coumermycin A1
CHEBI:3907 EXACT SEEDED antibacterial
A hydroxycoumarin antibiotic that is obtained from Streptomyces rishiriensis and exhibits potent antibacterial and anticancer activity.
Structure
| Standard InChIKey | WTIJXIZOODAMJT-DHFGXMAYSA-N |
|---|---|
| SMILES | CC1=CC=C(N1)C(=O)O[C@H]2[C@H]([C@@H](OC([C@@H]2OC)(C)C)OC3=C(C4=C(C=C3)C(=C(C(=O)O4)NC(=O)C5=CNC(=C5C)C(=O)NC6=C(C7=C(C(=C(C=C7)O[C@H]8[C@@H]([C@@H]([C@H](C(O8)(C)C)OC)OC(=O)C9=CC=C(N9)C)O)C)OC6=O)O)O)C)O |
| Stereochemistry | fully defined |
| Cross-references | pubchem:54675768, pubchem:54720057 |
Filing pathway
Shikimates and phenylpropanoids — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is saccharide, other, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Streptomyces rishiriensis NCBITaxon:68264 |
BGC_CHARACTERIZED | mibig:BGC0000833 | PMID:14285468 |
Occurrences 22
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1002/BIP.21493 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1007/S10295-013-1348-5 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1046/J.1432-1033.2003.03830.X |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1099/00221287-148-10-3317 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1099/MIC.0.26867-0 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1128/AAC.44.11.3040-3048.2000 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1371/JOURNAL.PONE.0171056 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1002/BIP.21493 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1007/S10295-013-1348-5 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1046/J.1432-1033.2003.03830.X |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1099/00221287-148-10-3317 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1099/MIC.0.26867-0 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1128/AAC.44.11.3040-3048.2000 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1371/JOURNAL.PONE.0171056 |
| Streptomyces rishiriensis NCBITaxon:68264 |
LOTUS | DOI:10.1002/BIP.21493 |
| Streptomyces rishiriensis NCBITaxon:68264 |
LOTUS | DOI:10.1007/S10295-013-1348-5 |
| Streptomyces rishiriensis NCBITaxon:68264 |
LOTUS | DOI:10.1046/J.1432-1033.2003.03830.X |
| Streptomyces rishiriensis NCBITaxon:68264 |
LOTUS | DOI:10.1099/00221287-148-10-3317 |
| Streptomyces rishiriensis NCBITaxon:68264 |
LOTUS | DOI:10.1099/MIC.0.26867-0 |
| Streptomyces rishiriensis NCBITaxon:68264 |
LOTUS | DOI:10.1128/AAC.44.11.3040-3048.2000 |
| Streptomyces rishiriensis NCBITaxon:68264 |
LOTUS | DOI:10.1371/JOURNAL.PONE.0171056 |
| Streptomyces rishiriensis NCBITaxon:68264 |
CHEBI | PMID:24079980 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000833 | Streptomyces rishiriensis NCBITaxon:68264 |
CLUSTER_DEMONSTRATED | genbank:AF235050.4 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Elsewhere in the fleet
- AntibioticMech — CHEBI:3907 (same structure, same inchikey)
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000833 | MIBIG | 4 |
| CHEBI:3907 | CHEBI | 3-star |
This page is generated from data/natural_products/shikimates_and_phenylpropanoids/coumermycin-a1.yaml, which is generated from the committed inventories. Neither is edited by hand.