zeaxanthin
CHEBI:27547 EXACT SEEDED cytotoxicenzyme inhibitortoxin
Structure
| Standard InChIKey | JKQXZKUSFCKOGQ-QAYBQHTQSA-N |
|---|---|
| SMILES | CC1=C(C(C[C@@H](C1)O)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C2=C(C[C@H](CC2(C)C)O)C)\C)\C)/C)/C |
| Stereochemistry | fully defined |
| Cross-references | pubchem:5280899 |
Filing pathway
Terpenoids — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is terpene, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Xanthobacter autotrophicus Py2 NCBITaxon:78245 |
SOURCE_ASSERTION | mibig:BGC0000656 | PMID:12189420 |
Occurrences 25
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Bangia fuscopurpurea NCBITaxon:101920 |
LOTUS | DOI:10.1016/S0031-9422(00)89006-8 |
| Microchloropsis salina NCBITaxon:1027361 |
LOTUS | DOI:10.1080/00071618200650061 |
| Erythrobacter longus NCBITaxon:1044 |
LOTUS | DOI:10.1007/BF00247807 |
| Ascidia zara NCBITaxon:107392 |
LOTUS | DOI:10.1016/0305-0491(85)90174-9 |
| Trididemnum solidum NCBITaxon:1079459 |
LOTUS | DOI:10.1021/NP50055A001 |
| Linckia laevigata NCBITaxon:109185 |
LOTUS | DOI:10.1016/0305-0491(89)90090-4 |
| Cladonia gracilis NCBITaxon:111668 |
LOTUS | DOI:10.1016/0305-1978(85)90064-X |
| Cladonia gracilis NCBITaxon:111668 |
LOTUS | DOI:10.1016/0305-1978(87)90002-0 |
| Cladonia rangiferina NCBITaxon:111670 |
LOTUS | DOI:10.1016/0305-1978(85)90064-X |
| Cladonia rangiferina NCBITaxon:111670 |
LOTUS | DOI:10.1016/0305-1978(87)90002-0 |
| Microcystis aeruginosa NCBITaxon:1126 |
LOTUS | DOI:10.1111/J.1365-2427.2006.01582.X |
| Lycium barbarum NCBITaxon:112863 |
LOTUS | DOI:10.1055/S-0029-1186218 |
| Lycium chinense NCBITaxon:112883 |
LOTUS | DOI:10.1007/BF02975206 |
| Lycium chinense NCBITaxon:112883 |
LOTUS | DOI:10.1055/S-0029-1186218 |
| Azolla cristata NCBITaxon:1131306 |
LOTUS | DOI:10.1016/0305-1978(85)90030-4 |
| Thelypteris palustris var. pubescens NCBITaxon:1132572 |
LOTUS | DOI:10.1016/0305-1978(85)90030-4 |
| Equisetum palustre NCBITaxon:113538 |
LOTUS | DOI:10.1016/0305-1978(85)90030-4 |
| Synechocystis NCBITaxon:1142 |
LOTUS | DOI:10.1016/S0014-5793(99)00817-0 |
| Synechocystis NCBITaxon:1142 |
LOTUS | DOI:10.1111/J.1365-2427.2006.01582.X |
| Cetrariella delisei NCBITaxon:115238 |
LOTUS | DOI:10.1016/0305-1978(87)90002-0 |
| Spirulina NCBITaxon:1154 |
LOTUS | DOI:10.1080/01635588809513979 |
| Cladonia ciliata var. tenuis NCBITaxon:1156959 |
LOTUS | DOI:10.1016/0305-1978(85)90064-X |
| Oscillatoria sp. NCBITaxon:1159 |
CHEBI | PMID:21473610 |
| Planktothrix agardhii NCBITaxon:1160 |
LOTUS | DOI:10.1016/B978-0-12-261650-1.50017-4 |
| Planktothrix agardhii NCBITaxon:1160 |
LOTUS | DOI:10.1016/S0031-9422(00)81568-X |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000656 | Xanthobacter autotrophicus Py2 NCBITaxon:78245 |
CLUSTER_UNSTATED | genbank:AF408848.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Bioactivities 25
| Assay | Result | Reference |
|---|---|---|
| P-glycoprotein substrates identified in KB-8-5-11 adenocarcinoma cell line, qHTS therapeutic library screen | 14.581 uM | PMID:31515284 |
| Primary qHTS assay for inhibitors of human arachidonate 12S-lipoxygenase (ALOX12): Round 2 | 35.4813 uM | pubchem.aid:1671190 |
| Primary qHTS assay for inhibitors of human arachidonate 12S-lipoxygenase (ALOX12): Round 2 | 35.4813 uM | pubchem.aid:1671190 |
