euphol
naturalproductmech:mibig-21e4f2495f MINTED SEEDED
Structure
| Standard InChIKey | CAHGCLMLTWQZNJ-WZLOIPHISA-N |
|---|---|
| SMILES | C[C@H](CCC=C(C)C)[C@@H]1CC[C@]2([C@]1(CCC3=C2CC[C@@H]4[C@@]3(CC[C@@H](C4(C)C)O)C)C)C |
| Stereochemistry | fully defined |
| Cross-references | pubchem:441678, CHEBI:4940 |
Filing pathway
Terpenoids — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is terpene, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Arabidopsis thaliana NCBITaxon:3702 |
BGC_CHARACTERIZED | mibig:BGC0002401 | DOI:10.1111/nph.16338 |
Occurrences 25
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Euphorbia nicaeensis NCBITaxon:1087772 |
LOTUS | DOI:10.1055/S-2006-959736 |
| Euphorbia boetica NCBITaxon:1091613 |
LOTUS | DOI:10.1021/NP50116A020 |
| Euphorbia oxyphylla NCBITaxon:1091639 |
LOTUS | DOI:10.1016/S0031-9422(00)82286-4 |
| Euphorbia retusa NCBITaxon:1091645 |
LOTUS | DOI:10.1016/0031-9422(73)80529-1 |
| Euphorbia sulcata NCBITaxon:1091647 |
LOTUS | DOI:10.1016/0031-9422(73)80529-1 |
| Euphorbia caducifolia NCBITaxon:1129975 |
LOTUS | DOI:10.1016/S0031-9422(00)97902-0 |
| Euphorbia portulacoides NCBITaxon:1138358 |
LOTUS | DOI:10.1016/0031-9422(95)00752-0 |
| Euphorbia sapinii NCBITaxon:1281384 |
LOTUS | DOI:10.1016/J.PHYTOL.2011.04.001 |
| Euphorbia aleppica NCBITaxon:1333886 |
LOTUS | DOI:10.1016/0031-9422(95)00361-A |
| Euphorbia tirucalli NCBITaxon:142860 |
LOTUS | DOI:10.1021/NP50006A011 |
| Euphorbia tirucalli NCBITaxon:142860 |
LOTUS | DOI:10.1515/ZNC-1985-9-1008 |
| Euphorbia trigona NCBITaxon:1492770 |
LOTUS | DOI:10.1016/0031-9422(88)83136-4 |
| Clusia multiflora NCBITaxon:156472 |
LOTUS | DOI:10.1016/0031-9422(94)00642-7 |
| Dacryodes hopkinsii NCBITaxon:1591303 |
LOTUS | DOI:10.1590/S0103-50532004000300008 |
| Camellia sasanqua NCBITaxon:182300 |
LOTUS | DOI:10.1021/NP970490H |
| Camellia sasanqua NCBITaxon:182300 |
LOTUS | DOI:10.1248/CPB.45.2016 |
| Garcinia cymosa NCBITaxon:198793 |
LOTUS | DOI:10.1016/S0031-9422(98)00565-2 |
| Garcinia cymosa NCBITaxon:198793 |
LOTUS | DOI:10.1080/14786419.2012.725399 |
| Clusia columnaris NCBITaxon:211701 |
LOTUS | DOI:10.1590/S0102-695X2008000100003 |
| Euphorbia drupifera NCBITaxon:212879 |
LOTUS | DOI:10.1016/J.FITOTE.2007.02.002 |
| Euphorbia lathyris NCBITaxon:212925 |
LOTUS | DOI:10.1104/PP.89.2.681 |
| Euphorbia lathyris NCBITaxon:212925 |
LOTUS | DOI:10.3390/MOLECULES24234322 |
| Euphorbia kansui NCBITaxon:239687 |
LOTUS | DOI:10.1021/NP0205396 |
| Euphorbia kansui NCBITaxon:239687 |
LOTUS | DOI:10.1055/S-2006-957574 |
| Euphorbia kansui NCBITaxon:239687 |
LOTUS | DOI:10.1211/0022357001773607 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0002401 | Arabidopsis thaliana NCBITaxon:3702 |
CLUSTER_DEMONSTRATED | genbank:CP002686.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0002401 | MIBIG | 2 |
This page is generated from data/natural_products/terpenoids/euphol.yaml, which is generated from the committed inventories. Neither is edited by hand.