aflatoxin B1
CHEBI:2504 EXACT SEEDED toxin
An aflatoxin having a tetrahydrocyclopenta[c]furo[3',2':4,5]furo[2,3-h]chromene skeleton with oxygen functionality at positions 1, 4 and 11.
Structure
| Standard InChIKey | OQIQSTLJSLGHID-WNWIJWBNSA-N |
|---|---|
| SMILES | COc1cc2c(c3oc(=O)c4c(c13)CCC4=O)[C@@H]1C=CO[C@@H]1O2 |
| Stereochemistry | fully defined |
| Cross-references | pubchem:186907, chembl:CHEMBL1697694 |
Filing pathway
Unclassified — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is pks, from MIBiG.
Producer organisms 5
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Aspergillus flavus NCBITaxon:5059 |
SOURCE_ASSERTION | mibig:BGC0000006 | DOI:10.1094/phyto-79-808 |
| Aspergillus flavus NCBITaxon:5059 |
SOURCE_ASSERTION | mibig:BGC0000007 | DOI:10.1007/s00253-002-1094-5 |
| Aspergillus flavus NCBITaxon:5059 |
SOURCE_ASSERTION | mibig:BGC0000008 | DOI:10.1371/journal.pone.0199169 |
| Aspergillus nomius NCBITaxon:41061 |
SOURCE_ASSERTION | mibig:BGC0000009 | DOI:10.1007/bf00393843 |
| Aspergillus ochraceoroseus NCBITaxon:138278 |
SOURCE_ASSERTION | mibig:BGC0000011 | DOI:10.1080/15572536.2006.11832818 |
Occurrences 6
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Streptomyces roseolus NCBITaxon:67358 |
LOTUS | DOI:10.3390/TOXINS10110442 |
| Glycyrrhiza uralensis NCBITaxon:74613 |
LOTUS | DOI:10.1016/J.FOODCONT.2012.11.028 |
| Homo sapiens NCBITaxon:9606 |
CHEBI | 10.1038/nbt.2488 |
| Homo sapiens NCBITaxon:9606 |
LOTUS | DOI:10.1007/S11306-016-1051-4 |
| Homo sapiens NCBITaxon:9606 |
LOTUS | DOI:10.1038/NBT.2488 |
| Aspergillus flavus NCBITaxon:5059 |
LOTUS | DOI:10.1007/S10600-009-9433-8 |
Biosynthetic gene clusters 5
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000006 | Aspergillus flavus NCBITaxon:5059 |
CLUSTER_UNSTATED | genbank:AY510451.1 |
| mibig:BGC0000007 | Aspergillus flavus NCBITaxon:5059 |
CLUSTER_UNSTATED | genbank:AY510452.1 |
| mibig:BGC0000008 | Aspergillus flavus NCBITaxon:5059 |
CLUSTER_UNSTATED | genbank:AY510453.1 |
| mibig:BGC0000009 | Aspergillus nomius NCBITaxon:41061 |
CLUSTER_UNSTATED | genbank:AY510454.1 |
| mibig:BGC0000011 | Aspergillus ochraceoroseus NCBITaxon:138278 |
CLUSTER_UNSTATED | genbank:AY092402.3 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Bioactivities 5
| Assay | Result | Reference |
|---|---|---|
| Assay of Substrate Hydrolysis from Article 10.1021/bi401043w: "The natural product dihydrotanshinone I provides a prototype for uncharged inhibitors that bind specifically to the acetylcholinesterase peripheral site with nanomolar affinity." | KI 28 uM | PMID:24040835 |
| Bacterial reverse mutation test (aka Ames test) summary data | ACTIVE | pubchem.aid:2202554 |
| CCRIS carcinogenicity studies | ACTIVE | pubchem.aid:1259411 |
| CCRIS mutagenicity studies | ACTIVE | pubchem.aid:1259407 |
| GENE-TOX mutagenicity studies | ACTIVE | pubchem.aid:1259408 |
Open questions 1
shared-structure — This structure is reported by more than one MIBiG entry: BGC0000006, BGC0000007, BGC0000008, BGC0000009, BGC0000011. Confirm they describe the same compound rather than an upstream cross-reference error.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000006 | MIBIG | 3 |
| BGC0000007 | MIBIG | 3 |
| BGC0000008 | MIBIG | 3 |
| BGC0000009 | MIBIG | 3 |
| BGC0000011 | MIBIG | 3 |
| CHEBI:2504 | CHEBI | 3-star |
This page is generated from data/natural_products/unclassified/aflatoxin-b1.yaml, which is generated from the committed inventories. Neither is edited by hand.