paxilline
CHEBI:34907 EXACT SEEDED
An indole diterpene alkaloid with formula C27H33NO4 isolated from Penicillium paxilli. It is a potent inhibitor of large conductance Ca2+- and voltage-activated K+ (BK)-type channels.
Structure
| Standard InChIKey | ACNHBCIZLNNLRS-UBGQALKQSA-N |
|---|---|
| SMILES | CC(C)(O)[C@H]1O[C@H]2CC[C@@]3(C)[C@@](O)(CC[C@H]4CC5=C([NH]C6=CC=CC=C56)[C@@]43C)C2=CC1=O |
| Stereochemistry | fully defined |
| Cross-references | npatlas:NPA028977 |
Filing pathway
Unclassified — computed by NPClassifier npclassifier.gnps2.org@2026-09-07, which is why it is pinned rather than recomputed. The gene cluster's asserted class is terpene, from MIBiG.
Producer organisms 1
A claim that this taxon makes the compound. The basis says what the evidence addressed — a knockout and a database assertion are not the same claim.
| Taxon | Basis | Cluster | Evidence |
|---|---|---|---|
| Penicillium paxilli NCBITaxon:70109 |
BGC_CHARACTERIZED | mibig:BGC0001082 | DOI:10.1021/ja3116636 |
Occurrences 24
Somebody found the compound in this organism and cited it. That is not a claim that the organism makes it, and nothing here promotes one to the other.
| Taxon | Source | Reference |
|---|---|---|
| Penicillium thiersii NCBITaxon:116978 |
LOTUS | DOI:10.1021/OL026424A |
| Emericella desertorum NCBITaxon:1810909 |
LOTUS | DOI:10.1016/B978-0-12-179760-7.50023-1 |
| Emericella desertorum NCBITaxon:1810909 |
LOTUS | DOI:10.1039/P19870001735 |
| Emericella desertorum NCBITaxon:1810909 |
LOTUS | DOI:10.1039/P19880001689 |
| Emericella desertorum NCBITaxon:1810909 |
LOTUS | DOI:10.1248/CPB.37.1387 |
| Aspergillus foveolatus NCBITaxon:210207 |
LOTUS | DOI:10.1248/CPB.37.1387 |
| Penicillium miczynskii NCBITaxon:36645 |
LOTUS | DOI:10.1016/0040-4020(95)00138-X |
| Claviceps paspali NCBITaxon:40601 |
LOTUS | DOI:10.1021/JF902208W |
| Lolium perenne NCBITaxon:4522 |
LOTUS | DOI:10.1016/S0031-9422(00)82327-4 |
| Aspergillus striatus NCBITaxon:469280 |
LOTUS | DOI:10.1248/CPB.34.2411 |
| Aspergillus striatus NCBITaxon:469280 |
LOTUS | DOI:10.1248/CPB.37.1387 |
| Aspergillus oryzae NCBITaxon:5062 |
CHEBI | PMID:23311903 |
| Penicillium camemberti NCBITaxon:5075 |
LOTUS | DOI:10.1021/NP400304Q |
| Penicillium shearii NCBITaxon:904690 |
CHEBI | PMID:24894186 |
| Penicillium paxilli NCBITaxon:70109 |
LOTUS | DOI:10.1016/B978-0-12-179760-7.50024-3 |
| Penicillium paxilli NCBITaxon:70109 |
LOTUS | DOI:10.1016/S0003-2670(00)82471-X |
| Penicillium paxilli NCBITaxon:70109 |
LOTUS | DOI:10.1016/S0031-9422(00)82327-4 |
| Penicillium paxilli NCBITaxon:70109 |
LOTUS | DOI:10.1016/S0031-9422(00)89639-9 |
| Penicillium paxilli NCBITaxon:70109 |
LOTUS | DOI:10.1016/S0040-4039(00)75170-7 |
| Penicillium paxilli NCBITaxon:70109 |
LOTUS | DOI:10.1021/JO00124A016 |
| Penicillium paxilli NCBITaxon:70109 |
LOTUS | DOI:10.1021/NP50005A017 |
| Penicillium paxilli NCBITaxon:70109 |
LOTUS | DOI:10.1046/J.1365-2958.2001.02265.X |
| Penicillium paxilli NCBITaxon:70109 |
LOTUS | DOI:10.1248/CPB.55.1383 |
| Penicillium paxilli NCBITaxon:70109 |
CHEBI | PMID:17428785 |
Biosynthetic gene clusters 1
| Accession | Host | Locus evidence | Genome |
|---|---|---|---|
| mibig:BGC0001082 | Penicillium paxilli NCBITaxon:70109 |
CLUSTER_DEMONSTRATED | genbank:HM171111.1 |
A locus claim and a taxon claim are different questions. Heterologous expression settles the first and leaves the second where the isolation report left it.
Provenance
| Source concept | Source | Version |
|---|---|---|
| BGC0001082 | MIBIG | 4 |
| CHEBI:34907 | CHEBI | 3-star |
This page is generated from data/natural_products/unclassified/paxilline.yaml, which is generated from the committed inventories. Neither is edited by hand.