asperphenamate
CHEBI:145105 EXACT SEEDED
A carboxylic ester resulting from the formal condensation of the carboxy group of N-benzoyl-L-phenylalanine with the hydroxy group of N-benzoyl-L-phenylalaninol. A metabolite found in several Pencillium and Aspergillus species, as well as in plants as a product of endophytic fungi.
Structure
| Standard InChIKey | CVULDJMCSSACEO-VMPREFPWSA-N |
|---|---|
| SMILES | C1=CC=C(C=C1)C[C@@H](COC(=O)[C@H](CC2=CC=CC=C2)NC(=O)C3=CC=CC=C3)NC(=O)C4=CC=CC=C4 |
| Stereochemistry | fully defined |
Filing pathway
Unclassified — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is nrps, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Aspergillus terreus NIH2624 NCBITaxon:341663 |
SOURCE_ASSERTION | mibig:BGC0001517 | DOI:10.1016/j.taap.2012.05.018 |
Occurrences 18
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Penicillium spathulatum NCBITaxon:1263194 |
LOTUS | DOI:10.1055/S-0042-111393 |
| Penicillium spathulatum NCBITaxon:1263194 |
LOTUS | DOI:10.1055/S-0042-111394 |
| Penicillium spathulatum NCBITaxon:1263194 |
CHEBI | PMID:27399232 |
| Melastoma malabathricum NCBITaxon:128733 |
LOTUS | DOI:10.1007/S11418-010-0431-8 |
| Croton hieronymi NCBITaxon:2896018 |
LOTUS | DOI:10.1016/S0031-9422(03)00202-4 |
| Ficus mucuso NCBITaxon:309328 |
CHEBI | PMID:21139276 |
| Anaphalis subumbellata NCBITaxon:3749087 |
LOTUS | DOI:10.1021/NP50025A017 |
| Sapium rigidifolium NCBITaxon:3877711 |
LOTUS | DOI:10.1016/0031-9422(93)85112-5 |
| Piptadenia gonoacantha NCBITaxon:397634 |
CHEBI | PMID:21562684 |
| Aspergillus flavipes NCBITaxon:41900 |
LOTUS | DOI:10.1016/0014-5793(68)80090-0 |
| Aspergillus flavipes NCBITaxon:41900 |
CHEBI | PMID:875642 |
| Leucas aspera NCBITaxon:483811 |
LOTUS | DOI:10.1021/NP058118M |
| Penicillium brevicompactum NCBITaxon:5074 |
LOTUS | DOI:10.1016/0031-9422(82)85217-5 |
| Penicillium brevicompactum NCBITaxon:5074 |
CHEBI | PMID:16345939 |
| Penicillium megasporum NCBITaxon:69778 |
LOTUS | DOI:10.1016/0031-9422(89)80145-1 |
| Artemisia anomala NCBITaxon:714449 |
LOTUS | DOI:10.1016/S0031-9422(00)83589-X |
| Grangea maderaspatana NCBITaxon:72940 |
LOTUS | DOI:10.1016/S0031-9422(99)00388-X |
| Begonia nantoensis NCBITaxon:78253 |
LOTUS | DOI:10.1002/CHIN.200434239 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0001517 | Aspergillus terreus NIH2624 NCBITaxon:341663 |
CLUSTER_UNSTATED | genbank:NT_165937.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0001517 | MIBIG | 3 |
| CHEBI:145105 | CHEBI | 3-star |
This page is generated from data/natural_products/unclassified/asperphenamate.yaml, which is generated from the committed inventories. Neither is edited by hand.