albaflavenone
CHEBI:51460 EXACT SEEDED antimicrobial unspecified
A carbotricyclic compound that is (+)-epi-isozizaene in which the hydrogens at position 5 have been replaced by an oxo group.
Structure
| Standard InChIKey | SHUZZAXJEJPUGA-CCUNJIBTSA-N |
|---|---|
| SMILES | C[C@H]1CC(=O)C2=C(C)C(C)(C)[C@H]3CC[C@@]12C3 |
| Stereochemistry | fully defined |
| Cross-references | npatlas:NPA017239, pubchem:25137938 |
Filing pathway
Terpenoids — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is terpene, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Streptomyces coelicolor A3(2) NCBITaxon:100226 |
SOURCE_ASSERTION | mibig:BGC0000660 | PMID:18234666 |
Occurrences 22
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1007/S00253-015-7060-9 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1007/S00253-019-10240-3 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1007/S10295-013-1383-2 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1007/S10295-015-1685-7 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1007/S10295-019-02172-8 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1016/B978-0-12-404634-4.00014-0 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1021/JA901313V |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1074/JBC.M710421200 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1111/J.1742-4658.2011.08447.X |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1128/JB.00017-11 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.7164/ANTIBIOTICS.47.434 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1007/S00253-015-7060-9 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1007/S00253-019-10240-3 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1007/S10295-013-1383-2 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1007/S10295-015-1685-7 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1007/S10295-019-02172-8 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1016/B978-0-12-404634-4.00014-0 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1021/JA901313V |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1074/JBC.M710421200 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1111/J.1742-4658.2011.08447.X |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1128/JB.00017-11 |
| Streptomyces coelicolor A3(2) NCBITaxon:100226 |
CHEBI | PMID:22151149 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000660 | Streptomyces coelicolor A3(2) NCBITaxon:100226 |
CLUSTER_UNSTATED | genbank:AL645882.2 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Elsewhere in the fleet
- AntibioticMech — CHEBI:51460 (same structure, same inchikey)
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000660 | MIBIG | 5 |
| CHEBI:51460 | CHEBI | 3-star |
This page is generated from data/natural_products/terpenoids/albaflavenone.yaml, which is generated from the committed inventories. Neither is edited by hand.