| Primary qHTS for inhibitors of NSP2Pro chikungunya virus (CHIKV) | 11.0903 uM | pubchem.aid:1964107 |
| Primary qHTS to identify inhibitors of SARS-CoV-2 cell entry | 17.7828 uM | pubchem.aid:1645846 |
| Rat pregnane X receptor (rPXR) activation by small molecules, qHTS assay | 15.8489 uM | pubchem.aid:1346983 |
| qHTS Assay for Identifying Gametocytocidal Compounds | 35.4813 uM | pubchem.aid:743244 |
| qHTS assay for identifying genotoxic compounds that show differential cytotoxicity against isogenic chicken DT40 cell lines with known DNA damage response pathways - Rad54/Ku70 mutant cell line | 11.8832 uM | pubchem.aid:743015 |
| qHTS assay for identifying genotoxic compounds that show differential cytotoxicity against isogenic chicken DT40 cell lines with known DNA damage response pathways - Rev3 mutant cell line | 13.3332 uM | pubchem.aid:743014 |
| qHTS assay for identifying genotoxic compounds that show differential cytotoxicity against isogenic chicken DT40 cell lines with known DNA damage response pathways - wild type cell line | 7.4978 uM | pubchem.aid:743012 |
| qHTS assay for small molecule agonists of the p53 signaling pathway | 29.8493 uM | pubchem.aid:651631 |
| qHTS assay for small molecule agonists of the p53 signaling pathway - cell viability | 33.4915 uM | pubchem.aid:651633 |
| qHTS assay for small molecule agonists of the p53 signaling pathway: Summary | 29.8493 uM | pubchem.aid:720552 |
| qHTS assay for small molecule disruptors of the mitochondrial membrane potential | 1.8834 uM | pubchem.aid:720635 |
| qHTS assay for small molecule disruptors of the mitochondrial membrane potential - cell viability | 33.4915 uM | pubchem.aid:720634 |
| qHTS assay for small molecules that induce genotoxicity in human embryonic kidney cells expressing luciferase-tagged ATAD5 | 26.6032 uM | pubchem.aid:651632 |
| qHTS assay for small molecules that induce genotoxicity in human embryonic kidney cells expressing luciferase-tagged ATAD5 - cell viability | 23.7101 uM | pubchem.aid:651634 |
| qHTS assay for small molecules that induce genotoxicity in human embryonic kidney cells expressing luciferase-tagged ATAD5: Summary | 31.0171 uM | pubchem.aid:720516 |
| qHTS assay to identify aromatase inhibitors | 33.4915 uM | pubchem.aid:743083 |
| qHTS assay to identify aromatase inhibitors - cell viability counter screen | 33.4915 uM | pubchem.aid:743084 |
| qHTS assay to identify small molecule agonists of the androgen receptor (AR) signaling pathway | 16.9301 uM | pubchem.aid:743036 |
| qHTS assay to identify small molecule agonists of the androgen receptor (AR) signaling pathway: Summary | 26.8325 uM | pubchem.aid:743053 |
| qHTS assay to identify small molecule agonists of the estrogen receptor alpha (ER-alpha) signaling pathway | 10.6822 uM | pubchem.aid:743075 |
| qHTS assay to identify small molecule agonists of the peroxisome proliferator-activated receptor gamma (PPARg) signaling pathway | 21.3138 uM | pubchem.aid:743094 |
| qHTS assay to identify small molecule antagonists of the androgen receptor (AR) signaling pathway | 26.8325 uM | pubchem.aid:743035 |
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000656 | MIBIG | 5 |
| CHEBI:27547 | CHEBI | 3-star |
This page is generated from data/natural_products/terpenoids/zeaxanthin.yaml, which is generated from the committed inventories. Neither is edited by hand.