBITaxon:397620 |
LOTUS | DOI:10.7164/ANTIBIOTICS.48.149 |
| Lachnum papyraceum NCBITaxon:397620 |
LOTUS | DOI:10.7164/ANTIBIOTICS.48.154 |
| Lachnum papyraceum NCBITaxon:397620 |
LOTUS | DOI:10.7164/ANTIBIOTICS.48.261 |
| Handroanthus impetiginosus NCBITaxon:429701 |
LOTUS | DOI:10.1002/HLCA.19890720406 |
| Myxotrichum stipitatum NCBITaxon:78140 |
LOTUS | DOI:10.1021/NP010600R |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0001489 | Cladonia uncialis subsp. uncialis NCBITaxon:180999 |
CLUSTER_UNSTATED | genbank:MG777496.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0001489 | MIBIG | 3 |
| CHEBI:16368 | CHEBI | 3-star |
This page is generated from data/natural_products/shikimates_and_phenylpropanoids/6-hydroxymellein.yaml, which is generated from the committed inventories. Neither is edited by hand.