(−)-geosmin
CHEBI:46702 EXACT SEEDED
The (−)-stereoisomer of geosmin, having 4S,4aS,8aR configuration.
Structure
| Standard InChIKey | JLPUXFOGCDVKGO-TUAOUCFPSA-N |
|---|---|
| SMILES | C[C@H]1CCC[C@@]2([C@@]1(CCCC2)O)C |
| Stereochemistry | fully defined |
Filing pathway
Terpenoids — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is terpene, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Streptomyces coelicolor A3(2) NCBITaxon:100226 |
SOURCE_ASSERTION | mibig:BGC0001181 | DOI:10.1038/s41564-020-0697-x |
Occurrences 25
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Coffea arabica NCBITaxon:13443 |
LOTUS | DOI:10.1007/S002170100305 |
| Cortinarius herculeus NCBITaxon:1586124 |
LOTUS | DOI:10.1080/00275514.1999.12060999 |
| Cortinarius herculeus NCBITaxon:1586124 |
LOTUS | DOI:10.2307/3761199 |
| Beta vulgaris NCBITaxon:161934 |
LOTUS | DOI:10.1021/JF60204A059 |
| Oscillatoria brevis NCBITaxon:177969 |
LOTUS | DOI:10.1007/BF00416598 |
| Cystoderma amianthinum NCBITaxon:182063 |
LOTUS | DOI:10.1080/00275514.1999.12060999 |
| Cystoderma amianthinum NCBITaxon:182063 |
LOTUS | DOI:10.2307/3761199 |
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.1016/J.YMBEN.2018.09.004 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1007/S10295-013-1383-2 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1016/B978-0-12-404634-4.00014-0 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1021/JA062669X |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1038/NCHEMBIO.2007.29 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.1371/JOURNAL.PONE.0060665 |
| Streptomyces albidoflavus NCBITaxon:1886 |
LOTUS | DOI:10.7164/ANTIBIOTICS.47.434 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1007/S10295-013-1383-2 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1016/B978-0-12-404634-4.00014-0 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1021/JA062669X |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1038/NCHEMBIO.2007.29 |
| Streptomyces coelicolor NCBITaxon:1902 |
LOTUS | DOI:10.1371/JOURNAL.PONE.0060665 |
| Streptomyces griseus NCBITaxon:1911 |
LOTUS | DOI:10.1111/J.1365-2672.1992.TB01818.X |
| Streptomyces tendae NCBITaxon:1932 |
LOTUS | DOI:10.1021/JF00013A023 |
| Streptomyces tendae NCBITaxon:1932 |
LOTUS | DOI:10.1128/AEM.57.12.3429-3432.1991 |
| Streptomyces halstedii NCBITaxon:1944 |
LOTUS | DOI:10.1038/SJ.JIM.7000121 |
| Streptomyces avermitilis NCBITaxon:33903 |
LOTUS | DOI:10.1007/BF02932133 |
| Streptomyces avermitilis NCBITaxon:33903 |
LOTUS | DOI:10.1038/JA.2006.66 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0001181 | Streptomyces coelicolor A3(2) NCBITaxon:100226 |
CLUSTER_UNSTATED | genbank:AL645882.2 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0001181 | MIBIG | 4 |
| CHEBI:46702 | CHEBI | 3-star |
This page is generated from data/natural_products/terpenoids/geosmin.yaml, which is generated from the committed inventories. Neither is edited by hand.