(-)-Mellein
naturalproductmech:mibig-5879a27c10 MINTED SEEDED
Structure
| Standard InChIKey | KWILGNNWGSNMPA-ZCFIWIBFSA-N |
|---|---|
| SMILES | C[C@@H]1CC2=C(C(=CC=C2)O)C(=O)O1 |
| Stereochemistry | fully defined |
| Cross-references | pubchem:114679 |
Filing pathway
Shikimates and phenylpropanoids — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is pks, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Parastagonospora nodorum NCBITaxon:13684 |
SOURCE_ASSERTION | mibig:BGC0001244 | PMID:25326302 |
Occurrences 23
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Microsphaeropsis NCBITaxon:107453 |
LOTUS | DOI:10.1021/NP980341E |
| Pezicula livida NCBITaxon:108568 |
LOTUS | DOI:10.7164/ANTIBIOTICS.47.113 |
| Ficus formosana NCBITaxon:1127366 |
LOTUS | DOI:10.1055/S-2005-873163 |
| Aspergillus melleus NCBITaxon:138277 |
LOTUS | DOI:10.1038/165274A0 |
| Aspergillus melleus NCBITaxon:138277 |
LOTUS | DOI:10.1039/P19840001021 |
| Aspergillus melleus NCBITaxon:138277 |
LOTUS | DOI:10.1271/BBB.60.1375 |
| Mycetinis alliaceus NCBITaxon:139086 |
LOTUS | DOI:10.1039/P19810001790 |
| Plenodomus tracheiphilus NCBITaxon:1408161 |
LOTUS | DOI:10.1016/0031-9422(93)85221-C |
| Millettia leucantha NCBITaxon:1712206 |
LOTUS | DOI:10.1007/S12272-011-0603-4 |
| Garcinia bancana NCBITaxon:180102 |
LOTUS | DOI:10.1002/CHIN.200537209 |
| Enicosanthum membranifolium NCBITaxon:235726 |
LOTUS | DOI:10.1002/CHIN.200738212 |
| Enicosanthum membranifolium NCBITaxon:235726 |
LOTUS | DOI:10.1016/J.BMC.2007.03.051 |
| Parastagonospora nodorum NCBITaxon:321614 |
LOTUS | DOI:10.1016/S0031-9422(00)82234-7 |
| Parastagonospora nodorum NCBITaxon:321614 |
LOTUS | DOI:10.1128/AEM.02745-14 |
| Ficus subcuneata NCBITaxon:326052 |
LOTUS | DOI:10.1055/S-2005-873163 |
| Picea glauca NCBITaxon:3330 |
LOTUS | DOI:10.1021/NP800192F |
| Millettia vatkei NCBITaxon:3851323 |
LOTUS | DOI:10.1007/S12272-011-0603-4 |
| Lasiodiplodia theobromae NCBITaxon:45133 |
LOTUS | DOI:10.1016/J.TET.2009.10.084 |
| Lasiodiplodia theobromae NCBITaxon:45133 |
LOTUS | DOI:10.1016/S0031-9422(00)90622-8 |
| Garcinia mangostana NCBITaxon:58228 |
LOTUS | DOI:10.1016/J.PHYTOL.2012.11.007 |
| Coniothyrium NCBITaxon:78388 |
LOTUS | DOI:10.1021/NP980341E |
| Ipomoea pes-caprae NCBITaxon:89656 |
LOTUS | DOI:10.1002/PTR.2650060211 |
| Ipomoea pes-caprae NCBITaxon:89656 |
LOTUS | DOI:10.1055/S-2006-960196 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0001244 | Parastagonospora nodorum NCBITaxon:13684 |
CLUSTER_UNSTATED | genbank:KM365454.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0001244 | MIBIG | 3 |
This page is generated from data/natural_products/shikimates_and_phenylpropanoids/mellein.yaml, which is generated from the committed inventories. Neither is edited by hand.