fosfomycin
CHEBI:28915 EXACT SEEDED antibacterial
A phosphonic acid having an (R,S)-1,2-epoxypropyl group attached to phosphorus.
Structure
| Standard InChIKey | YMDXZJFXQJVXBF-STHAYSLISA-N |
|---|---|
| SMILES | C[C@H]1[C@H](O1)[P](=O)(O)O |
| Stereochemistry | fully defined |
| Cross-references | pubchem:73491, pubchem:446987 |
Filing pathway
Unclassified — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is other, from MIBiG.
Producer organisms 2
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Streptomyces fradiae NCBITaxon:1906 |
SOURCE_ASSERTION | mibig:BGC0000938 | DOI:10.1016/j.chembiol.2006.09.007 |
| Pseudomonas syringae NCBITaxon:317 |
SOURCE_ASSERTION | mibig:BGC0001859 | PMID:22615277 |
Occurrences 19
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Streptomyces NCBITaxon:1883 |
LOTUS | DOI:10.1016/J.BMC.2018.05.017 |
| Pseudomonas viridiflava NCBITaxon:33069 |
LOTUS | DOI:10.7164/ANTIBIOTICS.43.238 |
| Arabidopsis thaliana NCBITaxon:3702 |
LOTUS | DOI:10.1007/S00425-002-0762-0 |
| Streptomyces wedmorensis NCBITaxon:43759 |
LOTUS | DOI:10.1007/BF00290527 |
| Streptomyces wedmorensis NCBITaxon:43759 |
LOTUS | DOI:10.1016/J.ABB.2013.12.004 |
| Streptomyces wedmorensis NCBITaxon:43759 |
LOTUS | DOI:10.1107/S1744309105012376 |
| Streptomyces wedmorensis NCBITaxon:43759 |
LOTUS | DOI:10.1128/AAC.44.3.647-650.2000 |
| Streptomyces wedmorensis NCBITaxon:43759 |
LOTUS | DOI:10.1271/BBB1961.49.873 |
| Streptomyces wedmorensis NCBITaxon:43759 |
LOTUS | DOI:10.7164/ANTIBIOTICS.44.1286 |
| Streptomyces wedmorensis NCBITaxon:43759 |
LOTUS | DOI:10.7164/ANTIBIOTICS.45.1008 |
| Streptomyces wedmorensis NCBITaxon:43759 |
LOTUS | DOI:10.7164/ANTIBIOTICS.45.1812 |
| Streptomyces wedmorensis NCBITaxon:43759 |
LOTUS | DOI:10.7164/ANTIBIOTICS.49.502 |
| Streptomyces fradiae NCBITaxon:1906 |
LOTUS | DOI:10.1002/ANIE.199403411 |
| Streptomyces fradiae NCBITaxon:1906 |
LOTUS | DOI:10.1021/ACS.BIOCHEM.8B00693 |
| Streptomyces fradiae NCBITaxon:1906 |
LOTUS | DOI:10.1039/P19910001993 |
| Streptomyces fradiae NCBITaxon:1906 |
LOTUS | DOI:10.1126/SCIENCE.166.3901.122 |
| Streptomyces fradiae NCBITaxon:1906 |
LOTUS | DOI:10.1128/AAC.5.2.121 |
| Pseudomonas syringae NCBITaxon:317 |
LOTUS | DOI:10.1128/AAC.06478-11 |
| Pseudomonas syringae NCBITaxon:317 |
LOTUS | DOI:10.7164/ANTIBIOTICS.39.1011 |
Biosynthetic gene clusters 2
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0000938 | Streptomyces fradiae NCBITaxon:1906 |
CLUSTER_DEMONSTRATED | genbank:EU924263.1 |
| mibig:BGC0001859 | Pseudomonas syringae NCBITaxon:317 |
CLUSTER_DEMONSTRATED | genbank:JX102649.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Elsewhere in the fleet
- AntibioticMech — CHEBI:28915 (same structure, same inchikey)
Open questions 1
shared-structure — This structure is reported by more than one MIBiG entry: BGC0000938, BGC0001859. Confirm they describe the same compound rather than an upstream cross-reference error.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0000938 | MIBIG | 5 |
| BGC0001859 | MIBIG | 4 |
| CHEBI:28915 | CHEBI | 3-star |
This page is generated from data/natural_products/unclassified/fosfomycin.yaml, which is generated from the committed inventories. Neither is edited by hand.